GLSynthesis offers a growing catalog of specialty chemicals. For ordering information, write to support@glsynthesis.com or phone 508-754-6700, ext 100.
Catalog # |
Name |
CAS |
Structure |
Price |
Purity |
Ac-1001 |
3-(4-methyl-2,5-dioxo-2,5-dihydrofuran-3-yl) propanoic acid |
487-66-1 |
|
$120 for 1 g $380 for 5 g |
98% |
Ac-1002 |
5-octanoyl salicyclic acid |
78418-01-6 |
Picture 24.
|
$120 for 1 g |
98% |
Ac-1003 |
ethyl isocyanoacetate |
2999-46-4 |
|
$250 for 100 g $980 for 1 kg |
98% |
Ac-1004 |
(Z)-3-cyanoacrylicacidethylester,ethyl-cis-(BETA-cyano)acrylate |
40594-97-6 |
Picture 1734.
|
$250 for 5 g $390 for 10 g |
98% |
Ac-1005 |
3-bromo-2-hydroxybenzoicacid |
3883-95-2 |
Picture 1741.
|
$150 for 10 g $250 for 25 g |
98% |
Ac-1006 |
2,3-Dihydroxybenzoicacid |
303-38-8 |
Picture 1729.
|
|
98% |
Ac-1007 |
methyl-2,3-dihydroxybenzoate |
2411-83-8 |
Picture 1726.
|
$120 for 10 g |
98% |
Ac-1008 |
ethyl 2-Mercaptocyclohex-1-enecarboxylate |
54928-91-5 |
Picture 39.
|
|
98% |
Ac-1009 |
1-Cyclohexene-1-carboxylicacid,2-sulfo-,1-ethylester |
243984-25-0 |
Picture 40.
|
|
98% |
Ac-1010 |
3-Pyridinecarboxylicacid,4-methyl- |
3222-50-2 |
Picture 64.
|
|
98% |
Ac-1011 |
Benzoicacid,2-(acetylamino)- |
89-52-1 |
Picture 65.
|
|
98% |
Ac-1012 |
4-Pentenoicacid,4-chloro-2,2-dimethyl-,ethylester |
118427-36-4 |
Picture 76.
|
$280 for 1 g $980 for 5 g |
98% |
Ac-1013 |
Pentanoicacid,5-bromo-2,2-dimethyl-4-oxo-,ethylester |
154325-75-4 |
Picture 77.
|
$350 for 1 g |
98% |
Ac-1014 |
2-Piperidineaceticacid |
19832-04-3 |
Picture 122.
|
$180 for 1 g $500 for 5 g |
98% |
Ac-1015 |
2-Piperidineaceticacid,1-[(1,1-dimethylethoxy)carbonyl]- |
149518-50-3 |
Picture 98.
|
$100 for 1 g $300 for 5 g |
98% |
Ac-1016 |
1,2-Piperidinedicarboxylicacid,4-oxo-,1-(1,1-dimethylethyl)ester |
661458-35-1 |
Picture 1009.
|
$120 for 1 g $350 for 5 g |
98% |
Ac-1017 |
3-Pentene-1,3,4-tricarboxylicacid,1,3,4-triethylester |
154222-94-3 |
Picture 121.
|
|
98% |
Ac-1018 |
1H-Pyrrole-3-carboxylicacid,5-acetyl-2,4-dimethyl- |
17106-15-9 |
Picture 125.
|
$200 for 1 g $750 for 5 g |
98% |
Ac-1019 |
1,3-Dioxolan-4-one,2,2-dimethyl-5-phenyl- |
6337-34-4 |
Picture 232.
|
|
98% |
Ac-1020 |
Benzeneaceticacid,2-cyclopentyl-2-hydroxy-,(2S)- |
64471-43-8 |
Picture 535.
|
|
98% |
Ac-1021 |
Benzeneaceticacid,2-1-cyclopenten-1-yl-2-hydroxy-,(2S) |
302842-81-5 |
Picture 545.
|
|
98% |
Ac-1022 |
1,3-Dioxolan-4-one,2,5-diphenyl- |
56535-98-9 |
Picture 549.
|
|
98% |
Ac-1023 |
1,3-Dioxolan-4-one,2-(1,1-dimethylethyl)-5-phenyl- |
666835-66-1 |
Picture 671.
|
|
98% |
Ac1024 |
(S)-2-(cyclopent-1-en-1-yl)-2-phenylpropanoicacid |
N/A |
Picture 1290.
|
|
98% |
Ac-1025 |
3-tert-butyl5-methyl4-benzyl-2,2-dimethyloxazolidine-3,5-dicarboxylate |
203806-77-3 |
Picture 1184.
|
|
98% |
Ac-1026 |
(5R)-2-(tert-butyl)-5-(1-hydroxycyclohexyl)-5-phenyl-1,3-dioxan-4-one |
N/A |
Picture 534.
|
|
98% |
Ac-1027 |
2-(tert-butyl)-5-(1-pyrrolidin-3-yl)-5-phenyl-1,3-dioxan-4-one |
N/A |
Picture 688.
|
|
98% |
Ac-1028 |
Butanoicacid,3-[[(1,1-dimethylethoxy)carbonyl]amino]-4-hydroxy-,1,1-dimethylethylester |
1393721-08-8 |
Picture 251.
|
|
98% |
Ac-1029 |
Asparticacid, N-[(1,1-dimethylethoxy)carbonyl]-,4-(1,1-dimethylethyl)ester |
1016259-17-8 |
Picture 253.
|
|
98% |
Ac-1030 |
Aceticacid,2-[2-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]ethoxy]- |
75001-09-1 |
Picture 267.
|
$580 for 5 g |
98% |
Ac-1031 |
2H-Isoindole-2-aceticacid,1,3-dihydro-2-(2-methylpropyl)-1,3-dioxo- |
19506-89-9 |
Picture 290.
|
$150 for 1 g |
98% |
Ac-1032 |
[1,1'-Biphenyl]-4-carboxylicacid,4'-fluoro- |
5731-10-2 |
Picture 527.
|
|
98% |
Ac-1033 |
Benzoicacid,3-[4-(trifluoromethyl)phenoxy]- |
72178-29-1 |
Picture 881.
|
$450 for 1 g |
98% |
Ac-1034 |
4H-Pyran-2,6-dicarboxylicacid,4-oxo- |
99-32-1 |
Picture 1129.
|
$200 for 25 g |
98% |
Ac-1035 |
chelidamicacid,1,4-dihydro-4-oxo-2,6-pyridinedicarboxylicacid |
138-60-3 |
Picture 1389.
|
|
98% |
Ac-1037 |
[1,1'-Biphenyl]-2-carboxylicacid,4'-fluoro- |
1841-57-2 |
Picture 294.
|
$250 for 5 g |
98% |
Ac-1038 |
Ethanethioicacid, S-(1,1-dimethylethyl)ester |
999-90-6 |
Picture 374.
|
|
98% |
Ac-1039 |
1-Naphthalenecarboxylicacid,1,2,3,4-tetrahydro-7-methoxy-,(1R)- |
405103-12-0 |
Picture 410.
|
|
98% |
Ac-1040 |
1-Naphthalenecarboxylicacid,1,2,3,4-tetrahydro-7-methoxy-,(1S)-,compd.with(2S)-2-methylbenzenemethanamine(1:1)(9CI) |
405103-15-3 |
Picture 411.
|
|
98% |
Ac-1041 |
1H-Pyrrole-2-carboxylicacid,4-[2-(4-chlorophenyl)ethyl]-,ethylester |
856256-79-6 |
Picture 419.
|
|
98% |
Ac-1042 |
Benzoicacid,4-(methylsulfonyl)-3-nitro- |
81029-08-5 |
Picture 466.
|
$500 for 5 g $850 for 10 g |
98% |
Ac-1043 |
Benzoicacid,2-bromo-3-chloro- |
56961-26-3 |
Picture 500.
|
$200 for 10 g |
98% |
Ac-1044 |
Aceticacid,2-[(phenylthioxomethyl)thio]- |
942-91-6 |
Picture 593.
|
$580 for 100 g |
98% |
Ac-1045 |
1(2H)-Pyrimidineaceticacid,tetrahydro-2-(1-methylethyl)-2-oxo-,(2R)- |
1370045-08-1 |
Picture 604.
|
|
98% |
Ac-1046 |
L-Valine, N-(3-cyanopropyl)- |
1189553-33-0 |
Picture 609.
|
|
98% |
Ac-1047 |
4-Pentynoicacid,2-[[(1,1-dimethylethoxy)carbonyl]amino]-,methylester |
173306-82-6 |
Picture 615.
|
|
98% |
Ac-1048 |
Benzenepropanoicacid,4-nitro-2-oxo- |
38335-24-9 |
Picture 636.
|
$150 for 1 g $450 for 5 g |
98% |
Ac-1049 |
2-Pyridinecarboxylicacid,4-propyl- |
87999-87-9 |
Picture 739.
|
|
98% |
Ac-1050 |
Benzoicacid,4-amino-2,3-difluoro-5-nitro- |
284030-57-5 |
Picture 743.
|
$250 for 5 g |
98% |
Ac-1051 |
Pentanoicacid,2-(hydroxymethyl)-,(2R)- |
875125-87-4 |
Picture 746.
|
$780 for 1 g |
98% |
Ac-1052 |
Benzoicacid,3-[[[[4-(trifluoromethyl)phenyl]amino]carbonyl]amino]- |
244156-66-9 |
Picture 749.
|
|
98% |
Ac-1053 |
Pentanoicacid,2-[(acetylthio)methyl]-4-methyl- |
76789-49-6 |
Picture 584.
|
|
98% |
Ac-1054 |
Butanoicacid,2-[(acetylthio)methyl]-3-methyl-,(2S)- |
176959-58-3 |
Picture 762.
|
|
98% |
Ac-1055 |
Pentanoicacid,2-[(acetylthio)methyl]-4-methyl-,(2S)- |
632333-34-7 |
Picture 763.
|
|
98% |
Ac-1046 |
L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-fluoro- |
41153-30-4 |
Picture 767.
|
$250 for 25 g |
98% |
Ac-1047 |
Propanoicacid,3-(acetylthio)-2,2-dimethyl- |
106517-45-7 |
Picture 776.
|
|
98% |
Ac-1048 |
Cyclohexanecarboxylicacid,1-[(acetylthio)methyl]- |
149705-49-7 |
Picture 777.
|
|
98% |
Ac-1049 |
Cyclopentanecarboxylicacid,1-[(acetylthio)methyl]- |
137613-93-5 |
Picture 778.
|
|
98% |
Ac-1050 |
2-Naphthalenepropanoicacid,2-[(acetylthio)methyl]- |
115355-29-8 |
Picture 959.
|
|
98% |
Ac-1051 |
Cyclohexanepropanoicacid,2-[(acetylthio)methyl]- |
89022-01-5 |
Picture 963.
|
|
98% |
Ac-1052 |
2-Naphthalenepropanoicacid,2-(acetylthio)-,(2S)- |
1013313-64-8 |
Picture 966.
|
|
98% |
Ac-1053 |
Pentanoicacid,2-(acetylthio)-3-methyl- |
149603-95-2 |
Picture 967.
|
|
98% |
Ac-1054 |
Benzenepropanoicacid,2-[(acetylthio)methyl]-4-chloro- |
115355-27-6 |
Picture 971.
|
|
98% |
Ac-1055 |
Benzenepropanoicacid,2-(acetylthio)-BETA-methyl- |
174625-34-4 |
Picture 973.
|
|
98% |
Ac-1056 |
[1,1'-Biphenyl]-4-propanoicacid,2-(acetylthio)- |
167090-24-6 |
Picture 976.
|
|
98% |
Ac-1057 |
Benzenepropanoicacid,2-[(acetylthio)methyl]- |
91702-98-6 |
Picture 979.
|
|
98% |
Ac-1058 |
Hexanoicacid,2-(acetylthio)- |
188001-87-8 |
Picture 984.
|
|
98% |
Ac-1059 |
Hexanoicacid,2-(acetylthio)-5-methyl- |
139719-26-9 |
Picture 989.
|
|
98% |
Ac-1060 |
3-(acetylthio)-2-(cyclopentylmethyl)propanoicacid |
N/A |
Picture 1344.
|
|
98% |
Ac-1061 |
2-(acetylthio)-3-(2-bromophenyl)propanoicacid |
N/A |
Picture 1345.
|
|
98% |
Ac-1062 |
2-((acetylthio)methyl)-4-ethylhexanoicacid |
N/A |
Picture 1347.
|
|
98% |
Ac-1063 |
Cyclohexanecarboxylicacid,1-(hydroxymethyl)- |
55987-28-5 |
Picture 781.
|
|
98% |
Ac-1064 |
Cyclopentanecarboxylicacid,1-(hydroxymethyl)- |
102539-92-4 |
Picture 782.
|
|
98% |
Ac-1065 |
[1,1'-Bicyclobutyl]-1,1'-dicarboxylicacid |
99173-29-2 |
Picture 786.
|
|
98% |
Ac-1066 |
Butanoicacid,4,4'-(1,5-naphthalenediyldiimino) bis[4-oxo-] |
293761-46-3 |
Picture 790.
|
|
98% |
Ac-1067 |
1,2-Benzenedicarboxylicacid,4,5-dichloro- |
56962-08-4 |
Picture 834.
|
|
98% |
Ac-1068 |
Benzoicacid,4,5-dimethoxy-2-nitro- |
4998-07-6 |
Picture 574.
|
|
98% |
Ac-1069 |
Benzoicacid,2-hydroxy-4,5-dimethoxy- |
5722-93-0 |
Picture 264.
|
$350 for 25 g |
98% |
Ac-1070 |
1-Naphthaleneaceticacid,5-(2,2-dimethyl-1-oxopropoxy)-3,4-dihydro-,ethylester |
439803-38-0 |
Picture 100.
|
|
98% |
Ac-1071 |
1H-Pyrrole-2-carboxylicacid,4-(2-phenylethyl)- |
856256-73-0 |
Picture 822.
|
|
98% |
Ac-1072 |
Butanoicacid,2-(hydroxymethyl)-3-methyl- |
116049-20-8 |
Picture 840.
|
|
98% |
Ac-1073 |
L-Serine, N-[[2-(phenylthio)ethoxy]carbonyl]- |
676531-72-9 |
Picture 851.
|
|
98% |
Ac-1074 |
Benzeneaceticacid,4-methyl-2-phenyl- |
1882-56-0 |
Picture 864.
|
$350 for 1 g |
98% |
Ac-1075 |
Undecanoicacid,11-bromo- |
2834-05-1 |
Picture 876.
|
|
98% |
Ac-1076 |
1,3-Benzodioxole-4-carboxylicacid,5-chloro- |
379229-83-1 |
Picture 891.
|
$300 for 1 g $950 for 5 g |
98% |
Ac-1077 |
Propanedioicacid,2-[(4-methylbenzoyl)amino]-,1,3-diethylester |
141820-20-4 |
Picture 899.
|
|
98% |
Ac-1078 |
2-Pyridinecarboxylicacid,4-chloro-,methylester,hydrochloride(1:1) |
176977-85-8 |
Picture 901.
|
|
98% |
Ac-1079 |
Aceticacid,2-(2-oxocyclopentylidene)- |
91747-26-1 |
Picture 942.
|
$390 for 1 g |
98% |
Ac-1080 |
Propanedioicacid,2-[(2-bromophenyl)methyl]-,1-ethylester |
1094202-39-7 |
Picture 964.
|
|
98% |
Ac-1081 |
Propanedioicacid,2-(2-ethylbutyl)-,1-ethylester |
1566013-04-4 |
Picture 980.
|
|
98% |
Ac-1082 |
1-Naphthalenepropanoicacid,2-methylene- |
139263-24-4 |
Picture 982.
|
|
98% |
Ac-1083 |
Cyclohexanepropanoicacid,2-methylene- |
131330-80-8 |
Picture 983.
|
|
98% |
Ac-1084 |
3-(2-bromophenyl)prop-1-en-2-ylformate |
1896743-05-7 |
Picture 1353.
|
|
98% |
Ac-1085 |
4-Pyrimidinecarboxylicacid,2,6-dichloro- |
16492-28-7 |
Picture 985.
|
$150 for 5 g |
98% |
Ac-1086 |
2-Propenoicacid,3-phenyl-,phenylmethylester |
103-41-3 |
Picture 990.
|
|
98% |
Ac-1087 |
2-Propenoicacid,3-(2-methoxyphenyl)-,phenylmethylester |
475066-13-8 |
Picture 991.
|
|
98% |
Ac-1088 |
Benzoicacid,5-chloro-2-[(phenoxycarbonyl)amino]-,methylester |
1478021-53-2 |
Picture 1027.
|
|
98% |
Ac-1089 |
Benzenebutanoicacid,2-hydroxy-,ethylester |
7226-83-7 |
Picture 1047.
|
|
98% |
Ac-1090 |
(S)-7-((tert-butoxycarbonyl)amino)-2-methylheptanoicacid |
N/A |
Picture 1087.
|
|
98% |
Ac-1091 |
1,2-Piperidinedicarboxylicacid,4-propyl-,1-(1,1-dimethylethyl)ester |
941585-67-7 |
Picture 1106.
|
|
98% |
Ac-1092 |
3-((2-cyanoethyl)amino)-2,2-dimethylpropanoicacid |
N/A |
Picture 1125.
|
|
98% |
Ac-1093 |
(2E,6E)-3,11-dimethyldodeca-2,6,10-trienoicacid |
N/A |
Picture 1139.
|
|
98% |
Ac-1094 |
(Z)-6-tert-butyl1-ethyl4-((2-(tert-butoxy)-2-oxoethyl)amino)-2-fluorohex-2-enedioate |
N/A |
Picture 1141.
|
|
98% |
Ac-1095 |
8-((tert-butoxycarbonyl)amino)-3,6-dioxooctanoicacid |
N/A |
Picture 1158.
|
|
98% |
Ac-1096 |
1-Naphthalenecarboxylicacid,1,2,3,4-tetrahydro-7-methoxy- |
85858-95-3 |
Picture 1176.
|
$350 for 1 g |
98% |
Ac-1097 |
Benzoicacid,4-fluoro-3-nitro- |
453-71-4 |
Picture 1188.
|
|
98% |
Ac-1098 |
4-(methylthio)-3-(morpholinosulfonyl)benzoicacid |
299181-53-6 |
Picture 1193.
|
|
98% |
Ac-1099 |
4-((1,3,5-trinitrohexahydropyrimidin-5-yl)methoxy)butanoicacid |
N/A |
Picture 1202.
|
|
98% |
Ac-1100 |
(R)-3-(1,3-dioxoisoindolin-2-yl)-3-(formyloxy)propyl2-oxo-2-phenylacetate |
N/A |
Picture 1215.
|
|
98% |
Ac-1101 |
Propanoicacid,3-bromo-2-(bromomethyl)- |
41459-42-1 |
Picture 1239.
|
$150 for 10 g |
98% |
Ac-1102 |
diethyl2,2-bis(hydroxymethyl)succinate |
N/A |
Picture 1240.
|
|
98% |
Ac-1103 |
2-Propenoicacid,3-[3-(trifluoromethyl)phenyl]- |
779-89-5 |
Picture 1266.
|
|
98% |
Ac-1104 |
(1S,8S)-8-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-9-oxooctahydropyridazino[1,2-a]pyridazine-1-carboxylicacid |
N/A |
Picture 1287.
|
|
98% |
Ac-1105 |
1,2-Piperidinedicarboxylicacid,4-oxo-,1-(1,1-dimethylethyl)ester,(2S)- |
198646-60-5 |
Picture 1301.
|
$250 for 5 g |
98% |
Ac-1106 |
(2-(((1-carboxy-2-hydroxyethyl)carbamoyl)oxy)ethyl)(methyl)(phenyl)sulfonium2,2,2-trifluoroacetate |
N/A |
Picture 1334.
|
|
98% |
Ac-1107 |
Benzoicacid,3-(cyclopropylmethoxy)-4-(difluoromethoxy)- |
162401-62-9 |
Picture 1336.
|
|
98% |
Ac-1108 |
3-(cyclopentyloxy)-4-methoxybenzoicacid |
144036-17-9 |
Picture 1516.
|
$300 for 5 g |
98% |
Ac-1109 |
4-(3-(4-(trifluoromethyl)phenyl)ureido)benzoicacid |
244156-67-0 |
Picture 1343.
|
|
98% |
Ac-1110 |
3-((2,4-dinitrophenyl)amino)-4-hydroxy-3-methylbutanoicacid |
N/A |
Picture 1346.
|
|
98% |
Ac-1111 |
2-(naphthalen-2-yl)ethane-1,1-diyldipropionate |
N/A |
Picture 1350.
|
|
98% |
Ac-1112 |
1-(2-((tert-butoxycarbonyl)amino)-3-methylbutanoyl)pyrrolidin-2-yl2-phenylacetate |
N/A |
Picture 1365.
|
|
98% |
Ac-1113 |
isobutyl2-(2-phenylacetoxy)pyrrolidine-1-carboxylate |
N/A |
Picture 1366.
|
|
98% |
Ac-1114 |
1-[2-(2-methoxyethoxy)ethyl]piperidine-4-carboxylicacid |
1409184-86-6 |
Picture 1384.
|
|
98% |
Ac-1115 |
3-azetidinecarboxylicacid |
36476-78-5 |
Picture 1394.
|
|
98% |
Ac-1116 |
(3R,4S)-1-(benzyloxycarbonyl)-4-ethylpyrrolidine-3-carboxylicacid |
1428243-24-6
|
Picture 1397.
|
|
98% |
Ac-1117 |
(3R,4S)-1-(benzyloxycarbonyl)-4-methylpyrrolidine-3-carboxylicacid |
1428243-35-9 1428243-36-0 |
Picture 1398.
|
$190 for 250 mg $580 for 1 g |
98% |
Ac-1118 |
(3S,4R)-1-(benzyloxycarbonyl)-4-methylpyrrolidine-3-carboxylicacid |
N/A |
Picture 1399.
|
|
98% |
Ac-1119 |
(1S,2R)-ethyl4-benzyl-2-ethylcyclopentanecarboxylate |
N/A |
Picture 1408.
|
|
98% |
Ac-1120 |
(1R,2S)-ethyl2-ethyl-4-oxocyclopentanecarboxylate |
1310730-26-7 |
Picture 1435.
|
|
98% |
Ac-1121 |
[(4-N-morpholine-4-sulfonyl)phenyl]boronicacid |
486422-68-8 |
Picture 1436.
|
$100 for 1 g $300 for 5 g |
98% |
Ac-1122 |
2-((3-bromocyclohex-2-enyloxy)carbonyl)benzoicacid |
N/A |
Picture 1500.
|
|
98% |
Ac-1123 |
(S)-2-((3-bromocyclohex-2-enyloxy)carbonyl)benzoicacid |
N/A |
Picture 1501.
|
|
98% |
Ac-1124 |
(R)-2-((3-bromocyclohex-2-enyloxy)carbonyl)benzoicacid |
N/A |
Picture 1502.
|
|
98% |
Ac-1125 |
3-hydroxy-3-phenylpropanamide |
24506-17-0 |
Picture 1519.
|
|
98% |
Ac-1126 |
N-methoxy-N-methyl-3-phenylpropanamide |
170646-96-5 |
Picture 1530.
|
|
98% |
Ac-1127 |
(R)-benzyl2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoatehydrochloride |
N/A |
Picture 1546.
|
|
98% |
Ac-1128 |
(R)-methyl2-((R)-2-((S)-2-(tert-butoxycarbonyl)-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate |
N/A |
Picture 1547.
|
|
98% |
Ac-1129 |
(R)-benzyl2-((R)-2-((S)-2-(tert-butoxycarbonyl)-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate |
049024-22-6 |
Picture 1548.
|
|
98% |
Ac-1130 |
(R)-2-((R)-2-((S)-2-(tert-butoxycarbonyl)-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoicacid |
N/A |
Picture 1549.
|
|
98% |
Ac-1131 |
tert-butyl(S)-1-((R)-4-methyl-1-((R)-1-((S)-4-methyl-1-((S)-2-methyloxiran-2-yl)-1-oxopentan-2-ylamino)-1-oxo-3-phenylpropan-2-ylamino)-1-oxopentan-2-ylamino)-1-oxo-4-phenylbutan-2-ylcarbamate |
N/A |
Picture 1550.
|
|
98% |
Ac-1132 |
(R)-methyl2-((R)-2-((S)-2-(2-chloroacetamido)-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate |
N/A |
Picture 1551.
|
|
98% |
Ac-1133 |
(S)-12-(2-(tert-butoxycarbonyl)-4-methylpentanamido)dodecanoicacid |
391610-91-6 |
Picture 1554.
|
|
98% |
Ac-1134 |
tert-butyl(S)-1-((R)-1-(4-(hydroxymethyl)phenylamino)-1-oxopropan-2-ylamino)-1-oxopropan-2-ylcarbamate |
N/A |
Picture 1555.
|
|
98% |
Ac-1135 |
(1S,13R)-4-((R)-2-((S)-2-(tert-butoxycarbonyl)propanamido)propanamido)benzyl4-nitrophenylcarbonate |
N/A |
Picture 1556.
|
|
98% |
Ac-1136 |
(R)-2-((S)-2-aminopropanamido)propanoicacid |
3695-80-5 |
Picture 1557.
|
|
98% |
Ac-1137 |
isoxepac |
55453-87-7 |
Picture 1563.
|
|
98% |
Ac-1138 |
4-(1-(2-(2-aminoethyl)disulfanyl)ethyl)benzoicacidhydrochloride |
N/A |
Picture 1564.
|
|
98% |
Ac-1139 |
3-((2-aminoethyl)disulfanyl)propanoicacid |
15579-00-7 |
Picture 1565.
|
$450 for 100 mg |
98% |
Ac-1140 |
3-((2-DBCO-amide)ethyldisulfanyl)-propionic acid |
N/A |
Picture 1566.
|
|
98% |
Ac-1141 |
3,3'-(((2-(3-azidopropyl)-2-methyl-1,3-dioxane-5,5-diyl)bis(methylene))bis(sulfanediyl))dipropanoicacid |
1704097-30-2 |
Picture 1567.
|
|
98% |
Ac-1142 |
2-(4-cyclopropanecarbonyl-phenyl)-2-methyl-propionicacid |
162096-54-0 |
Picture 1588.
|
$550 for 1 g |
98% |
Ac-1143 |
tert-butylN-[(1R)-2-[methoxy(methyl)amino]-1-methyl-2-oxoethyl]carbamate |
146553-06-2 |
Picture 1597.
|
$150 for 5 g |
98% |
Ac-1144 |
methyl2-hydroxy-2-methoxyacetate,methylglyoxylatemethylhemi-acetal |
109745-70-2 19757-97-2 |
Picture 1610.
|
|
98% |
Ac-1145 |
(2R,3S)-N-benzoyl-3-phenylisoserine |
132201-33-3 |
Picture 1612.
|
$250 for 10 g |
98% |
Ac-1146 |
(2S)-2-amino-4-benzylpentanedioicacid |
3283-43-0 |
Picture 1681.
|
|
98% |
Ac-1147 |
O-benzyl-D-serine |
10433-52-0 |
Picture 1685.
|
|
98% |
Ac-1148 |
4-(thiophene-2-sulfonyl)-piperazine-1,3(R)-dicarboxylicacid1-(9H-fluoren-9-ylmethyl)ester |
1055727-90-6 |
Picture 1688.
|
|
98% |
Ac-1149 |
2-chloro-N-(4-nitrophenyl)acetamide |
17329-87-2 |
Picture 1689.
|
$150 for 10 g |
98% |
Ac-1150 |
N-(tert-butoxycarbonyl)-L-ornithine |
13650-49-2 |
Picture 1691.
|
|
98% |
Ac-1151 |
(S)-2-(tert-butoxycarbonyl)-5-phenylpentanoicacid |
98628-27-4 |
Picture 1692.
|
$680 for 1 g |
98% |
Ac-1152 |
methyl(+)-(1S,2R)-2-[(tert-butyloxycarbonyl)amino]cyclobutanecarboxylate |
N/A |
Picture 1708.
|
|
98% |
Ac-1153 |
(Z)-ethyl2-hydroxy-4-(4-methoxyphenyl)-4-oxo-2-butenoate |
63913-14-4 |
Picture 1720.
|
|
98% |
Ac-1154 |
(E)-benzyl4-(2-methoxyphenyl)-2-oxobut-3-enoate |
1446211-49-9 |
Picture 1723.
|
|
98% |
Ac-1155 |
(E)-benzyl2-oxo-4-phenylbut-3-enoate |
887642-11-7 |
Picture 1724.
|
|
98% |
Ac-1156 |
3-Cyclopentapyrazolecarboxylicacid,1,4,5,6-tetrahydro- |
5932-32-1 |
Picture 1216.
|
$350 for 10 g |
98% |
Ac-1157 |
Benzoicacid,4-bromo-2-hydrazinyl-,hydrochloride(1:1) |
1231892-17-3 |
Picture 211.
|
$150 for 1 g $480 for 5 g |
98% |
Ac-1158 |
Benzoicacid,4-chloro-2-[(phenoxycarbonyl)amino]-,methylester |
189062-79-1 |
Picture 423.
|
|
98% |
Ac-1159 |
Benzoicacid,2-fluoro-4-[[(phenylmethoxy)carbonyl]amino]-,1,1-dimethylethylester |
324788-98-9 |
Picture 681.
|
|
98% |
Ac-1160 |
3,5-Oxazolidinedicarboxylicacid,2,2-dimethyl-4-(phenylmethyl)-,3-(1,1-dimethylethyl)5-methylester,(4S,5R)- |
203806-77-3 |
Picture 752.
|
|
98% |
Ac-1161 |
methyl4-chloro-2-((methoxycarbonyl)amino)benzoate |
N/A |
Picture 1190.
|
|
98% |
Ac-1162 |
4-(4-chlorophenethyl)-1H-pyrrol-2-ylpropionate |
N/A |
Picture 1220.
|
|
98% |
Ac-1163 |
Benzo[b]thiophene-2-carboxylicacid,5,6-diethoxy- |
97852-72-7 |
Picture 603.
|
|
98% |
Ac-1164 |
2-(4-chlorophenyl)malonic acid mono ethyl ester |
1566004-64-5 |
Picture 977.
|
|
98% |
Ac-1165 |
2-Thiophenecarboxylicacid,4-phenyl-5-(trifluoromethyl)- |
208108-76-3 |
Picture 723.
|
$150 for 1 g $550 for 5 g |
98% |
Ac-1166 |
Thieno[2,3-c]pyridine-2-carboxylicacid,4-chloro-,methylester |
251996-85-7 |
Picture 724.
|
$300 for 1 g |
98% |
Ac-1167 |
2-Butenedioicacid,2-[(1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl)amino]-,1,4-dimethylester |
60458-95-9 |
Picture 742.
|
$490 for 10 g |
98% |
Ac-1168 |
(E)-1-hydroxy-3-(4-methoxyphenyl)-3-oxoprop-1-enylpropionate |
N/A |
Picture 1272.
|
|
98% |
Ac-1169 |
2-(2-(4-bromophenyl)-5-oxo-1,3-oxathiolan-4-yl)aceticacid |
N/A |
Picture 1316.
|
|
98% |
Ac-1170 |
tert-butyl4'-(bromomethyl)-2'-chloro-[1,1'-biphenyl]-2-carboxylate |
N/A |
Picture 1337.
|
|
98% |
Ac-1171 |
(R)-2-((S)-2-(((9H-fluoren-9-yl)methoxy)carbonyl)propanamido)propanoicacid,FMoc-L-Ala-D-Ala-OH |
538334-18-8 |
Picture 1558.
|
|
98% |
Ac-1172 |
Benzenepropanoicacid,2-hydroxy-,ethylester |
20921-04-4 |
Picture 633.
|
|
98% |
Ac-1173 |
(S)-7-((tert-butoxycarbonyl)amino)-2-methylheptanoicacid |
N/A |
Picture 81.
|
|
98% |
Ac-1174 |
(2E,6E)-3,11-dimethyldodeca-2,6,10-trienoicacid |
N/A |
Picture 245.
|
|
98% |
Ac-1175 |
(Z)-6-tert-butyl1-ethyl4-((2-(tert-butoxy)-2-oxoethyl)amino)-2-fluorohex-2-enedioate |
N/A |
Picture 252.
|
|
98% |
Ac-1176 |
8-((tert-butoxycarbonyl)amino)-3,6-dioxooctanoicacid |
N/A |
Picture 312.
|
|
98% |
Ac-1177 |
L-Tryptophan,ethylester |
2899-28-7 |
Picture 434.
|
|
98% |
Ac-1178 |
4-((5-aminonaphthalen-1-yl)amino)-4-oxobutanoicacid |
N/A |
Picture 442.
|
|
98% |
Ac-1179 |
L-Tryptophan,methylester,hydrochloride(1:1) |
7524-52-9 |
Picture 454.
|
|
98% |
Ac-1180 |
methyl4-chloro-2-((methoxycarbonyl)amino)benzoate |
N/A |
Picture 460.
|
|
98% |
Ac-1181 |
(R)-3-(1,3-dioxoisoindolin-2-yl)-3-(formyloxy)propyl2-oxo-2-phenylacetate |
N/A |
Picture 529.
|
|
98% |
Ac-1182 |
((2-oxo-2-phenylethylidene)amino)(phenyl)methylformate |
N/A |
Picture 546.
|
|
98% |
Ac-1183 |
11-(5,6-dihydro-3-imino-benzo[h]-cinnoline-2(3H))-1-undecanoic acid |
402519-05-5 |
Picture 552.
|
|
98% |
Ac-1184 |
diethyl2,2-bis(hydroxymethyl)succinate |
N/A |
Picture 608.
|
|
98% |
Ac-1185 |
(E)-ethyl3-(4-(2-amino-2-methylpropyl)phenyl)acrylate |
N/A |
Picture 632.
|
|
98% |
Ac-1186 |
(E)-1-hydroxy-3-(4-methoxyphenyl)-3-oxoprop-1-enylpropionate |
N/A |
Picture 657.
|
|
98% |
Ac-1187 |
(1S,8S)-8-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-9-oxooctahydropyridazino[1,2-a]pyridazine-1-carboxylicacid |
N/A |
Picture 687.
|
|
98% |
Ac-1188 |
dimethyl2,8-bis((4-fluorophenyl)amino)-5-oxononanedioate |
N/A |
Picture 702.
|
|
98% |
Ac-1189 |
2,8-bis((4-fluorophenyl)amino)-5-oxononanedioicacid |
N/A |
Picture 707.
|
|
98% |
Ac-1190 |
(2-(((1-carboxy-2-hydroxyethyl)carbamoyl)oxy)ethyl)(methyl)(phenyl)sulfonium2,2,2-trifluoroacetate |
N/A |
Picture 870.
|
|
98% |
Ac-1191 |
Octanedioicacid,1,8-dimethylester |
1732-09-8 |
Picture 909.
|
|
98% |
Ac-1192 |
3-((2,4-dinitrophenyl)amino)-4-hydroxy-3-methylbutanoicacid |
N/A |
Picture 968.
|
|
98% |
Ac-1193 |
2-(naphthalen-2-yl)ethane-1,1-diyldipropionate |
N/A |
Picture 981.
|
98% |
Ac-1194 |
2-fluoro-5-(3-(4-(trifluoromethyl)phenyl)ureido)phenylformate |
N/A |
Picture 996.
|
|
98% |
Ac-1195 |
1-(2-((tert-butoxycarbonyl)amino)-3-methylbutanoyl)pyrrolidin-2-yl2-phenylacetate |
N/A |
Picture 1010.
|
|
98% |
Ac-1196 |
isobutyl2-(2-phenylacetoxy)pyrrolidine-1-carboxylate |
N/A |
Picture 1012.
|
|
98% |
Ac-1197 |
((2-oxo-2-phenylethylidene)amino)(phenyl)methylformate |
N/A |
Picture 1217.
|
|
98% |
Ac-1198 |
2-amino-2-(3,5-dihydroxyphenyl)aceticacid |
146255-66-5 |
Picture 1428.
|
|
98% |
Ac-1199 |
1,2,4-Piperazinetricarboxylicacid,4-(1,1-dimethylethyl)1-(phenylmethyl)ester,(2R)- |
954388-33-1 |
Picture 783.
|
$150 for 1 g $450 for 5 g |
98% |
Ad-3001 |
Benzaldehyde,3-methoxy-4-[(4-methoxyphenyl)methoxy]- |
129047-38-7 |
Picture 83.
|
$150 for 1 g $380 for 5 g |
98% |
Ad-3002 |
Cyclopentanecarboxaldehyde,1-phenyl- |
21573-69-3 |
Picture 272.
|
$380 for 1 g |
98% |
Ad-3003 |
Butanoicacid,3-[[(1,1-dimethylethoxy)carbonyl]amino]-4-oxo-,1,1-dimethylethylester,(3R)- |
1393721-12-4 |
Picture 276.
|
|
98% |
Ad-3004 |
1H-Pyrrole-2-carboxylicacid,4-formyl-3,5-dimethyl-,ethylester |
2199-64-6 |
Picture 104.
|
$180 for 1 g $750 for 5 g |
98% |
Ad-3005 |
2-Furancarboxaldehyde,5-(2-chloro-4-nitrophenyl)- |
327049-94-5 |
Picture 947.
|
$150 for 1 g |
98% |
Ad-3006 |
5'-[4-(tert-butyldimethylsilyl)oxy]phenyl-2,2'-bithiophene-5-carbaldehyde |
886054-95-1 |
Picture 1669.
|
|
98% |
Ad-3007 |
5-Benzofurancarboxaldehyde,2-(tributylstannyl)- |
959972-41-9 |
Picture 338.
|
|
98% |
Ad-3008 |
ethyl4-formylpyrrolidine-2-carboxylate |
N/A |
Picture 1156.
|
|
98% |
Ad-3009 |
ethyl4-(3-ethoxy-3-oxopropyl)-5-formyl-3-methyl-1H-pyrrole-2-carboxylate |
4949-56-8 |
Picture 105.
|
|
98% |
Ad-3010 |
1H-Pyrrole-3-carboxamide, N-[2-(diethylamino)ethyl]-5-formyl-2,4-dimethyl- |
356068-86-5 |
Picture 140.
|
|
98% |
Ad-3011 |
ethyl4-formylpyrrolidine-2-carboxylate |
N/A |
Picture 303.
|
|
98% |
Ad-3012 |
1H-Pyrrole-2-carboxaldehyde |
1003-29-8 |
Picture 386.
|
|
98% |
Ad-3013 |
1H-Pyrrole-3-carboxaldehyde |
7126-39-8 |
Picture 1175.
|
$150 for 5 g |
98% |
Ad-3014 |
Cyclooctanecarboxaldehyde |
6688-11-5 |
Picture 610.
|
$350 for 5 g |
98% |
Ad-3015 |
(1s,4s)-4-((tert-butyldimethylsilyl)oxy)cyclohexanecarbaldehyde |
N/A |
Picture 650.
|
|
98% |
Ad-3016 |
2-Propenal,2-bromo-(9CI) |
14925-39-4 |
Picture 651.
|
|
98% |
Ad-3017 |
4-Pyridinecarboxaldehyde,3,5-dibromo- |
70201-42-2 |
Picture 285.
|
$120 for 25 g |
98% |
Ad-3018 |
Benzonitrile,4-hydroxy-3,5-dimethoxy- |
72684-95-8 |
Picture 728.
|
$180 for 1 g $550 for 5 g |
98% |
Ad-3019 |
4-Pyridinecarboxaldehyde,3,5-dichloro- |
136590-83-5 |
Picture 1173.
|
$150 for 25 g |
98% |
Ad-3020 |
2-hydroxy-3-bromobenzaldehyde |
1829-34-1 |
Picture 1396.
|
$150 for 25 g |
98% |
Ad-3021 |
Benzaldehyde,4-hydroxy-2,6-dimethyl- |
70547-87-4 |
Picture 1226.
|
$250 for 100 g |
98% |
Ad-3022 |
Butanoicacid,2-nitro-3,4-dioxo-,sodiumsalt(1:1) |
15250-39-2 |
Picture 948.
|
|
98% |
Ad-3023 |
Carbamicacid,[[4-(dimethoxymethyl)phenyl]methyl]-,phenylmethylester(9CI) |
159730-66-2 |
Picture 962.
|
|
98% |
Ad-3024 |
benzyl(2,2-dimethoxyethyl)(neopentyl)carbamate |
N/A |
Picture 1341.
|
|
98% |
Ad-3025 |
benzyl(4-(dimethoxymethyl)cyclohexyl)carbamate |
N/A |
Picture 1349.
|
|
98% |
Ad-3026 |
Carbamicacid, N-decyl-N-(2,2-dimethoxyethyl)-,9H-fluoren-9-ylmethylester |
1260529-12-1 |
Picture 738.
|
|
98% |
Ad-3027 |
10-((2,2-dimethoxyethyl)amino)decan-3-ol |
N/A |
Picture 760.
|
|
98% |
Ad-3028 |
1-Piperidinecarboxylicacid,4-(dimethoxymethyl)-,phenylmethylester |
392690-93-6 |
Picture 969.
|
|
98% |
Ad-3029 |
Benzonitrile,4-(dimethoxymethyl)- |
90921-71-4 |
Picture 975.
|
|
98% |
Ad-3030 |
Piperidinium,1-(chloromethylene)-,chloride(1:1) |
59611-74-4 |
Picture 987.
|
|
98% |
Ad-3031 |
1,2-Butanediol,4-phenyl- |
1199-97-9 |
Picture 1055.
|
|
98% |
Ad-3032 |
2-imidazolecarbaldehyde |
10111-08-7 |
Picture 1390.
|
|
98% |
Ad-3033 |
4,5-dibromo-1H-pyrrole-2-carbaldehyde |
932-82-1 |
Picture 1391.
|
$140 for 1 g $490 for 5 g |
98% |
Ad-3034 |
Butanenitrile,4,4-dimethoxy- |
14618-78-1 |
Picture 362.
|
|
98% |
Ad-3035 |
4-(benzyloxy)-3-(cyclopropylmethoxy)benzaldehyde |
1381886-14-1 |
Picture 1513.
|
|
98% |
Ad-3036 |
4-formylphenyl4-(tert-butoxycarbonyl)benzoate |
N/A |
Picture 1543.
|
|
98% |
Ad-3037 |
Benzaldehyde,2-chloro-4-hydroxy- |
56962-11-9 |
Picture 1321.
|
$150 for 25 g |
98% |
Ad-3038 |
3-(cyclopentyloxy)-4-methoxybenzaldehyde |
67387-76-2 |
Picture 1512.
|
$300 for 25 g |
98% |
Ad-3039 |
Benzaldehyde,3-(2-propen-1-yloxy)- |
40359-32-8 |
Picture 1015.
|
$390 for 10 g |
98% |
Ad-3040 |
3-ethoxy-2-bromo-4-methoxy-benzaldehyde |
1364687-69-3 |
Picture 1589.
|
|
98% |
Ad-3041 |
2-bromo-3,4-dimethoxybenzylaldehyde |
55171-60-3 |
Picture 1591.
|
$380 for 1 g |
98% |
Ad-3042 |
3-Allyloxy-2-bromo-4-methoxybenzaldehyde |
185406-89-7 |
Picture 1593.
|
|
98% |
Ad-3043 |
Benzaldehyde,4-hydroxy-3-(hydroxymethyl)- |
54030-32-9 |
Picture 559.
|
$420 for 1 g |
98% |
Ad-3044 |
Benzaldehyde,3-hydroxy-4-phenoxy- |
35065-13-5 |
Picture 880.
|
|
98% |
Ad-3045 |
Benzaldehyde,3,4-dimethoxy- |
120-14-9 |
Picture 683.
|
|
98% |
Ad-3046 |
2,2-Dimethylpropionyloxy-4-methoxybenzaldehyde |
151792-57-3 |
Picture 1608.
|
|
98% |
Ad-3047 |
tert-butyl(2-formyl-4,4-dimethyl-1,3-dioxetan-2-yl)carbamate |
N/A |
Picture 548.
|
|
98% |
Ad-3048 |
benzyl(2,2-dimethoxyethyl)(neopentyl)carbamate |
N/A |
Picture 910.
|
|
98% |
Ad-3049 |
benzyl(4-(dimethoxymethyl)cyclohexyl)carbamate |
N/A |
Picture 974.
|
|
98% |
Ad-3050 |
Carbamicacid,(4,4-dimethoxybutyl)-,phenylmethylester(9CI) |
868775-53-5 |
Picture 960.
|
|
98% |
K-7001 |
Methanone,(4-bromophenyl)(3,4-dimethoxyphenyl)- |
116412-90-9 |
Picture 1026.
|
$280 for 1 g $750 for 5 g |
98% |
K-7002 |
Methanone,[3,5-bis(trifluoromethyl)phenyl]phenyl- |
21221-93-2 |
Picture 676.
|
$580 for 100 g |
98% |
K-7003 |
Methanone,(3,5-dibromophenyl)[4-(trifluoromethyl)phenyl]- |
1310355-45-3 |
Picture 30.
|
|
98% |
K-7004 |
4’-trifluoromethyl-3,4-dimethoxybenzophenone |
116412-99-8 |
Picture 33.
|
|
98% |
K-7005 |
Methanone,[3,5-bis(trifluoromethyl)phenyl](3,4-dimethoxyphenyl)- |
1310355-49-7 |
Picture 34.
|
|
98% |
K-7006 |
(R)-3-(3-fluoro-4-pivaloylphenyl)-5-(hydroxymethyl)oxazolidin-2-one |
N/A |
Picture 92.
|
|
98% |
K-7007 |
Carbamicacid, N,N-dimethyl-, C,C'-(5-acetyl-1,3-phenylene)ester |
81732-48-1 |
Picture 107.
|
|
98% |
K-7008 |
Ethanone,1-(5-amino-2-methylphenyl)- |
22241-00-5 |
Picture 248.
|
|
98% |
K-7009 |
cyclohex-3-en-1-yl(4-(2-phenylpropan-2-yl)phenyl)methanone |
N/A |
Picture 255.
|
|
98% |
K-7010 |
Benzenemethanol,2-phenyl-2-(trifluoromethyl)- |
727-98-0 |
Picture 268.
|
$280 for 10 g |
98% |
K-7011 |
Ethanone,1-[2-hydroxy-4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]-2-[4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]- |
130064-21-0 |
Picture 296.
|
|
98% |
K-7012 |
Ethanone,1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)- |
17720-60-4 |
Picture 300.
|
$250 for 5 g |
98% |
K-7013 |
4-Hepten-3-one,5-hydroxy-2,2,6,6-tetramethyl- |
55252-75-0 |
Picture 310.
|
|
98% |
K-7014 |
12,16,20-Docosatrien-11-one,13,17,21-trimethyl-,(12E,16E)- |
877057-50-6 |
Picture 326.
|
|
98% |
K-7015 |
2-Propen-1-one,3-(2-nitrophenyl)-1-phenyl- |
7473-93-0 |
Picture 395.
|
|
98% |
K-7016 |
1,4-Dioxaspiro[4.5]decan-8-one,7-(hydroxymethylene)- |
115215-91-3 |
Picture 406.
|
|
98% |
K-7017 |
Ethanone,1-(4-methoxy-3-propoxyphenyl)- |
104226-65-5 |
Picture 480.
|
$380 for 1 g $980 for 5 g |
98% |
K-7018 |
Ethanone,1,1'-(5-amino-1,3-phenylene)bis- |
87533-49-1 |
Picture 631.
|
$390 for 250 mg |
98% |
K-7019 |
Ethanone,1-[2,2'-bithiophen]-5-yl- |
3515-18-2 |
Picture 758.
|
|
98% |
K-7020 |
1H-Isoindole-1,3(2H)-dione,2-(4-benzoylphenyl)- |
40101-60-8 |
Picture 772.
|
|
98% |
K-7021 |
Ethanone,2-bromo-1-(5-bromo-2-thienyl)- |
10531-44-9 |
Picture 785.
|
$130 for 1 g $350 for 5 g |
98% |
K-7022 |
4H-Pyran-4-one,tetrahydro-3-methoxy-,(3S)- |
1464985-83-8 |
Picture 842.
|
|
98% |
K-7023 |
8-Azabicyclo[3.2.1]octane-8-carboxylicacid,3-oxo-,1,1-dimethylethylester |
185099-67-6 |
Picture 920.
|
|
98% |
K-7024 |
ethyl4-(2-phenylacetyl)-1H-pyrrole-2-carboxylate |
N/A |
Picture 1077.
|
|
98% |
K-7025 |
Cyclopentanecarboxylicacid,1-(iodomethyl)-2-oxo-,ethylester |
2900-10-9 |
Picture 1134.
|
|
98% |
K-7026 |
2-bromo-1-(5-bromothiophen-2-yl)ethanone |
10531-44-9 |
Picture 1308.
|
$320 for 5 g |
98% |
K-7027 |
2-(3-bromophenylamino)-1-(2,6-difluorophenyl)ethanone |
N/A |
Picture 1385.
|
|
98% |
K-7028 |
2-(3-bromophenylamino)-1-(2-chloro-6-fluorophenyl)ethanone |
N/A |
Picture 1386.
|
|
98% |
K-7029 |
1-(2,5-dibromo-4-fluorophenyl)ethanone |
1806349-76-7 |
Picture 1432.
|
|
98% |
K-7030 |
(Z)-1-(tert-butyldimethylsilyloxy)-2-hydroxyoct-2-en-4-one |
N/A |
Picture 1605.
|
|
98% |
K-7031 |
methyl3,4-dimethoxy-2-(2-oxopropyl)benzoate |
N/A |
Picture 1609.
|
|
98% |
K-7032 |
ethyl2-(3-bromo-2-oxopropyl)-3,4-dimethoxybenzylcarbamate |
N/A |
Picture 1618.
|
|
98% |
K-7033 |
4-benzyloxypropiophenone |
4495-66-3 |
Picture 1629.
|
$290 for 1 g |
98% |
K-7034 |
ethyl4-(2-phenylacetyl)-1H-pyrrole-2-carboxylate |
N/A |
Picture 49.
|
|
98% |
K-7035 |
(4-chlorophenyl)(3,3-dihydroxypyrrolidin-1-yl)methanone |
N/A |
Picture 725.
|
|
98% |
K-7036 |
4-(2-(4'-chloro-[1,1'-biphenyl]-4-yl)ethyl)cycloheptanone |
N/A |
Picture 1613.
|
|
98% |
K-7037 |
(E)-tert-butyl((1S,7S)-5-oxobicyclo[5.2.0]nonan-2-ylidene)carbamate |
N/A |
Picture 1159.
|
|
98% |
K-7038 |
(E)-tert-butyl(6-hydroxybicyclo[6.2.0]decan-2-ylidene)carbamate |
N/A |
Picture 1155.
|
|
98% |
Q-7201 |
2H-1-Benzopyran-2-one,7-amino-4-methyl- |
26093-31-2 |
Picture 446.
|
|
98% |
Q-7202 |
3-cyano-7-hydroxycoumarin |
19088-73-4 |
Picture 501.
|
|
98% |
Q-7203 |
(S)-benzyl(3-oxo-4-((2-oxo-2H-chromen-7-yl)oxy)butan-2-yl)carbamate |
N/A |
Picture 640.
|
|
98% |
Q-7204 |
DDAO |
118290-05-4 |
Picture 25.
|
$500 for 100 mg |
98% |
Q-7205 |
Phenyl 1,4-dihydroxy-2-naphthoate |
54978-55-1 |
Picture 27.
|
$100 for 10 g $350 for 100 g |
98% |
Q-7206 |
Phosphorothioicacid, O,O-diethyl O-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)ester |
299-45-6 |
Picture 250.
|
|
98% |
Q-7207 |
2H-Naphtho[2,3-b]pyran-5,10-dione,2,2-dimethyl- |
15297-92-4 |
Picture 498.
|
$120 for 100 mg |
98% |
Q-7208 |
Phosphoricacid,3-cyano-2-oxo-2H-1-benzopyran-7-yldiethylester |
753001-39-7 |
Picture 499.
|
|
98% |
Q-7209 |
2H-1-Benzopyran-2-one,7-methoxy-4-methyl- |
2555-28-4 |
Picture 641.
|
$150 for 25 g |
98% |
Q-7210 |
2H-1-Benzopyran-4-aceticacid,7-methoxy-2-oxo- |
62935-72-2 |
Picture 642.
|
$150 for 5 g $280 for 10 g |
98% |
Q-7211 |
2H-1-Benzopyran-4-aceticacid,2-oxo-7-(phenylamino)- |
82412-15-5 |
Picture 643.
|
|
98% |
Q-7212 |
4H-1-Benzopyran-4-one,2-(methylthio)-8-phenyl- |
778643-54-2 |
Picture 644.
|
|
98% |
Q-7213 |
4H-1-Benzopyran-4-one,2-(2-amino-3-methoxyphenyl)- |
167869-21-8 |
Picture 645.
|
$240 for 50 mg |
98% |
Q-7214 |
3-cyano-2-oxo-2H-chromen-6-yldiethylphosphate |
N/A |
Picture 1143.
|
|
98% |
Q-7215 |
(S)-benzyl(3-oxo-4-((2-oxo-2H-chromen-7-yl)oxy)butan-2-yl)carbamate |
N/A |
Picture 1267.
|
|
98% |
Q-7216 |
4H-1-Benzopyran-4-one,2-(4-morpholinyl)-8-phenyl- |
154447-36-6 |
Picture 1268.
|
$150 for 50 mg |
98% |
Q-7217 |
5-amino-2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)-N-(prop-2-yn-1-yl)benzamide |
N/A |
Picture 1462.
|
|
98% |
Q-7218 |
O,O-diethylS-(4-methyl-1-oxo-1H-isochromen-7-yl)phosphorothioate |
N/A |
Picture 1137.
|
|
98% |
Am-2001 |
2-Pyridinamine, N-3-pyridinyl- |
33932-95-5 |
Picture 363.
|
$280 for 1 g $780 for 5 g |
98% |
Am-2002 |
1-Naphthalenamine, 4-cyclopropyl- |
878671-94-4 |
Picture 29.
|
$100 for 1 g $300 for 5 g
|
98% |
Am-2003 |
1-Pyrrolidineethanol,2-phenyl- |
5407-61-4 |
Picture 52.
|
|
98% |
Am-2004 |
1,2-Ethanediamine,1-(4-methoxyphenyl)-N1,N1-dimethyl- |
851169-57-8 |
Picture 55.
|
$250 for 5 g $900 for 25 g |
98% |
Am-2005 |
4-Morpholineethanamine,BETA-[4-(trifluoromethyl)phenyl]- |
885950-67-4 |
Picture 115.
|
$200 for 1 g $650 for 5 g |
98% |
Am-2006 |
1-Pyrrolidineethanamine,BETA-(4-methoxyphenyl)- |
31466-55-4 |
Picture 124.
|
$200 for 1 g $750 for 5 g |
98% |
Am-2007 |
morpholino(m-tolyl)methanamine |
N/A |
Picture 243.
|
|
98% |
Am-2008 |
4-Morpholineacetamide,2-3-pyridinyl- |
719279-71-7 |
Picture 256.
|
|
98% |
Am-2009 |
1,2-Ethanediamine, N1,N2,N2-trimethyl-1-phenyl- |
858523-65-6 |
Picture 273.
|
$380 for 1 g |
98% |
Am-2010 |
4-Morpholineethanamine,BETA-phenyl- |
31466-44-1 |
Picture 281.
|
$150 for 1 g $550 for 5 g |
98% |
Am-2011 |
4-Piperidinol,4-(2-pyridinyl)- |
50461-56-8 |
Picture 304.
|
$200 for 1 g $750 for 5 g |
98% |
Am-2012 |
4-Morpholineacetonitrile,2-3-pyridinyl- |
36740-09-7 |
Picture 306.
|
$150 for 1 g $450 for 5 g |
98% |
Am-2013 |
Benzeneacetonitrile,2-(dimethylamino)-4-methoxy- |
15190-05-3 |
Picture 307.
|
$150 for 1 g |
98% |
Am-2014 |
4-Morpholineacetonitrile,2-phenyl- |
15190-10-0 |
Picture 309.
|
|
98% |
Am-2015 |
1-Pyrrolidineethanamine,2-phenyl-,hydrochloride(1:1) |
31788-84-8 |
Picture 367.
|
$350 for 1 g |
98% |
Am-2016 |
Benzeneacetonitrile,3-methoxy-2-phenyl- |
25310-35-4 |
Picture 372.
|
|
98% |
Am-2017 |
4-Piperidinol,4-(3-pyridinyl)- |
50461-59-1 |
Picture 375.
|
$200 for 5 g |
98% |
Am-2018 |
4-Piperidinol,4-(4-pyridinyl)- |
233261-75-1 |
Picture 674.
|
$680 for 1 g |
98% |
Am-2019 |
Piperidine,1-[2-(4-piperidinyl)ethyl]-,hydrochloride(1:2) |
105903-66-0 |
Picture 695.
|
$450 for 5 g |
98% |
Am-2020 |
-Morpholineethanamine,2-phenyl- |
38060-08-1 |
Picture 890.
|
$150 for 1 g $490 for 5 g |
98% |
Am-2021 |
3-Pyridineacetonitrile,2-(dimethylamino)- |
223121-52-6 |
Picture 932.
|
|
98% |
Am-2022 |
1-Pyrrolidineethanamine,2-phenyl- |
31788-83-7 |
Picture 1042.
|
$320 for 1 g |
98% |
Am-2023 |
Benzeneethanamine,4-methoxy-BETA-phenyl- |
51431-54-0 |
Picture 1057.
|
|
98% |
Am-2024 |
2-morpholino-1-phenylethanaminiumchloride |
38060-08-1 |
Picture 1339.
|
$450 for 5 g |
98% |
Am-2025 |
2-morpholino-2-phenylacetamide |
6327-69-1 |
Picture 1536.
|
|
98% |
Am-2026 |
1-(2-chlorophenyl)-2-morpholinoethanamine |
1851830-39-1 |
Picture 1147.
|
|
98% |
Am-2027 |
Benzeneacetamide,2-(dimethylamino)-4-methoxy- |
92547-49-4 |
Picture 286.
|
|
98% |
Am-2028 |
Carbamicacid, N-(3-ethyl-2-pyridinyl)-,1,1-dimethylethylester |
149489-03-2 |
Picture 62.
|
$280 for 1 g |
98% |
Am-2029 |
Benzoicacid,4-hexoxyl-,hydrazide |
64328-58-1 |
Picture 63.
|
|
98% |
Am-2030 |
Benzoicacid,4-butoxy-,hydrazide |
64328-61-6 |
Picture 66.
|
$150 for 1 g $400 for 5 g |
98% |
Am-2031 |
Pyrrolidine,3-phenyl- |
936-44-7 |
Picture 89.
|
$200 for 5 g |
98% |
Am-2032 |
Piperazine,1-(3-pyridinylmethyl)- |
39244-80-9 |
Picture 90.
|
$100 for 5 g $250 for 25 g |
98% |
Am-2033 |
2-Naphthalenamine,1,2,3,4-tetrahydro-N-phenyl- |
33816-55-6 |
Picture 96.
|
$300 for 1 g |
98% |
Am-2034 |
1-(1-(3-chlorophenyl)cyclobutyl)-3-methylbutan-1-amine |
N/A |
Picture 188.
|
|
98% |
Am-2035 |
8-Azabicyclo[3.2.1]octane,8-(phenylmethyl)- |
19079-79-9 |
Picture 191.
|
|
98% |
Am-2036 |
1H-Inden-2-ol,1-amino-2,3-dihydro-2-methyl- |
764600-30-8 |
Picture 244.
|
|
98% |
Am-2037 |
(1S,2R)-1-amino-4,7-dimethyl-2,3-dihydro-1H-inden-2-ol |
N/A |
Picture 233.
|
|
98% |
Am-2038 |
[1,1'-Biphenyl]-3-methanamine,4'-fluoro-,hydrochloride(1:1) |
1195901-44-0 |
Picture 237.
|
$200 for 1 g $750 for 5 g |
98% |
Am-2039 |
Carbamimidothioicacid,(4-chlorophenyl)methylester,hydrochloride(1:1) |
544-47-8 |
Picture 261.
|
|
98% |
Am-2040 |
Benzenamine,3-bromo-4-methoxy- |
19056-41-8 |
Picture 262.
|
|
98% |
Am-2041 |
N-(2-ethyl-2-hydroxy-1-phenylbutyl)-4-methylbenzenesulfonamide |
926927-10-8 |
Picture 275.
|
|
98% |
Am-2042 |
Benzeneacetonitrile,4,5-dimethoxy-2-nitro- |
17354-04-0 |
Picture 287.
|
|
98% |
Am-2043 |
1,3-Propanediol,2,2-bis[[(4-aminobenzoyl)oxy]methyl]-,1,3-bis(4-aminobenzoate) |
25288-92-0 |
Picture 292.
|
|
98% |
Am-2044 |
Benzene,1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-nitro- |
128134-65-6 |
Picture 297.
|
|
98% |
Am-2045 |
2-Pyrrolidinecarboxamide,hydrochloride(1:1) |
115630-49-4 |
Picture 308.
|
$100 for 1 g |
98% |
Am-2046 |
Benzenamine,4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)- |
66750-05-8 |
Picture 328.
|
|
98% |
Am-2047 |
[1,1'-Biphenyl]-2,2'-diamine |
1454-80-4 |
Picture 378.
|
$350 for 5 g |
98% |
Am-2048 |
6-amino-3-methylbenzofuran-2(3H)-one |
N/A |
Picture 380.
|
|
98% |
Am-2049 |
Benzenamine,2-bromo-6-methyl-4-nitro- |
102170-56-9 |
Picture 390.
|
$450 for 100 g |
98% |
Am-2050 |
2-Piperidineethanamine,1-methyl-N-phenyl- |
1247762-11-3 |
Picture 391.
|
|
98% |
Am-2051 |
2,6-Pyridinediamine, N2,N6-dimethyl-3-nitro- |
73895-39-3 |
Picture 398.
|
$250 for 1 g |
98% |
Am-2052 |
1-Piperazinecarboximidamide, N-cyano-N'-(2-methylphenyl)-3-phenyl- |
1001183-82-9 |
Picture 399.
|
|
98% |
Am-2053 |
1H-Inden-2-amine,2,3-dihydro-N-phenyl-,hydrochloride(1:1) |
33237-73-9 |
Picture 393.
|
$480 for 1 g |
98% |
Am-2054 |
Piperazine,2-(1-methylethyl)- |
84468-53-1 |
Picture 506.
|
|
98% |
Am-2055 |
1H-Inden-2-amine,2,3-dihydro- |
2975-41-9 |
Picture 923.
|
|
98% |
Am-2056 |
N1-(2,3-dihydro-1H-inden-2-yl)-N1-phenyl-N2-propylethane-1,2-diamine |
N/A |
Picture 409.
|
|
98% |
Am-2057 |
4(5H)-Pyrimidinone,6-amino-2-methoxy- |
123200-86-2 |
Picture 426.
|
|
98% |
Am-2058 |
Benzenamine,3-chloro-4-methyl-,hydrochloride(1:1) |
7745-89-3 |
Picture 430.
|
|
98% |
Am-2059 |
Benzenamine,3-ethyl-,hydrochloride(1:1) |
72072-15-2 |
Picture 438.
|
|
98% |
Am-2060 |
Benzeneethanamine,3,4-dichloro-,hydrochloride(1:1) |
39959-88-1 |
Picture 439.
|
|
98% |
Am-2061 |
4-Pyridinamine,2,6-dichloro-3-nitro- |
2897-43-0 |
Picture 457.
|
|
98% |
Am-2062 |
Spiro[3H-indole-3,4'-piperidine],1,2-dihydro-1-(methylsulfonyl)- |
178261-41-1 |
Picture 504.
|
$390 for 1 g |
98% |
Am-2063 |
Pyridinium,1-[(4-chlorophenyl)methyl]-,chloride(1:1) |
19340-03-5 |
Picture 849.
|
|
98% |
Am-2064 |
Pyridinium,1-[(4-methoxyphenyl)methyl]-,chloride(1:1) |
8349-72-5 |
Picture 857.
|
|
98% |
Am-2065 |
Spiro[3H-indole-3,4'-piperidine]-1'-carboxylicacid,1,2-dihydro-,phenylmethylester |
167484-18-6 |
Picture 895.
|
$190 for 1 g $850 for 5 g |
98% |
Am-2066 |
tert-butyl3-oxo-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
1160247-07-3 |
Picture 1393.
|
$300 for 1 g |
98% |
Am-2067 |
7-chloro-1-(4-methoxybenzyl)-4-(methoxymethyl)quinolin-1-iumiodide |
N/A |
Picture 1362.
|
|
98% |
Am-2068 |
7-chloro-4-iodo-1-(4-methoxybenzyl)quinolin-1-iumiodide |
N/A |
Picture 1363.
|
|
98% |
Am-2069 |
Phenol,4-[(2-hydroxyethyl)amino]-3-nitro- |
65235-31-6 |
Picture 505.
|
|
98% |
Am-2070 |
Piperazine,2-(1-methylethyl)-,(2R)- |
207284-25-1 |
Picture 521.
|
$350 for 1 g |
98% |
Am-2071 |
2-Pyrrolidinecarboxamide,hydrochloride(1:1),(2R)- |
50894-62-7 |
Picture 514.
|
|
98% |
Am-2072 |
Phenol,4-amino-2-(aminomethyl)-,hydrochloride(1:2) |
135043-64-0 |
Picture 528.
|
|
98% |
Am-2073 |
5-ethynyl-2,2-dimethyl-1,3-dioxan-5-amine |
N/A |
Picture 533.
|
|
98% |
Am-2074 |
Carbamothioicacid, N-[2-(1,1-dimethylethoxy)-5-fluorophenyl]-, O-(1-methylethyl)ester |
663925-82-4 |
Picture 538.
|
|
98% |
Am-2075 |
2-Pentanamine,1,1'-dithiobis[4-methyl-,hydrochloride(1:2),(2S,2'S)- |
112157-33-2 |
Picture 540.
|
|
98% |
Am-2076 |
1H-Carbazol-6-amine,2,3,4,9-tetrahydro-,hydrochloride(1:1) |
1079-26-1 |
Picture 557.
|
|
98% |
Am-2077 |
Acetamide, N-[5-[(2-hydroxyethyl)amino]-2-methoxyphenyl]- |
149706-00-3 |
Picture 561.
|
|
98% |
Am-2078 |
1-Piperazinecarboxylicacid,4-[2-fluoro-4-[[(phenylmethoxy)carbonyl]amino]phenyl]-,phenylmethylester |
174649-03-7 |
Picture 563.
|
|
98% |
Am-2079 |
Hydrazine,1,2-bis(1-methylethyl)- |
3711-34-0 |
Picture 576.
|
|
98% |
Am-2080 |
Cyclobutanecarbonitrile,1-(3-chlorophenyl)- |
28049-60-7 |
Picture 577.
|
$350 for 1 g |
98% |
Am-2081 |
Cyclobutanemethanamine,2-butyl-1-(4-chlorophenyl)- |
773009-49-7 |
Picture 578.
|
|
98% |
Am-2082 |
Cyclobutanemethanamine,1-(4-chlorophenyl)-2-(1-methylpropyl)- |
792141-74-3 |
Picture 579.
|
|
98% |
Am-2083 |
Carbamicacid, N-[3-(2-oxiranyl)propyl]-,1,1-dimethylethylester |
220243-54-9 |
Picture 585.
|
|
98% |
Am-2084 |
2-(3-((R)-amino(pyridin-4-yl)methyl)phenyl)cyclopentanone |
N/A |
Picture 602.
|
|
98% |
Am-2085 |
Benzenemethanamine,3-phenoxy-,hydrochloride(1:1) |
376637-85-3 |
Picture 606.
|
$520 for 5 g |
98% |
Am-2086 |
Benzonitrile,4-[3-(dimethylamino)-1-propyn-1-yl]- |
860003-17-4 |
Picture 612.
|
|
98% |
Am-2087 |
3-(3-(dimethylamino)prop-1-yn-1-yl)benzonitrile |
N/A |
Picture 613.
|
|
98% |
Am-2088 |
Benzenamine,3-ethyl-4-methyl- |
104715-64-2 |
Picture 614.
|
|
98% |
Am-2089 |
Benzoicacid,2,3-diamino-,ethylester |
37466-88-9 |
Picture 616.
|
|
98% |
Am-2090 |
1-Piperidinecarboxylicacid,3-(hydroxymethyl)-,phenylmethylester |
39945-51-2 |
Picture 620.
|
|
98% |
Am-2091 |
Phenol,4-amino-2-[(diethylamino)methyl]-,hydrochloride(1:2) |
6297-14-9 |
Picture 622.
|
|
98% |
Am-2092 |
Carbamicacid,[(1S)-2-oxo-2-phenyl-1-(phenylmethyl)ethyl]-,1,1-dimethylethylester(9CI) |
202861-97-0 |
Picture 635.
|
$750 for 5 g |
98% |
Am-2093 |
Benzeneethanamine,4-amino-2,2-dimethyl- |
51131-55-6 |
Picture 639.
|
|
98% |
Am-2094 |
(S)-5-(aminomethyl)-1-benzylpyrrolidin-2-one |
N/A |
Picture 659.
|
|
98% |
Am-2095 |
Benzenecarboximidamide,4-phenoxy- |
6461-98-9 |
Picture 697.
|
$390 for 1 g |
98% |
Am-2096 |
Benzenecarboximidamide |
618-39-3 |
Picture 698.
|
$190 for 10 g |
98% |
Am-2097 |
[1,1'-Biphenyl]-4-carboximidamide |
125772-44-3 |
Picture 699.
|
$390 for 1 g |
98% |
Am-2098 |
Benzenecarboximidamide,3-(trifluoromethyl)- |
26130-45-0 |
Picture 700.
|
$150 for 1 g |
98% |
Am-2099 |
Benzenamine,3-methyl-4-(1-piperazinyl)- |
1421314-12-6 |
Picture 708.
|
|
98% |
Am-2100 |
Pyrrolidine,3-phenyl- |
936-44-7 |
Picture 89.
|
$200 for 5 g |
98% |
Am-2101 |
Pyrrolidine,3-(trifluoromethyl)- |
644970-41-2 |
Picture 665.
|
$350 for 250 mg $890 for 1 g |
98% |
Am-2102 |
Pyridine,2-(3-pyrrolidinyl)- |
150281-45-1 |
Picture 1241.
|
$650 for 5 g |
98% |
Am-2103 |
Pyrrolidine,3-(phenylsulfonyl)- |
101769-04-4 |
Picture 1278.
|
$290 for 1 g |
98% |
Am-2104 |
Pyrrolidine,3-(methylsulfonyl)- |
433980-62-2 |
Picture 1367.
|
$290 for 1 g |
98% |
Am-2105 |
(phenylsulfonyl)methanamine |
892654-83-9 |
Picture 1534.
|
|
98% |
Am-2106 |
Pyridine,4-(3-pyrrolidinyl)- |
150281-47-3 |
Picture 716.
|
$290 for 1 g |
98% |
Am-2107 |
Pyrrolidine,2-(phenylmethyl)- |
35840-91-6 |
Picture 874.
|
$120 for 1 g $330 for 5 g |
98% |
Am-2108 |
Ethanamine,2-(phenylsulfonyl)-,hydrochloride(1:1) |
38752-48-6 |
Picture 883.
|
$150 for 1 g $650 for 5 g |
98% |
Am-2109 |
Pyridine,4-(3-pyrrolidinyl)-,hydrochloride(1:2) |
1195901-61-1 |
Picture 717.
|
$290 for 1 g |
98% |
Am-2110 |
Benzenamine,3-fluoro-4-(1-piperazinyl)- |
212694-67-2 |
Picture 719.
|
|
98% |
Am-2111 |
1H-Indole-3-ethanamine,1,2-dimethyl- |
17726-03-3 |
Picture 726.
|
$190 for 1 g $850 for 5 g |
98% |
Am-2112 |
Pyridine,4-[2-[(4-nitrophenyl)thio]ethyl]- |
292060-90-3 |
Picture 727.
|
|
98% |
Am-2113 |
Carbamicacid, N-[(1S)-1-(hydroxymethyl)-3-methylbutyl]-,1,1-dimethylethylester |
82010-31-9 |
Picture 748.
|
|
98% |
Am-2114 |
1,4-Benzenediamine, N1,N1-diphenyl- |
2350-01-8 |
Picture 788.
|
$150 for 1 g $690 for 5 g |
98% |
Am-2115 |
Morpholine,2-(4-morpholinylmethyl)-(9CI) |
122894-68-2 |
Picture 812.
|
|
98% |
Am-2116 |
Methanone,4-morpholinyl-1-piperazinyl- |
98834-08-3 |
Picture 814.
|
$140 for 1 g $450 for 5 g |
98% |
Am-2117 |
Benzaldehyde,2,6-dichloro-,oxime |
25185-95-9 |
Picture 826.
|
|
98% |
Am-2118 |
Benzene,[(3,3-diethoxypropoxy)methyl]- |
|
Picture 838.
|
|
98% |
Am-2119 |
3-Pyridazinamine,6-chloro- |
5469-69-2 |
Picture 850.
|
|
98% |
Am-2120 |
Morpholine,4-[(4-nitrophenyl)methyl]-,hydrobromide(1:1) |
6472-78-2 |
Picture 853.
|
|
98% |
Am-2121 |
Benzeneethanamine,2-methyl-4-(phenylmethoxy)-N-(phenylmethyl)-,hydrochloride(1:1),(2R)- |
1126298-87-0 |
Picture 854.
|
|
98% |
Am-2122 |
Cyclobutanemethanamine,2-(2-methylpropyl)-1-phenyl- |
168835-62-9 |
Picture 855.
|
|
98% |
Am-2123 |
Benzeneacetonitrile,4-methoxy-2-phenyl- |
4578-79-4 |
Picture 861.
|
$150 for 1 g $520 for 5 g |
98% |
Am-2124 |
Pyridine,3-methyl-2-phenyl-,hydrochloride(1:1) |
1632200-07-7 |
Picture 875.
|
|
98% |
Am-2125 |
Benzenamine,4-[(4-methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)- |
694499-26-8 |
Picture 892.
|
$150 for 10 g |
98% |
Am-2126 |
3-(4-(trifluoromethyl)phenoxy)benzonitrile |
1972459-29-2 |
Picture 905.
|
|
98% |
Am-2127 |
Benzenamine,3-(1H-imidazol-1-yl)-5-(trifluoromethyl)- |
943320-48-7 |
Picture 906.
|
$450 for 1 g |
98% |
Am-2128 |
Benzenecarboximidamide,3-(2-phenylethenyl)- |
26130-65-4 |
Picture 913.
|
$130 for 1 g |
98% |
Am-2129 |
Benzenecarboximidamide,3-chloro-,hydrochloride(1:1) |
24095-60-1 |
Picture 914.
|
|
98% |
Am-2130 |
5-chloro-2-((pyridin-4-ylmethyl)amino)benzohydrazide |
N/A |
Picture 915.
|
|
98% |
Am-2131 |
Benzenecarboximidamide,3-(phenylmethoxy)- |
26130-55-2 |
Picture 916.
|
|
98% |
Am-2132 |
Benzenecarboximidamide,4-(phenylmethoxy)- |
31066-05-4 |
Picture 917.
|
|
98% |
Am-2133 |
2,4(1H,3H)-Pyrimidinedione,6-amino-3-methyl-5-nitroso- |
61033-04-3 |
Picture 918.
|
$450 for 1 g |
98% |
Am-2134 |
Benzenecarboximidamide,4-(trifluoromethyl)-,hydrochloride,hydrate(1:1:2) |
175278-62-3 |
Picture 919.
|
$150 for 5 g |
98% |
Am-2135 |
Benzenepropanamine,BETA-phenyl-,hydrochloride(1:1) |
40692-28-2 |
Picture 925.
|
|
98% |
Am-2136 |
Carbamicacid,[(1S,2R)-2-cyano-2-hydroxy-1-(phenylmethyl)ethyl]-,1,1-dimethylethylester(9CI) |
105116-40-3 |
Picture 927.
|
|
98% |
Am-2137 |
Benzaldehyde,2,3-dichloro-,oxime |
414-54-4 |
Picture 929.
|
|
98% |
Am-2138 |
1-Propanamine,3-methoxy-,hydrochloride(1:1) |
18600-41-4 |
Picture 936.
|
|
98% |
Am-2139 |
2-Propanone,2-[4-fluoro-2-(methylsulfonyl)phenyl]hydrazone |
1174743-98-6 |
Picture 937.
|
|
98% |
Am-2140 |
2-Propenamide,3-(2,4-dichlorophenyl)-N-hydroxy- |
886574-70-5 |
Picture 938.
|
|
98% |
Am-2141 |
Benzenemethanamine,4-ethenyl- |
50325-49-0 |
Picture 978.
|
$350 for 5 g |
98% |
Am-2142 |
3-(2-((4-nitrophenyl)thio)ethyl)pyridine |
N/A |
Picture 992.
|
|
98% |
Am-2143 |
Hydrazinecarboxamide, N-(2-methyl-5-nitrophenyl)- |
1239741-44-6 |
Picture 995.
|
|
98% |
Am-2144 |
Pyrrolidine,3-(methylsulfonyl)-1-(phenylmethyl)- |
859731-42-3 |
Picture 1013.
|
|
98% |
Am-2145 |
Benzeneacetonitrile,4,5-dihydroxy-2-nitro- |
117568-28-2 |
Picture 1028.
|
|
98% |
Am-2146 |
Benzenamine,2-chloro-3-methoxy-,hydrochloride(1:1) |
85893-87-4 |
Picture 1029.
|
$350 for 5 g |
98% |
Am-2147 |
3-ethyl-4-methylanilinehydrochloride |
N/A |
Picture 1067.
|
|
98% |
Am-2148 |
5-Quinolinamine,2-methyl- |
54408-50-3 |
Picture 1068.
|
|
98% |
Am-2149 |
Benzenamine,2-chloro-4-fluoro- |
2106-02-7 |
Picture 1072.
|
|
98% |
Am-2150 |
4-amino-3-nitrophenylpivalate |
N/A |
Picture 1074.
|
|
98% |
Am-2151 |
Benzoicacid,2-amino-4-chloro-,methylester |
5900-58-3 |
Picture 1075.
|
|
98% |
Am-2152 |
Carbamicacid, N-(3-methyl-2-pyridinyl)-,1,1-dimethylethylester |
138343-75-6 |
Picture 1083.
|
$300 for 25 g |
98% |
Am-2153 |
1,3-Benzenediamine,4,4'-[1,3-propanediylbis(oxy)]bis-,hydrochloride(1:4) |
74918-21-1 |
Picture 1089.
|
|
98% |
Am-2154 |
1-((2-chlorophenyl)(imino)methyl)cyclopentanol |
79499-57-3 |
Picture 1096.
|
|
98% |
Am-2155 |
Cyclobutanecarbonitrile,1-(2-chlorophenyl)- |
28049-59-4 |
Picture 1121.
|
$390 for 1 g |
98% |
Am-2156 |
Cyclobutanecarbonitrile,1-phenyl- |
14377-68-5 |
Picture 1136.
|
$100 for 10 g |
98% |
Am-2157 |
N1,N2,N2-trimethyl-1-phenylethane-1,2-diaminedihydrochloride |
N/A |
Picture 1145.
|
|
98% |
Am-2158 |
1-cyclohexyl-2-methoxyethanaminehydrochloride |
N/A |
Picture 1146.
|
|
98% |
Am-2159 |
1-(2-chlorophenyl)-2-morpholinoethanamine |
1851830-39-1 |
Picture 1147.
|
|
98% |
Am-2160 |
4-Pyridinamine,2,6-dichloro- |
2587-02-2 |
Picture 1157.
|
|
98% |
Am-2161 |
Pyridine,2,6-dichloro-3-nitro- |
16013-85-7 |
Picture 1171.
|
|
98% |
Am-2162 |
4-((7-chloro-2,4-dioxo-1,2-dihydroquinazolin-3(4H)-yl)sulfonyl)-2-nitrobenzoicacid |
N/A |
Picture 1181.
|
|
98% |
Am-2163 |
2-Piperazinone,3,3-dimethyl- |
22476-74-0 |
Picture 1187.
|
$190 for 5 g |
98% |
Am-2164 |
methyl2-amino-4-chlorobenzoate |
5900-58-3 |
Picture 1197.
|
|
98% |
Am-2165 |
1,3-Propanediol,2-amino-2-[2-(4-octylphenyl)ethyl]-,hydrochloride(1:1) |
162359-56-0 |
Picture 1223.
|
$180 for 1 g $750 for 5g |
98% |
Am-2166 |
(2S,4R)-1-benzyl2-methyl4-aminopyrrolidine-1,2-dicarboxylatehydrochloride |
739360-84-0 |
Picture 1224.
|
|
98% |
Am-2167 |
Piperazine,1-(2-fluoro-4-nitrophenyl)- |
154590-33-7 |
Picture 1229.
|
$150 for 5 g |
98% |
Am-2168 |
4-isopropyl-N-(4-(methylamino)benzyl)aniline |
1903699-37-5 |
Picture 1232.
|
|
98% |
Am-2169 |
tert-butyl(7-hydroxyheptyl)(methyl)carbamate |
N/A |
Picture 1233.
|
|
98% |
Am-2170 |
Cyclopropanecarbonitrile,1-(4-chlorophenyl)- |
64399-27-5 |
Picture 1234.
|
|
98% |
Am-2171 |
tert-butyl3-methylpiperazine-1-carboxylate |
120737-59-9 |
Picture 1242.
|
$120 for 25 g |
98% |
Am-2172 |
1,3-Propanediol,2-amino-2-[2-(4-octylphenyl)ethyl]- |
162359-55-9 |
Picture 1279.
|
|
98% |
Am-2173 |
1-(piperidin-4-ylmethyl)piperidinedihydrochloride |
32470-52-3 |
Picture 1280.
|
$250 for 1 g |
98% |
Am-2174 |
1-Piperazinecarboxylicacid,1,1-dimethylethylester |
57260-71-6 |
Picture 1281.
|
|
98% |
Am-2175 |
2-Pyridinamine,4-methyl-3-nitro- |
6635-86-5 |
Picture 1283.
|
|
98% |
Am-2176 |
tert-butyl(1-(N-(benzyloxy)formamido)-4-methylpentan-2-yl)carbamate |
N/A |
Picture 1291.
|
|
98% |
Am-2177 |
Benzenecarboximidamide,3-bromo- |
26157-85-7 |
Picture 1293.
|
$350 for 10 g |
98% |
Am-2178 |
2-Propanol,1-amino-2-methyl- |
854-16-2 |
Picture 1304.
|
|
98% |
Am-2179 |
tert-butyl(1-((tert-butyldimethylsilyl)oxy)-1-cyano-3-phenylpropan-2-yl)carbamate |
105116-42-5 |
Picture 1307.
|
|
98% |
Am-2180 |
tert-butyl(8-hydroxyoctyl)(methyl)carbamate |
808757-09-7 |
Picture 1309.
|
|
98% |
Am-2181 |
1,2-Ethanediamine, N1,N1-dimethyl-1-(3-pyridinyl)- |
638220-38-9 |
Picture 1310.
|
$450 for 1 g |
98% |
Am-2182 |
(R)-phenyl(4-(3,4-dichlorobenzyl)morpholin-2-yl)carbamate |
N/A |
Picture 1312.
|
|
98% |
Am-2183 |
tert-butyl4-(N-(tert-butyl)sulfamoyl)-2-nitrobenzoate |
N/A |
Picture 1313.
|
|
98% |
Am-2184 |
1H-Indole-5,6-diol,2,3-dihydro- |
29539-03-5 |
Picture 1322.
|
$350 for 5 g |
98% |
Am-2185 |
2(1H)-Pyridinone,4-methyl-3-nitro- |
21901-18-8 |
Picture 1330.
|
|
98% |
Am-2186 |
3-Pyridinecarboxylicacid,2-amino-,methylester |
14667-47-1 |
Picture 1338.
|
|
98% |
Am-2187 |
tert-butyl4-(oxiran-2-yl)benzylcarbamate |
N/A |
Picture 1348.
|
|
98% |
Am-2188 |
4-Pyridinamine,2-chloro-3-nitro- |
2789-25-5 |
Picture 1358.
|
$150 for 5 g |
98% |
Am-2189 |
4-Pyridinamine,2-chloro-5-nitro- |
2604-39-9 |
Picture 1359.
|
$150 for 5 g |
98% |
Am-2190 |
3,4-Pyridinediamine,2-chloro- |
39217-08-8 |
Picture 1360.
|
$120 for 10 g |
98% |
Am-2191 |
7-chloro-1-(4-methoxybenzyl)-4-(methoxymethyl)quinolin-1-iumiodide |
N/A |
Picture 1362.
|
|
98% |
Am-2192 |
7-chloro-4-iodo-1-(4-methoxybenzyl)quinolin-1-iumiodide |
N/A |
Picture 1363.
|
|
98% |
Am-2193 |
4-methyl-3-thioureidophenylacetate |
N/A |
Picture 1368.
|
|
98% |
Am-2194 |
(E)-1-isopropyl-4-(2-nitrovinyl)benzene |
42139-37-7 154242-18-9 |
Picture 1380.
|
$150 for 10 g |
98% |
Am-2195 |
1-isopropyl-4-(2-nitroethyl)benzene |
1268141-27-0 |
Picture 1381.
|
|
98% |
Am-2196 |
N-(4-isopropylphenethyl)-3,5-dimethylbenzamide |
1004058-99-4 |
Picture 1382.
|
|
98% |
Am-2197 |
(S)-tert-butyl3-((tert-butoxycarbonyloxy)methyl)-3-fluoropiperidine-1-carboxylate |
N/A |
Picture 1383.
|
|
98% |
Am-2198 |
3-amino-2,4-dichlorophenolhydrochloride |
61693-43-4 |
Picture 1400.
|
$150 for 1 g $450 for 5 g |
98% |
Am-2199 |
3,5-dichloro-4-aminopyridine |
22889-78-7 |
Picture 1402.
|
|
98% |
Am-2200 |
(S)-2-(trifluoromethanesulfonylaminomethyl)-pyrrolidine |
1186049-30-8 |
Picture 1406.
|
$220 for 1 g |
98% |
Am-2201 |
(R)-trifluoro-N-(pyrrolidin-2-ylmethyl)methanesulfonamide |
782495-18-5 |
Picture 1407.
|
$150 for 250 mg $580 for 1 g |
98% |
Am-2202 |
2-[[3-[[1,3-bis(oxidanylidene)-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]phenyl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
1212382-00-7 1176575--98-6 |
Picture 1433.
|
|
98% |
Am-2203 |
6-chloro-2-methylaminonicotinonitrile |
1187190-73-3 |
Picture 1437.
|
|
98% |
Am-2204 |
tert-butyl2-amino-4,5-dimethoxybenzylcarbamate |
N/A |
Picture 1480.
|
|
98% |
Am-2205 |
1-(3-bromo-2,6-dichlorobenzyl)hydrazinehydrochloride |
N/A |
Picture 1487.
|
|
98% |
Am-2206 |
1-benzyl-3-bromo-1,2,5,6-tetrahydropyridine |
1159982-62-3 |
Picture 1503.
|
#250 for 1 g $750 for 5 g |
98% |
Am-2207 |
N-(2-ethyl-3-methylphenyl)acetamide |
111923-31-0 |
Picture 1527.
|
|
98% |
Am-2208 |
(R)-1-(4-fluorobenzyl)-3-methylpiperazine |
422270-29-9 |
Picture 1532.
|
|
98% |
Am-2209 |
(R)-2-(4-(4-fluorobenzyl)-2-methylpiperazin-1-yl)-2-oxoethylacetate |
N/A |
Picture 1533.
|
|
98% |
Am-2210 |
tert-butyl4-(2-amino-2-oxo-1-phenylethyl)piperazine-1-carboxylate |
1252044-18-0 |
Picture 1535.
|
|
98% |
Am-2211 |
2-morpholino-2-phenylacetamide |
6327-69-1 |
Picture 1536.
|
|
98% |
Am-2212 |
tert-butyl4-methylpyridin-3-ylcarbamate |
180253-66-1 |
Picture 1541.
|
$450 for 5 g |
98% |
Am-2213 |
methyl 2-(4,5-dimethoxy-2-nitrophenyl)acetate |
2982-53-8 |
Picture 1544.
|
$300 for 5 g |
98% |
Am-2214 |
2-(piperidin-1-yl)-5-(trifluoromethyl)benzenamine |
1496-40-8 |
Picture 1545.
|
|
98% |
Am-2215 |
(S)-2-amino-4-methyl-1-((S)-2-methyloxiran-2-yl)pentan-1-one |
N/A |
Picture 1552.
|
|
98% |
Am-2216 |
tert-butyl(S)-4-methyl-1-((S)-2-methyloxiran-2-yl)-1-oxopentan-2-ylcarbamate |
N/A |
Picture 1553.
|
|
98% |
Am-2217 |
6-hydrazino-1H,3H-pyrimidine-2,4-dione |
893631-08-8 |
Picture 1607.
|
$390 for 1 g |
98% |
Am-2218 |
phenylN-(8-azabicyclo[3.2.1]octan-3-yl)carbamate |
1308622-09-4 |
Picture 1614.
|
|
98% |
Am-2219 |
2-bromo-3,4-dimethoxy-N-methylbenzylamine |
140843-32-9 |
Picture 1619.
|
|
98% |
Am-2220 |
ethyl3-(2,3-dimethoxyphenyl)-3-oxopropyl(methyl)carbamate |
N/A |
Picture 1620.
|
|
98% |
Am-2221 |
endo-benzyl8-azabicyclo[3.2.1]oct-3-ylcarbamate |
913575-14-1 1335151-55-7 1823223-38-6 |
Picture 1621.
|
|
98% |
Am-2222 |
1-(2-Hydroxy-5-chlorophenyl)urea |
57718-28-2 |
Picture 1623.
|
|
98% |
Am-2223 |
3-butyl-4-methylbenzenaminehydrochloride |
N/A |
Picture 1625.
|
|
98% |
Am-2224 |
4-methyl-3-propylbenzenaminehydrochloride |
N/A |
Picture 1628.
|
|
98% |
Am-2225 |
1'-benzyl-2',3',5',6'-tetrahydro-1'H-[3,4']bipyridinyl-4'-ol |
188879-36-9 |
Picture 1637.
|
|
98% |
Am-2226 |
2-Aminoisobutyricacidbenzylesterp-toluenesulfonate |
79118-16-4 |
Picture 1667.
|
|
98% |
Am-2227 |
tert-butylN-(3-chloropropyl)carbamate |
116861-31-5 |
Picture 1673.
|
$350 for 5 g |
98% |
Am-2228 |
2-(4-bromo-3-oxobutyl)isoindoline-1,3-dione |
51132-00-4 |
Picture 1682.
|
$550 for 5 g |
98% |
Am-2229 |
tert-butyl4-(5-amino-1-methylindolin-3-yl)piperidine-1-carboxylate |
N/A |
Picture 1683.
|
|
98% |
Am-2230 |
methyl4-amino-2-chlorobenzoate |
46004-37-9 |
Picture 1684.
|
$120 for 25 g |
98% |
Am-2231 |
L-leucyl-L-phenylalaninemethylester |
38155-18-9 |
Picture 1686.
|
|
98% |
Am-2232 |
3-N-tert-butoxycarbonyl-3-(R)-aminopyrrolidine |
122536-77-0 |
Picture 1687.
|
|
98% |
Am-2233 |
Indan-2-yl-phenyl-(2-pyrrolidin-2-yl-ethyl)-amine |
N/A |
Picture 1693.
|
|
98% |
Am-2234 |
ethyl2-piperazinecarboxylate |
89941-07-1 |
Picture 1709.
|
$300 for 10 g |
98% |
Am-2235 |
4-Ethyl-5-nitro-pyridin-2-ylamine |
70936-17-3 |
Picture 1711.
|
|
98% |
Am-2236 |
N-{3-[(diethylamino)methyl]-4-hydroxyphenyl}acetamide |
121-78-8 |
Picture 1733.
|
$120 for 1 g $450 for 5 g |
98% |
Am-2237 |
Phenol,4-amino-3-nitro- |
610-81-1 |
Picture 1124.
|
|
98% |
Am-2238 |
2-amino-4-bromo-6-fluorobenzonitrile |
1279865-14-3 |
Picture 1499.
|
$220 for 250 mg |
98% |
Am-2239 |
6-amino-5,8-dimethylquinolin-2(1H)-one |
N/A |
Picture 144.
|
|
98% |
Am-2240 |
1(2H)-Isoquinolinone,6-amino-5,8-dimethyl- |
69022-58-8 |
Picture 154.
|
$280 for 1 g $780 for 5 g |
98% |
Am-2241 |
1,2-Naphthalenedione,7-amino- |
63037-75-2 |
Picture 155.
|
|
98% |
Am-2242 |
N-(7-hydroxynaphthalen-2-yl)acetamide |
N/A |
Picture 159.
|
|
98% |
Am-2243 |
Acetamide, N-(1,2-dihydro-5,8-dimethyl-1-oxo-6-isoquinolinyl)- |
69022-57-7 |
Picture 163.
|
|
98% |
Am-2244 |
2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one,6-amino-2,2-dimethyl- |
1002726-62-6 |
Picture 200.
|
$250 for 5 g |
98% |
Am-2245 |
1H-1,2,3-Triazole,1-(3-nitrophenyl)- |
16279-91-7 |
Picture 204.
|
|
98% |
Am-2246 |
Benzenamine,3-(2H-1,2,3-triazol-2-yl)- |
626248-56-4 |
Picture 207.
|
$200 for 5 g |
98% |
Am-2247 |
1H-Pyrazole-4-carboxamide,5-amino-1-methyl- |
18213-75-7 |
Picture 226.
|
$300 for 5 g |
98% |
Am-2248 |
3-chloro-N-isobutyl-2-nitronaphthalen-1-amine |
N/A |
Picture 283.
|
|
98% |
Am-2249 |
Ethanamine,2-methoxy-N,N-dimethyl- |
3030-44-2 |
Picture 289.
|
$280 for 1 g |
98% |
Am-2250 |
2(1H)-Quinolinone,5-amino-3,4-dihydro- |
58130-38-4 |
Picture 301.
|
$480 for 1 g |
98% |
Am-2251 |
1H-Indol-5-amine,4-methyl- |
196205-06-8 |
Picture 339.
|
$350 for 1 g |
98% |
Am-2252 |
Benzonitrile,4-(1-hydroxy-1-methylethyl)- |
77802-22-3 |
Picture 342.
|
$350 for 1 g |
98% |
Am-2253 |
Pyridine,1,2,3,6-tetrahydro-4-methyl-1-(phenylmethyl)- |
32018-56-7 |
Picture 358.
|
$480 for 5 g |
98% |
Am-2254 |
1-benzyl-2-(2-iodoethyl)piperidine |
N/A |
Picture 400.
|
|
98% |
Am-2255 |
2-Butanol,4-(dimethylamino)-2-methyl- |
18502-49-3 |
Picture 420.
|
|
98% |
Am-2256 |
Benzaldehyde,3,4-dichloro-,oxime |
5331-92-0 |
Picture 428.
|
|
98% |
Am-2257 |
Pyrrolidine,2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-,hydrochloride(1:1) |
123948-28-7 |
Picture 520.
|
|
98% |
Am-2258 |
2-Oxazolamine |
4570-45-0 |
Picture 522.
|
$250 for 25 g |
98% |
Am-2259 |
Methanaminium, N-[3-(dimethylamino)-2-(trifluoromethyl)-2-propen-1-ylidene]-N-methyl-,hexafluorophosphate(1-)(1:1) |
292067-88-0 |
Picture 532.
|
$680 for 5 g |
98% |
Am-2260 |
3-Pyridazinamine,6-phenyl- |
14966-91-7 |
Picture 543.
|
$550 for 5 g |
98% |
Am-2261 |
Carbamicacid,[1-(2-naphthalenylcarbonyl)-4-piperidinyl]-,1,1-dimethylethylester(9CI) |
518062-45-8 |
Picture 560.
|
|
98% |
Am-2262 |
4-((5-aminonaphthalen-1-yl)amino)-4-oxobutanoicacid |
N/A |
Picture 1182.
|
|
98% |
Am-2263 |
Benzene,1-bromo-3-methoxy-5-nitro- |
16618-67-0 |
Picture 1199.
|
|
98% |
Am-2264 |
2-aminothiazol-5-yl-carboxylic acid ethyl ester |
1857147-86-2 |
Picture 1219.
|
|
98% |
Am-2265 |
3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine |
631909-35-8 |
Picture 1508.
|
|
98% |
Am-2266 |
H-Inden-2-amine,2,3-dihydro-N-phenyl- |
33237-72-8 |
Picture 433.
|
$600 for 1 g |
98% |
Am-2267 |
Hydroxylamine, O-(cyclopropylmethyl)-,hydrochloride(1:1) |
74124-04-2 |
Picture 431.
|
$150 for 1 g $600 for 5 g |
98% |
Am-2268 |
Benzenamine,3,4-dichloro-,hydrochloride(1:1) |
33240-95-8 |
Picture 432.
|
|
98% |
Am-2269 |
2-Pyrazinamine,5-bromo- |
59489-71-3 |
Picture 1142.
|
|
98% |
Am-2270 |
(2R,5S)-1,4-dibenzyl-2,5-dimethylpiperazine |
N/A |
Picture 8.
|
|
98% |
Am-2271 |
1-Butanamine,4-methoxy-,hydrochloride(1:1) |
1082681-91-1 |
Picture 605.
|
|
98% |
Am-2272 |
1H-Isoindole-1,3(2H)-dione,2-[2-(ethenyloxy)ethoxy]- |
391212-30-9 |
Picture 734.
|
$150 for 1 g $450 for 5 g |
98% |
Am-2273 |
2-Morpholinemethanamine,4-[(3,4-dichlorophenyl)methyl]-,(2R)- |
407640-13-5 |
Picture 755.
|
|
98% |
Am-2274 |
Morpholine,4,4'-(1,2-ethanediyl)bis- |
1723-94-0 |
Picture 803.
|
|
98% |
Am-2275 |
Piperazine,1,1'-(1,2-ethanediyl)bis[4-(phenylmethyl)- |
658-81-1 |
Picture 806.
|
|
98% |
Am-2276 |
8-Azabicyclo[3.2.1]oct-2-ene,3-(3-methoxyphenyl)-8-(phenylmethyl)-,hydrochloride(1:1) |
949902-69-6 |
Picture 847.
|
|
98% |
Am-2277 |
Carbamicacid,1,1-dimethylethylester |
4248-19-5 |
Picture 900.
|
|
98% |
Am-2278 |
(E)-4,4'-(ethene-1,2-diyl)bis(3-(isopropylsulfonyl)aniline) |
N/A |
Picture 46.
|
|
98% |
Am-2279 |
(E)-4-(4-amino-2-(tert-butylsulfonyl)styryl)-3-(isopropylsulfonyl)aniline |
N/A |
Picture 1196.
|
|
98% |
Am-2280 |
1-(4-fluorophenyl)-2-(2-imino-2,3-dihydropyrrol-1-yl)ethanonehydrobromide |
N/A |
Picture 1273.
|
|
98% |
Am-2281 |
(S)-2-(piperidin-1-yl)-1-phenylethanol |
83829-03-2 |
Picture 1562.
|
|
98% |
Am-2282 |
3-ethyl-4-methylanilinehydrochloride |
N/A |
Picture 28.
|
$100 for 1 g $500 for 10 g |
98% |
Am-2283 |
N1,N2,N2-trimethyl-1-phenylethane-1,2-diaminedihydrochloride |
N/A |
Picture 257.
|
|
98% |
Am-2284 |
1-cyclohexyl-2-methoxyethanaminehydrochloride |
N/A |
Picture 266.
|
|
98% |
Am-2285 |
1-(2-chlorophenyl)-2-morpholinoethanamin |
1851830-39-1 |
Picture 278.
|
$200 for 1 g |
98% |
Am-2286 |
(E)-tert-butyl(6-hydroxybicyclo[6.2.0]decan-2-ylidene)carbamate |
N/A |
Picture 302.
|
|
98% |
Am-2287 |
1-benzyl-2-(2-(benzyloxy)ethyl)piperidine |
N/A |
Picture 384.
|
|
98% |
Am-2288 |
4-amino-3-nitrophenylpivalate |
N/A |
Picture 478.
|
|
98% |
Am-2289 |
methyl2-amino-4-chlorobenzoate |
5900-58-3 |
Picture 484.
|
|
98% |
Am-2290 |
2,2,2-trichloroethyltert-butylcarbamate |
N/A |
Picture 517.
|
|
98% |
Am-2291 |
6-Chloro-2,3-methylenedioxyaniline |
946407-59-6 |
Picture 518.
|
|
98% |
Am-2292 |
1,2-Pyrrolidinedicarboxylic acid, 4-amino-, 2-methyl 1-(phenylmethyl) ester, hydrochloride (1:1), (2R,4S)-
|
739360-84-0 |
Picture 553.
|
|
98% |
Am-2293 |
Hydrazine,(4-methoxyphenyl)-,hydrochloride(1:1) |
19501-58-7 |
Picture 564.
|
|
98% |
Am-2294 |
tert-butyl4-(2-amino-2-oxo-1-(4-(trifluoromethyl)phenyl)ethyl)piperazine-1-carboxylate |
N/A |
Picture 575.
|
|
98% |
Am-2295 |
tert-butyl(7-hydroxyheptyl)(methyl)carbamate |
N/A |
Picture 582.
|
|
98% |
Am-2296 |
tert-butyl3-methylpiperazine-1-carboxylate |
120737-59-9 |
Picture 618.
|
$120 for 25 g |
98% |
Am-2297 |
1-(4-fluorophenyl)-2-(2-imino-2,3-dihydropyrrol-1-yl)ethanonehydrobromide |
N/A |
Picture 658.
|
|
98% |
Am-2298 |
1-(piperidin-4-ylmethyl)piperidinedihydrochloride |
32470-52-3 |
Picture 675.
|
$250 for 1 g |
98% |
Am-2299 |
tert-butyl(1-(N-(benzyloxy)formamido)-4-methylpentan-2-yl)carbamate |
N/A |
Picture 692.
|
|
98% |
Am-2300 |
N-(8-hydroxyoctyl)-N-methylbenzamide |
808757-09-7 |
Picture 761.
|
|
98% |
Am-2301 |
2-Propanamine, N-hydroxy-2-methyl- |
16649-50-6 |
Picture 810.
|
|
98% |
Am-2302 |
2-Propanol,1-amino-2-methyl- |
2854-16-2 |
Picture 858.
|
|
98% |
Am-2303 |
2-morpholino-1-phenylethanaminiumchloride |
N/A |
Picture 889.
|
$150 for 1 g $490 for 5 g |
98% |
Am-2304 |
tert-butyl4-(oxiran-2-yl)benzylcarbamate |
N/A |
Picture 972.
|
|
98% |
Am-2305 |
7-chloro-1-(4-methoxybenzyl)-4-(methoxymethyl)quinolin-1-iumiodide |
N/A |
Picture 1006.
|
|
98% |
Am-2306 |
7-chloro-4-iodo-1-(4-methoxybenzyl)quinolin-1-iumiodide |
N/A |
Picture 1007.
|
|
98% |
Am-2307 |
4-methyl-3-thioureidophenylacetate |
N/A |
Picture 1023.
|
|
98% |
Am-2308 |
pyridin-3-ylmethyl2-((4-((3-aminophenyl)carbamoyl)phenyl)amino)acetate |
N/A |
Picture 1032.
|
|
98% |
Am-2309 |
N-(2-hydroxy-1,2,2-triphenylethyl)-1-oxoethanesulfonamide |
N/A |
Picture 1037.
|
|
98% |
Am-2310 |
2-Pyridinamine,4-methyl-5-nitro- |
21901-40-6 |
Picture 1284.
|
|
98% |
Am-2311 |
1H-Inden-2-ol,1-aminooctahydro- |
62210-18-8 |
Picture 238.
|
|
98% |
Am-2312 |
Piperazine,1-(2,3-dichlorophenyl)- |
41202-77-1 |
Picture 666.
|
$150 for 25 g |
98% |
Ar-4001 |
2-bromobenzo[9,10]phenanthrene |
19111-87-6 |
Picture 31.
|
$200 for 10 g $400 for 25 g |
98% |
Ar-4002 |
Triphenylene |
217-59-4 |
Picture 32.
|
$100 for 10 g $200 for 25 g |
98% |
Ar-4003 |
Phenol,4-bromo-2-(1,1-dimethylethyl)-5-nitro- |
873055-68-6 |
Picture 41.
|
|
98% |
Ar-4004 |
Benzene,2-bromo-1-fluoro-4-nitro- |
701-45-1 |
Picture 87.
|
|
98% |
Ar-4005 |
Phenol,5-[(2-hydroxyethyl)amino]-2-methyl- |
55302-96-0 |
Picture 187.
|
|
98% |
Ar-4006 |
Benzene,1-bromo-4,5-dimethoxy-2-nitro- |
51072-66-3 |
Picture 571.
|
|
98% |
Ar-4007 |
Phenol,2-(chloromethyl)-4-nitro- |
2973-19-5 |
Picture 594.
|
$490 for 5 g |
98% |
Ar-4008 |
Thiocyanicacid,4-hydroxy-3-methylphenylester |
3774-53-6 |
Picture 841.
|
|
98% |
Ar-4009 |
Acetamide, N-(3-bromo-4-hydroxyphenyl)- |
6329-78-8 |
Picture 934.
|
|
98% |
Ar-4010 |
Benzene,1-bromo-2-fluoro-4-nitro- |
185331-69-5 |
Picture 1088.
|
|
98% |
Ar-4011 |
2-chloroethyl(4-hydroxy-2-nitrophenyl)carbamate |
65235-20-3 |
Picture 1098.
|
|
98% |
Ar-4012 |
2-bromo-6-ethoxy-3-(hydroxymethyl)phenol |
N/A |
Picture 1594.
|
|
98% |
Ar-4013 |
3-(2-hydroxypropan-2-yl)phenol |
7765-97-1 |
Picture 1529.
|
$390 for 1 g |
98% |
Ar-4014 |
Phenol,3-bromo-4-methoxy- |
17332-12-6 |
Picture 1204.
|
$180 for 5 g |
98% |
Ar-4015 |
1-bromanyl-2-fluoranyl-3-methyl-5-(trifluoromethyl)benzene |
N/A |
Picture 1485.
|
|
98% |
Ar-4016 |
1-Naphthalenol,4-nitro- |
605-62-9 |
Picture 933.
|
$150 for 5 g |
98% |
Ar-4017 |
4-Methyl-3-nitro-phenol |
2042-14-0 |
Picture 1721.
|
$200 for 250 g $600 for 1 kg |
98% |
Ar-4018 |
Benzoicacid,3-bromo-5-fluoro-6-methyl-2-(phenylmethoxy)-,phenylester |
1207285-04-8 |
Picture 59.
|
|
98% |
Ar-4019 |
Benzene,4-(bromomethyl)-1-chloro-2-iodo- |
136558-15-1 |
Picture 60.
|
$480 for 1 g |
98% |
Ar-4020 |
1-bromo-3-bromomethyl-2,4-dichloro-benzene |
886615-35-6 |
Picture 1486.
|
|
98% |
Ar-4021 |
2-Fluoro-4-BromobenzylBromide |
76283-09-5 |
Picture 1265.
|
|
98% |
Ar-4022 |
tert-butyl4'-(bromomethyl)-2'-chloro-[1,1'-biphenyl]-2-carboxylate |
N/A |
Picture 885.
|
|
98% |
Ar-4023 |
Benzoicacid,3-fluoro-6-hydroxy-2-methyl-,phenylester |
1207283-55-3 |
Picture 61.
|
$300 for 1 g $1200 for 5 g |
98% |
Ar-4024 |
3,9'-Bi-9H-carbazole |
18628-07-4 |
Picture 67.
|
$200 for 1 g $750 for 5 g |
98% |
Ar-4025 |
Benzamide, N-(3-chloro-4-fluorophenyl)-2-hydroxy-5-methoxy- |
1305204-00-5 |
Picture 93.
|
|
98% |
Ar-4026 |
Aceticacid,2-[[5-(2-bromoethyl)-5,6,7,8-tetrahydro-1-naphthalenyl]oxy]-,methylester |
150560-14-8 |
Picture 126.
|
|
98% |
Ar-4027 |
Benzeneaceticacid,3-chloro-4-[[(dimethylamino)carbonyl]thio]-,methylester |
91361-78-3 |
Picture 132.
|
|
98% |
Ar-4028 |
Acetamide, N-(4-bromo-5-fluoro-2-methylphenyl)- |
633335-80-5 |
Picture 161.
|
$150 for 5 g |
98% |
Ar-4029 |
Benzenesulfonicacid,4-iodo- |
13035-63-7 |
Picture 235.
|
|
98% |
Ar-4030 |
[1,1'-Biphenyl]-3-methanol,4'-fluoro- |
773871-79-7 |
Picture 239.
|
|
98% |
Ar-4031 |
Benzene,1-bromo-4-(4-methylphenoxy)- |
30427-93-1 |
Picture 269.
|
|
98% |
Ar-4032 |
Benzene,1-bromo-4-(4-methoxyphenoxy)- |
42203-37-2 |
Picture 305.
|
|
98% |
Ar-4033 |
Benzene,1,2-dichloro-4-phenoxy- |
55538-69-7 |
Picture 369.
|
$380 for 25 g |
98% |
Ar-4034 |
enzene,1-(4-bromophenoxy)-2-chloro- |
1283109-76-1 |
Picture 381.
|
|
98% |
Ar-4035 |
1-(3-bromophenoxy)-2-methylbenzene |
N/A |
Picture 1046.
|
|
98% |
Ar-4036 |
Benzene,1-(4-bromophenoxy)-2-(trifluoromethyl)- |
1092841-39-8 |
Picture 1049.
|
|
98% |
Ar-4037 |
Benzene,1-(chlorophenylmethyl)-4-methoxy- |
6731-11-9 |
Picture 1051.
|
|
98% |
Ar-4038 |
Benzene,1-bromo-3-phenoxy- |
6876-00-2 |
Picture 1144.
|
$180 for 10 g |
98% |
Ar-4039 |
Pyridine,3-phenoxy- |
2176-45-6 |
Picture 1035.
|
$130 for 1 g $420 for 5 g |
98% |
Ar-4040 |
Benzonitrile,2-chloro-3-iodo- |
1261580-84-0 |
Picture 337.
|
$580 for 1 g |
98% |
Ar-4041 |
Naphthalene,1-bromo-8-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]- |
274914-03-3 |
Picture 361.
|
|
98% |
Ar-4042 |
1,1'-Biphenyl,4,4'-bis(3-cyclohexen-1-ylmethoxy)- |
1162683-28-4 |
Picture 542.
|
|
98% |
Ar-4043 |
Benzene,1-(3-cyclohexen-1-ylmethoxy)-2,4-bis(1-methyl-1-phenylethyl)- |
1162683-34-2 |
Picture 388.
|
|
98% |
Ar-4044 |
Benzene,1,4-bis(3-cyclohexen-1-ylmethoxy)- |
1162683-31-9 |
Picture 928.
|
|
98% |
Ar-4045 |
1-(2-(4-(cyclohex-3-en-1-ylmethoxy)phenyl)propan-2-yl)-3-(cyclohex-3-en-1-ylmethyl)benzene |
N/A |
Picture 931.
|
|
98% |
Ar-4046 |
Benzene,1-iodo-4-octyl- |
133826-41-2 |
Picture 541.
|
|
98% |
Ar-4047 |
Benzene,1-bromo-2,3,4-trimethoxy-6-methyl-5-(phenylmethoxy)- |
82343-06-4 |
Picture 764.
|
|
98% |
Ar-4048 |
Benzene,1,2,3,4-tetramethoxy-5-methyl- |
35896-58-3 |
Picture 770.
|
|
98% |
Ar-4049 |
1-(5-iodonaphthalen-1-yl)pyrrolidine-2,5-dione |
N/A |
Picture 835.
|
|
98% |
Ar-4050 |
Boronicacid, B-(3-fluorophenyl)- |
768-35-4 |
Picture 845.
|
|
98% |
Ar-4051 |
Benzene,2-bromo-4-fluoro-1-(phenylmethoxy)- |
660842-05-7 |
Picture 911.
|
$150 for 1 g |
98% |
Ar-4052 |
Benzene,2-bromo-4-chloro-1-(phenylmethoxy)- |
151038-76-5 |
Picture 921.
|
|
98% |
Ar-4053 |
Benzene,2-bromo-4-methyl-1-(phenylmethoxy)- |
2830-53-7 |
Picture 1340.
|
$190 for 5 g $350 for 10 g |
98% |
Ar-4054 |
Benzamide,4-hydroxy-3,5-dimethoxy- |
3086-72-4 |
Picture 939.
|
|
98% |
Ar-4055 |
Benzene,1,2,3-trifluoro-5-methoxy-4-nitro- |
925890-13-7 |
Picture 1084.
|
$150 for 5 g |
98% |
Ar-4056 |
1,4-Naphthalenediol,2-methyl-,1,4-diacetate |
573-20-6 |
Picture 1179.
|
|
98% |
Ar-4057 |
Phenol,3-bromo-4-methoxy- |
17332-12-6 |
Picture 1204.
|
$180 for 5 g |
98% |
Ar-4058 |
1-bromanyl-2-fluoranyl-3-methyl-5-(trifluoromethyl)benzene |
N/A |
Picture 1485.
|
|
98% |
Ar-4059 |
2,6-dibromophenol |
608-33-3 |
Picture 1740.
|
|
98% |
Ar-4060 |
Benzene,(1-chloro-1-methylethyl)- |
934-53-2 |
Picture 291.
|
$180 for 5 g |
98% |
Ar-4061 |
2,6-Piperidinedione,4-(4-bromophenyl)- |
1137-60-6 |
Picture 437.
|
|
98% |
Ar-4062 |
3-Quinolinecarboxylicacid,7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-,ethylester |
86483-54-7 |
Picture 441.
|
|
98% |
Ar-4063 |
Benzoicacid,2-fluoro-4-nitro-,1,1-dimethylethyleste |
157665-46-8 |
Picture 680.
|
|
98% |
Ar-4064 |
1,3-Benzenediol,2-propyl- |
13331-19-6 |
Picture 714.
|
$150 for 1 g |
98% |
Ar-4065 |
5-(bromomethoxy)benzo[d][1,3]dioxole |
N/A |
Picture 801.
|
|
98% |
Ar-4066 |
Naphthalene,1-bromo- |
90-11-9 |
Picture 360.
|
|
98% |
Ar-4067 |
2-Fluoro-4-BromobenzylBromide |
76283-09-5 |
Picture 638.
|
|
98% |
Ar-4068 |
tert-butyl4-(N-(tert-butyl)sulfamoyl)-2-nitrobenzoate |
N/A |
Picture 791.
|
|
98% |
Ar-4069 |
1-(3-bromophenyl)-2,2,2-trifluoroethanol |
446-63-9 |
Picture 43.
|
$200 for 1 g $700 for 5 g |
98% |
B-4501 |
1,3-Dioxolane,4-ethenyl-2,2-dimethyl-,(4R)- |
127001-96-1 |
Picture 649.
|
|
98% |
B-4502 |
4-methyl-3-(piperidin-1-yl)furan-2(5H)-one |
N/A |
Picture 653.
|
|
98% |
B-4503 |
2-Piperidinone,3,3-dibromo- |
26228-95-5 |
Picture 740.
|
$350 for 5 g |
98% |
B-4504 |
2H-Azepin-2-one,3-bromohexahydro- |
3457-66-7 |
Picture 751.
|
$150 for 1 g $650 for 5 g |
98% |
B-4505 |
2,3-Butanedione,1,4-dibromo- |
6305-43-7 |
Picture 753.
|
|
98% |
B-4506 |
Silane,[[1-(butylthio)ethenyl]oxy]trimethyl- |
359719-79-2 |
Picture 1039.
|
|
98% |
B-4507 |
2-((R)-2-chloropropyl)tetrahydro-2H-pyran |
N/A |
Picture 1054.
|
|
98% |
B-4508 |
tert-butyl3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyridine-1(2H)-carboxylate |
885693-20-9 |
Picture 1504.
|
$180 for 1 g |
98% |
B-4509 |
tert-butyl3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrrole-1(5H)-carboxylate |
212127-83-8 |
Picture 1505.
|
$180 for 1 g |
98% |
B-4510 |
2-(4,4-difluorocyclohex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
1227068-84-9 |
Picture 1506.
|
$180 for 1 g |
98% |
B-4511 |
ethyl2-(2-oxopyrrolidin-1-yl)acetate |
61516-73-2 |
Picture 1522.
|
|
98% |
H-5001 |
1-(3,5-dimethylphenyl)-7-isopropyl-isoquinoline |
1218795-77-7 |
|
|
98% |
H-5002 |
1H-Indole-3-aceticacid,5-fluoro-2-methyl-,ethylester |
17536-39-9 |
Picture 74.
|
|
98% |
H-5003 |
1H-Indazole-1-carboxylicacid,6-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-,1,1-dimethylethylester |
1333222-21-1 |
Picture 216.
|
$580 for 1 g |
98% |
H-5004 |
6-Benzothiazolol,2-amino- |
26278-79-5 |
Picture 227.
|
$200 for 25 g |
98% |
H-5005 |
4-Thiazolecarboxylicacid,2-(2,6-difluorophenyl)-5-[[(1,1-dimethylethoxy)carbonyl]amino]- |
1270034-25-7 |
Picture 228.
|
$250 for 100 mg |
98% |
H-5006 |
1,3,4-Thiadiazole-2-propanoicacid,5-amino- |
66030-27-1 |
Picture 229.
|
$150 for 1 g |
98% |
H-5007 |
4-Thiazolecarboxylicacid,5-amino-2-(2,6-difluorophenyl)- |
1187056-40-1 |
Picture 230.
|
$350 for 100 mg |
98% |
H-5008 |
Thieno[3,2-c]pyridine,3-bromo-4-chloro- |
29064-82-2 |
Picture 429.
|
$250 for 1 g $900 for 5 g |
98% |
H-5009 |
Benzo[b]thiophene-2-carboxylicacid,5,6-diethoxy-,sodiumsalt(1:1) |
105102-18-9 |
Picture 516.
|
|
98% |
H-5010 |
5-Thiazolecarboxylicacid,2-[[(1,1-dimethylethoxy)carbonyl]amino]- |
302964-02-9 |
Picture 655.
|
$180 for 10 g |
98% |
H-5011 |
2-Thiophenecarboxamide, N-2-propen-1-yl- |
63122-37-2 |
Picture 736.
|
|
98% |
H-5012 |
Benzo[b]thiophene-3-carboxamide,2-amino-4,5,6,7-tetrahydro- |
4815-28-5 |
Picture 82.
|
$150 for 1 g |
98% |
H-5013 |
Thieno[2,3-c]pyridine-2-carboxylicacid,4-bromo-,1,1-dimethylethylester |
870236-59-2 |
Picture 135.
|
|
98% |
H-5014 |
Thieno[3,2-c]pyridin-4-amine,3-bromo- |
799293-85-9 |
Picture 485.
|
$150 for 1 g $550 for 5 g |
98% |
H-5015 |
4-(4-bromophenoxy)thieno[2,3-c]pyridine-2-carboxylicacid |
N/A |
Picture 1103.
|
|
98% |
H-5016 |
Thieno[2,3-c]pyridine-2-carboxamide,4-bromo- |
251993-41-6 |
Picture 547.
|
$390 for 1 g |
98% |
H-5017 |
1,2-Benzisoxazol-3(2H)-one,6-methyl-2-(triphenylmethyl)- |
947408-94-8 |
Picture 332.
|
|
98% |
H-5018 |
6-(bromomethyl)benzo[d]isoxazol-3-ol |
N/A |
Picture 333.
|
|
98% |
H-5019 |
1,2-Benzisoxazol-3(2H)-one,6-(bromomethyl)-2-(triphenylmethyl)- |
947408-95-9 |
Picture 336.
|
|
98% |
H-5020 |
5-Pyrimidinecarboxylicacid,2-(methylthio)-,ethylester |
73781-88-1 |
Picture 352.
|
$180 for 5 g |
98% |
H-5021 |
1H-Pyrazole,1-(1,1-dimethylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
1256359-15-5 |
Picture 353.
|
$180 for 1 g $750 for 5 g |
98% |
H-5022 |
2-Pyrimidinamine,4-(3-pyridinyl)- |
66521-66-2 |
Picture 359.
|
$120 for 1 g $350 for 5 g |
98% |
H-5023 |
9H-Purine,6-chloro-2-iodo- |
18552-90-4 |
Picture 404.
|
$350 for 1 g |
98% |
H-5024 |
5-Quinolinecarbonylchloride,8-methoxy-,hydrochloride(1:1) |
199872-33-8 |
Picture 405.
|
|
98% |
H-5025 |
1H-Pyrrole-2-carboxylicacid,5-methyl-,ethylester |
3284-51-3 |
Picture 424.
|
$150 for 25 g |
98% |
H-5026 |
9H-Purine,6-chloro-9-(tetrahydro-2H-pyran-2-yl)- |
7306-68-5 |
Picture 427.
|
|
98% |
H-5027 |
9H-Purin-2-amine,6-chloro-N,N-diethyl- |
857400-33-0 |
Picture 443.
|
|
98% |
H-5028 |
6-chloro-2-iodo-5,9-dihydro-4H-purine |
N/A |
Picture 447.
|
|
98% |
H-5029 |
1H-Benzimidazole-7-carboxylicacid,2-(3-pyridinyl)-,ethylester |
208773-29-9 |
Picture 450.
|
|
98% |
H-5030 |
5-Pyrimidinemethanol,2,4-dichloro-2-(3,4,5-trimethoxyphenyl)- |
148256-84-2 |
Picture 455.
|
|
98% |
H-5031 |
6-amino-2-methoxy-3-(4-methoxybutyl)pyrimidin-4(3H)-one |
N/A |
Picture 464.
|
|
98% |
H-5032 |
4-Pyridinecarboxamide, N-(3-cyanophenyl)- |
218156-94-6 |
Picture 469.
|
|
98% |
H-5033 |
1H-Pyrrole-2-carboxylicacid,4-(2-phenylacetyl)-,ethylester |
934475-89-5 |
Picture 481.
|
|
98% |
H-5034 |
6H-Purin-6-one,2-bromo-1,9-dihydro- |
87781-93-9 |
Picture 544.
|
$550 for 10 g |
98% |
H-5035 |
3(2H)-Pyridazinone,5-bromo-6-phenyl- |
90766-97-5 |
Picture 580.
|
$520 for 5 g |
98% |
H-5036 |
3-Quinolinecarboxylicacid,7-chloro-6-fluoro-1,4-dihydro-4-oxo-,ethylester |
75073-15-3 |
Picture 595.
|
$490 for 1 g |
98% |
H-5037 |
4-Pyrimidinecarboxylicacid,2,6-dichloro-,ethylester |
18127-43-0 |
Picture 669.
|
$290 for 1 g |
98% |
H-5038 |
Quinazoline,4-chloro-2-(trifluoromethyl)- |
52353-35-2 |
Picture 711.
|
$390 for 1 g |
98% |
H-5039 |
Quinazoline,4-(1-methylhydrazinyl)-2-(trifluoromethyl)- |
303148-88-1 |
Picture 712.
|
|
98% |
H-5040 |
2H-Indol-2-one,1,3-dihydro-5,6-dimethoxy- |
6286-64-2 |
Picture 729.
|
|
98% |
H-5041 |
Carbamicacid, N-[4-(aminocarbonyl)-2,3-dihydro-3-oxo-5-isothiazolyl]-,phenylester |
252004-30-1 |
Picture 789.
|
$680 for 1 g |
98% |
H-5042 |
1H-Pyrazole-4-carboxylicacid,5-amino-1-(4-fluorophenyl)- |
187949-90-2 |
Picture 823.
|
$150 for 1 g |
98% |
H-5043 |
6-amino-5-(dimethylamino)-2-(methylthio)pyrimidin-4(3H)-one |
N/A |
Picture 824.
|
|
98% |
H-5044 |
Quinoline,2-chloro-3-(chloromethyl)- |
90097-52-2 |
Picture 924.
|
$190 for 5 g $290 for 10 g |
98% |
H-5045 |
4(3H)-Quinazolinone,2-(methylthio)- |
54855-81-1 |
Picture 1011.
|
$150 for 1 g $650 for 5 g |
98% |
H-5046 |
2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one,2,2-dimethyl- |
20348-21-4 |
Picture 1126.
|
$150 for 5 g $250 for 10 g |
98% |
H-5047 |
2,2-DIMETHYL-6-NITRO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE |
1002726-59-1 |
Picture 1127.
|
$250 for 10 g |
98% |
H-5048 |
5-Pyrimidinecarboxylicacid,2,4-dichloro-,ethylester |
51940-64-8 |
Picture 1128.
|
|
98% |
H-5049 |
1H-Pyrrolo[2,3-b]pyridine-5-carboxaldehyde,4-chloro- |
958230-19-8 |
Picture 1130.
|
$220 for 1 g $660 for 5 g |
98% |
H-5050 |
1H-Pyrrolo[2,3-b]pyridine,4-chloro- |
55052-28-3 |
Picture 1131.
|
$220 for 100 g |
98% |
H-5051 |
1H-Indazole,7-bromo-5-nitro- |
685109-10-8 |
Picture 1170.
|
$120 for 1 g |
98% |
H-5052 |
1H-Indazol-5-amine,7-bromo- |
953411-10-4 |
Picture 1174.
|
$250 for 1 g $750 for 5 g |
98% |
H-5053 |
methyl4-bromothieno[2,3-c]pyridine-2-carboxylate |
145325-40-2 |
Picture 1180.
|
$220 for 1 g $680 for 5 g |
98% |
H-5054 |
7H-Pyrrolo[2,3-d]pyrimidine,4-chloro- |
3680-69-1 |
Picture 1201.
|
|
98% |
H-5055 |
1H-Indazole,3-iodo-6-nitro- |
70315-70-7 |
Picture 1230.
|
$200 for 10 g |
98% |
H-5056 |
4-Quinolinol,2,6-dimethyl- |
15644-82-3 |
Picture 1235.
|
$490 for 25 g |
98% |
H-5057 |
Quinoline,4-methyl- |
491-35-0 |
Picture 1237.
|
|
98% |
H-5058 |
Quinoline,2-phenyl- |
612-96-4 |
Picture 1102.
|
$150 for 5 g $690 for 25 g |
98% |
H-5059 |
Quinoline,2-phenyl-,hydrochloride(1:1) |
53826-02-1 |
Picture 396.
|
|
98% |
H-5060 |
3-Methyl-2-phenylpyridine |
10273-90-2 |
Picture 26.
|
$100 for 10 g $200 for 25 g |
98% |
H-5061 |
Spiro[2H-indole-2,3'-[3H]naphth[2,1-b][1,4]oxazine],1,3-dihydro-1,3,3,5,6-pentamethyl- |
100463-23-8 |
Picture 35.
|
|
98% |
H-5062 |
2-methyl-3-(3-(oxazol-5-yl)phenyl)quinazolin-4(3H)-one |
N/A |
Picture 71.
|
|
98% |
H-5063 |
Benzonitrile,2-(2-methyl-4-oxo-3(4H)-quinazolinyl)- |
56344-91-3 |
Picture 73.
|
|
98% |
H-5064 |
1H-Indole-2-propanoicacid,3-[(1,1-dimethylethyl)thio]-2,2-dimethyl-5-(1-methylethyl)-,ethylester |
136558-14-0 |
Picture 75.
|
|
98% |
H-5065 |
3-argio-2-ethylquinazolin-4(3H)-one |
N/A |
Picture 88.
|
|
98% |
H-5066 |
3H-Pyrazol-3-one,2-ethyl-2,4-dihydro-5-methyl- |
19364-68-2 |
Picture 91.
|
$420 for 1 g |
98% |
H-5067 |
Pyrazolo[1,5-a]-1,3,5-triazine,8-bromo-4-chloro-2-(methylthio)- |
54346-33-7 |
Picture 99.
|
$580 for 1 g |
98% |
H-5068 |
bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazol-2-yl)methane |
1212324-65-6 |
Picture 129.
|
|
98% |
H-5069 |
2-(2-(3b,4,8,8a-tetrahydro-3aH-indeno[1,2-d]oxazol-2-yl)propan-2-yl)-8,8a-dihydro-3aH-indeno[1,2-d]oxazole |
N/A |
Picture 102.
|
|
98% |
H-5070 |
Propanamide, N-(6-amino-1,2,3,4-tetrahydro-4-oxo-2-thioxo-5-pyrimidinyl)-2-methyl- |
227955-05-7 |
Picture 111.
|
|
98% |
H-5071 |
1H-Pyrrole-2,4-dicarboxylicacid,3,5-dimethyl-,2-(1,1-dimethylethyl)4-ethylester |
86770-31-2 |
Picture 116.
|
$200 for 5 g |
98% |
H-5072 |
1,1-Cyclopropanedimethanol,2-[(2-amino-6-chloro-9H-purin-9-yl)methylene]-,(2Z)- |
632325-69-0 |
Picture 117.
|
|
98% |
H-5073 |
2,4(1H,3H)-Pyrimidinedione,6-amino-1-(4-chlorophenyl)-3-propyl- |
136121-77-2 |
Picture 118.
|
|
98% |
H-5074 |
3-Cyclopentapyrazolecarboxylicacid,1,4,5,6-tetrahydro-,2-(2-bromo-3-phenyl-2-propen-1-ylidene)hydrazide |
303798-26-7 |
Picture 119.
|
|
98% |
H-5075 |
Phenol,4-methyl-3-[[6-(methylsulfonyl)-4-quinolinyl]amino]- |
454705-57-8 |
Picture 123.
|
|
98% |
H-5076 |
Benzo[h]cinnolin-3(2H)-one,4,4a,5,6-tetrahydro- |
25823-48-7 |
Picture 860.
|
|
98% |
H-5077 |
4-hydroxyphthalazin-1(2H)-one |
1445-69-8 |
Picture 1493.
|
|
98% |
H-5078 |
5,7-dichloro-2-methylpyrido[4,3-d]pyrimidin-4(3H)-one |
1609211-74-6 |
Picture 1498.
|
|
98% |
H-5079 |
Pyridazine,3-chloro-6-phenyl- |
20375-65-9 |
Picture 737.
|
$250 for 5 g |
98% |
H-5080 |
Benzo[h]cinnolin-3-amine,5,6-dihydro- |
627529-41-3 |
Picture 127.
|
|
98% |
H-5081 |
Pyrazolo[1,5-a]-1,3,5-triazin-4(1H)-one,2,3-dihydro-2-thioxo- |
34682-99-0 |
Picture 128.
|
$280 for 1 g $980 for 5 g |
98% |
H-5082 |
2H-Indol-2-one,1,3-dihydro-6-methoxy- |
7699-19-6 |
Picture 1105.
|
$330 for 5 g |
98% |
H-5083 |
2H-Indol-2-one,5-fluoro-1,3-dihydro- |
56341-41-4 |
Picture 131.
|
|
98% |
H-5084 |
1H-Pyrrole-3-carboxylicacid,2,4-dimethyl-,ethylester |
2199-51-1 |
Picture 134.
|
$180 for 10 g |
98% |
H-5085 |
6-bromo-2-(2-fluorophenyl)-1H-indole |
N/A |
Picture 146.
|
|
98% |
H-5086 |
2-phenyl-1-(5-(pyridin-4-yl)-1H-indazol-3-yl)ethanone |
N/A |
Picture 151.
|
|
98% |
H-5087 |
3-phenyl-1-(5-(pyridin-4-yl)-1H-indazol-3-yl)propan-1-one |
N/A |
|
98% |
H-5088 |
1H-Indazole-1-carboxylicacid,6-bromo-,1,1-dimethylethylester |
877264-77-2 |
Picture 158.
|
$220 for 5 g |
98% |
H-5089 |
6-bromo-2-(4-fluorotetrahydro-2H-pyran-3-yl)-1H-indole |
N/A |
Picture 160.
|
|
98% |
H-5090 |
Propanedioicacid,2-(3-nitro-2-pyridinyl)-,1,3-diethylester |
64362-41-0 |
Picture 162.
|
$380 for 1 g |
98% |
H-5091 |
4-Pyridazinecarboxylicacid,3,6-dichloro-,1,1-dimethylethylester |
100161-97-5 |
Picture 164.
|
|
98% |
H-5092 |
6-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3a,7a-dihydro-1H-indazole |
N/A |
Picture 168.
|
|
98% |
H-5093 |
3-methyl-5-(3-methyl-1H-indazol-5-yl)isoxazole |
N/A |
Picture 169.
|
|
98% |
H-5094 |
Pyrrolo[3,4-c]pyrazole-5(4H)-carboxylicacid,3-amino-2,6-dihydro-6,6-dimethyl-,1,1-dimethylethylester |
718632-44-1 |
Picture 195.
|
$150 for 1 g $750 for 5 g |
98% |
H-5095 |
Pyrrolo[3,4-c]pyrazole-2,5(4H,6H)-dicarboxylicacid,6,6-dimethyl-3-[(2-pyridinylcarbonyl)amino]-,5-(1,1-dimethylethyl)2-ethylester |
1041015-57-9 |
Picture 197.
|
|
98% |
H-5096 |
4-bromo-1-(phenylsulfonyl)-1H-indole |
412048-77-2 |
Picture 212.
|
|
98% |
H-5097 |
1H-Pyrrolo[2,3-b]pyridine,4-chloro-3-iodo- |
869335-73-9 |
Picture 214.
|
$250 for 5 g |
98% |
H-5098 |
1-Pyrrolidinecarboxylicacid,2-(aminocarbonyl)-,phenylmethylester |
93188-01-3 |
Picture 215.
|
$350 for 5 g |
98% |
H-5099 |
4-Pyridinecarboxylicacid,2-acetylhydrazide |
1078-38-2 |
Picture 217.
|
$150 for 100 mg |
98% |
H-5100 |
Pyridine,4-ethyl-2-(1H-imidazol-2-yl)- |
1416711-55-1 |
Picture 223.
|
|
98% |
H-5101 |
pteridine-2,4,6,7-tetraol |
N/A |
Picture 288.
|
|
98% |
H-5102 |
2-Pyrimidinamine,4-chloro- |
3993-78-0 |
Picture 295.
|
|
98% |
H-5103 |
2-Pyrazinecarboxylicacid,methylester |
6164-79-0 |
Picture 311.
|
|
98% |
H-5104 |
1,6-Naphthyridine,5,7-dichloro- |
337958-60-8 |
Picture 343.
|
$300 for 5 g |
98% |
H-5105 |
Furo[3,2-d]pyrimidine,2,4-dichloro- |
956034-07-4 |
Picture 345.
|
$280 for 1 g |
98% |
H-5106 |
3-methyl-1,2,3,12-tetrahydroindazolo[5,4-a]carbazole |
N/A |
Picture 387.
|
|
98% |
H-5107 |
Quinoline,2-phenyl-,hydrochloride(1:1) |
53826-02-1 |
Picture 396.
|
|
98% |
H-5108 |
2,4(1H,3H)-Pyrimidinedione,6-chloro-3-(4-methoxybutyl)- |
561064-18-4 |
Picture 473.
|
|
98% |
H-5109 |
Carbamicacid, N,N-diphenyl-,2-(acetylamino)-9H-purin-6-ylester |
112233-74-6 |
Picture 475.
|
|
98% |
H-5110 |
Imidazo[1,2-a]pyridine-3-aceticacid,6-chloro-2-(4-chlorophenyl)-2-hydroxy-,ethylester |
1026906-50-2 |
Picture 489.
|
|
98% |
H-5111 |
1-(5-iodo-3-methyl-1H-indazol-1-yl)ethanone |
N/A |
Picture 508.
|
|
98% |
H-5112 |
1H-Indazole,5-ethynyl-3-methyl- |
1093307-29-9 |
Picture 509.
|
$250 for 1 g $980 for 5 g |
98% |
H-5113 |
Ethanone,1-(5-bromo-6-fluoro-1H-indazol-1-yl)- |
633335-81-6 |
Picture 510.
|
$650 for 1 g |
98% |
H-5114 |
1H-Indazole,6-(4-pyridinyl)- |
885271-89-6 |
Picture 511.
|
$750 for 1 g |
98% |
H-5115 |
3-bromo-6-(pyridin-4-yl)-1H-indazole |
N/A |
Picture 512.
|
|
98% |
H-5116 |
4-Pyrimidinecarboxylicacid,2,6-dichloro-,methylester |
6299-85-0 |
Picture 525.
|
$150 for 10 g |
98% |
H-5117 |
4-Pyrimidinecarboxylicacid,2,6-dichloro-,1-methylethylester |
92638-07-8 |
Picture 526.
|
|
98% |
H-5118 |
4-Pyrimidinecarboxylicacid,1,2,3,6-tetrahydro-2,6-dioxo-,1-methylethylester |
4450-03-7 |
Picture 530.
|
|
98% |
H-5119 |
2(1H)-Quinolinone,4-hydroxy-3-nitro- |
15151-57-2 |
Picture 531.
|
$350 for 1 g |
98% |
H-5120 |
1H-Indole,5,6-dimethoxy- |
14430-23-0 |
Picture 555.
|
$280 for 5 g |
98% |
H-5121 |
1,2,4-Triazolo[4,3-b]pyridazine,6-chloro-3-(1-methylethyl)- |
72392-97-3 |
Picture 586.
|
$500 for 1 g |
98% |
H-5122 |
1,2,4-Triazolo[4,3-b]pyridazine,6-iodo-3-(1-methylethyl)- |
1097874-81-1 |
Picture 587.
|
$750 for 1 g |
98% |
H-5123 |
9H-Purine,2,6-dichloro-9-ethenyl- |
15816-13-4 |
Picture 588.
|
|
98% |
H-5124 |
Pyrimidine,4-chloro-2-methyl-6-phenyl- |
2915-15-3 |
Picture 670.
|
$160 for 1 g $550 for 5 g |
98% |
H-5125 |
1,2-Benzisoxazol-6-ol,7-propyl-3-(trifluoromethyl)- |
194608-88-3 |
Picture 715.
|
$490 for 1 g |
98% |
H-5126 |
Imidazo[1,2-a]pyridine,3-ethynyl- |
943320-53-4 |
Picture 721.
|
$650 for 1 g |
98% |
H-5127 |
3-((trimethylsilyl)ethynyl)imidazo[1,2-a]pyridine |
1148027-21-7 |
Picture 722.
|
$350 for 1 g |
98% |
H-5128 |
4(3H)-Quinazolinethione,2-(4-pyridinyl)- |
18590-73-3 |
Picture 794.
|
|
98% |
H-5129 |
4-Isoxazolecarboxylicacid,3-(2,6-dichlorophenyl)-5-(1-methylethyl)-,methylester |
278597-28-7 |
Picture 825.
|
$450 for 1 g |
98% |
H-5130 |
O-(4-chloroquinazoline-6-carbonyl)hydroxylamine |
N/A |
Picture 828.
|
|
98% |
H-5131 |
9H-Purin-2-amine,6-chloro-9-ethenyl- |
214201-73-7 |
Picture 869.
|
|
98% |
H-5132 |
Benzonitrile,4-(3-indolizinylmethyl)- |
501948-43-2 |
Picture 873.
|
|
98% |
H-5133 |
Imidodicarbonicacid,2-(3-ethynylimidazo[1,2-a]pyridin-8-yl)-,1,3-bis(1,1-dimethylethyl)ester |
1232836-09-7 |
Picture 893.
|
|
98% |
H-5134 |
1H-Benzimidazole,2-bromo- |
54624-57-6 |
Picture 902.
|
|
98% |
H-5135 |
1H-Indole-1-carboxylicacid,3-acetyl-4-iodo-,1,1-dimethylethylester |
370078-96-9 |
Picture 922.
|
|
98% |
H-5136 |
1H-Imidazole-4,5-dicarbonitrile |
1122-28-7 |
Picture 935.
|
|
98% |
H-5137 |
Imidazo[1,2-a]pyridine,3-bromo- |
4926-47-0 |
Picture 993.
|
$120 for 5 g |
98% |
H-5138 |
1H-Imidazole-5-acetonitrile,4-methyl- |
51667-66-4 |
Picture 994.
|
$580 for 1 g |
98% |
H-5139 |
3H-Imidazo[4,5-c]pyridine,2-butyl-4-chloro- |
145047-34-3 |
Picture 1004.
|
|
98% |
H-5140 |
1H-Imidazole,2,4,5-tribromo-1-[(phenylmethoxy)methyl]- |
189014-05-9 |
Picture 1033.
|
|
98% |
H-5141 |
(E)-2-(2-chloropyridin-3-yl)-N,N-dimethylethenamine |
N/A |
Picture 1044.
|
|
98% |
H-5142 |
2,5-Pyrrolidinedione,3,3,4,4-tetrafluoro- |
377-33-3 |
Picture 1058.
|
$580 for 1 g |
98% |
H-5143 |
N-(4-(8-bromo-6-(tert-butyl)-5-methoxyquinolin-3-yl)phenyl)methanesulfonamide |
1257830-36-6 |
Picture 1069.
|
|
98% |
H-5144 |
1H-pyrrolo[2,3-b]pyridine7-oxide |
N/A |
Picture 1085.
|
|
98% |
H-5145 |
4-phenylpyridine1-oxide |
N/A |
Picture 1086.
|
|
98% |
H-5146 |
benzyl3-(methylsulfonyl)-2,3-dihydro-1H-benzo[d]imidazole-1-carboxylate |
N/A |
Picture 1095.
|
|
98% |
H-5147 |
Quinoline,2-phenyl- |
612-96-4 |
Picture 1102.
|
$150 for 5 g $690 for 25 g |
98% |
H-5148 |
5H-Pyrrolo[3,4-b]pyrazin-5-one,6-(5-chloro-2-pyridinyl)-6,7-dihydro- |
148891-53-6 |
Picture 1104.
|
$650 for 5 g |
98% |
H-5149 |
5-(3-methyl-1H-indazol-5-yl)furan-3-carboxylicacid |
N/A |
Picture 1111.
|
|
98% |
H-5150 |
2-(3-methyl-1H-indazol-5-yl)thiazole-5-carboxylicacid |
N/A |
Picture 1112.
|
|
98% |
H-5151 |
1H-Pyrrolo[2,3-b]pyridine,3-methyl- |
5654-93-3 |
Picture 1113.
|
|
98% |
H-5152 |
2-(6-fluoro-3-methyl-1H-indazol-5-yl)thiazole-5-carboxylicacid |
N/A |
Picture 1114.
|
|
98% |
H-5153 |
tert-butyl3-bromo-6-(pyridin-4-yl)-1H-indazole-1-carboxylate |
N/A |
Picture 1115.
|
|
98% |
H-5154 |
1H-Indol-5-ol,4-fluoro-2-methyl- |
288385-88-6 |
Picture 1203.
|
$490 for 10 g |
98% |
H-5155 |
1H-Indazole,6-bromo- |
79762-54-2 |
Picture 1205.
|
|
98% |
H-5156 |
1H-Indazole,5-bromo-3-methyl- |
552331-16-5 |
Picture 1206.
|
$150 for 5 g |
98% |
H-5157 |
3-ethynyl-imidazo[1,2-a]pyrazine |
943320-47-6 |
Picture 1207.
|
$180 for 250 mg $580 for 1 g |
98% |
H-5158 |
2,6-dichloropyrimidin-4-ylpropionate |
N/A |
Picture 1227.
|
|
98% |
H-5159 |
6-Pteridinemethanol,2,4-diamino- |
945-24-4 |
Picture 1285.
|
|
98% |
H-5160 |
Imidazo[1,2-a]pyrazine,3-bromo- |
57948-41-1 |
Picture 1297.
|
$150 for 5 g |
98% |
H-5161 |
Pyridine,4-bromo-2-chloro- |
73583-37-6 |
Picture 1342.
|
|
98% |
H-5162 |
1H-Pyrrolo[2,3-b]pyridine |
271-63-6 |
Picture 1351.
|
|
98% |
H-5163 |
Imidazo[1,2-a]pyridine |
274-76-0 |
Picture 1354.
|
|
98% |
H-5164 |
Imidazo[1,2-b]pyridazine |
766-55-2 |
Picture 1355.
|
|
98% |
H-5165 |
5-bromo-6-fluoro-3-methyl-1H-indazole |
864773-66-0 |
Picture 1378.
|
$380 for 1 g $1180 for 5 g |
98% |
H-5166 |
5-bromo-6-fluoro-3-methyl-1H-indole |
N/A |
Picture 1379.
|
|
98% |
H-5167 |
1H-Pyrrolo[2,3-c]pyridine,7-broMo-4-chloro- |
446284-44-2 |
Picture 1387.
|
|
98% |
H-5168 |
methyl4-bromo-1H-indole-7-carboxylate |
1224724-39-3 |
Picture 1388.
|
$490 for 1 g $1400 for 5 g |
98% |
H-5169 |
2-methyl-5-nitroquinoline |
23877-94-3 |
Picture 1395.
|
$290 for 1 g |
98% |
H-5170 |
p-phenylpyridine,4-phenylpyridin |
939-23-1 |
Picture 1403.
|
|
98% |
H-5171 |
N-((1H-imidazol-2-yl)methyl)-4-chlorocyclohexanamine |
N/A |
Picture 1404.
|
|
98% |
H-5172 |
2-(2'-pyridyl)imidazole |
18653-75-3 |
Picture 1405.
|
|
98% |
H-5173 |
3-bromo-N-butyl-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
1350550-51-4 |
Picture 1438.
|
|
98% |
H-5174 |
Ethyl5-Bromo-1H-Indole-2-Carboxylate |
16732-70-0 |
Picture 1443.
|
|
98% |
H-5175 |
5-amino-1-methylpyrazole-4-carbonitrile |
5334-41-8 |
Picture 1446.
|
|
98% |
H-5176 |
5-methyl-2-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine |
1227210-32-3 |
Picture 1463.
|
$490 for 1 g |
98% |
H-5177 |
5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl-amine |
1227210-33-4 |
Picture 1464.
|
$650 for 1 g |
98% |
H-5178 |
6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-amine |
1333508-93-2 |
Picture 1465.
|
$880 for 1 g |
98% |
H-5179 |
2-(imidazo-[1,2-a]pyridin-3-yl)acetamide |
21801-86-5 |
Picture 1466.
|
$550 for 1 g |
98% |
H-5180 |
4-bromo-2-iodo-1H-indole-7-carboxylicacid |
1643570-49-3 |
Picture 1470.
|
|
98% |
H-5181 |
4-bromo-2-iodo-1H-indole-7-carboxamide |
1643570-46-0 |
Picture 1471.
|
|
98% |
H-5182 |
7-fluoro-6-nitroquinazolin-4(3H)-one |
N/A |
Picture 1479.
|
|
98% |
H-5183 |
2-chlorofuro[3,2-d]pyrimidine |
655255-09-7 |
Picture 1489.
|
$480 for 1 g |
98% |
H-5184 |
2-chloro-6-(triethylsilyl)furo[2,3-b]pyrazine |
N/A |
Picture 1491.
|
|
98% |
H-5185 |
2,3,3,4,5-pentamethyl-1-propyl-3H-indol-1-ium2,3,3,5,6-pentamethyl-1-propyl-3H-indol-1-iumiodide |
N/A |
Picture 1495.
|
|
98% |
H-5186 |
5,7-dichloro-2-methylpyrido[4,3-d]pyrimidin-4(3H)-one |
1609211-74-6 |
Picture 1498.
|
|
98% |
H-5187 |
pyrrolo[1,2-f][1,2,4]triazine-2,4(1H,3H)-dione |
918538-04-2 |
Picture 1518.
|
$110 for 1 g $350 for 5 g |
98% |
H-5188 |
3-methyl-1H-indazol-6-amine |
79173-62-9 |
Picture 1521.
|
$350 for 5 g |
98% |
H-5189 |
5-Fluoro[b]benzofuran |
24410-59-1 |
Picture 1525.
|
$250 for 1 g |
98% |
H-5190 |
2,4-dichloro-6-methylpyridine |
42779-56-6 |
Picture 1528.
|
$150 for 10 g |
98% |
H-5191 |
2-butyl-3H-imidazo[4,5-c]pyridin-4(5H)-one |
133052-28-5 |
Picture 1531.
|
|
98% |
H-5192 |
6-chloro-N-neopentylnicotinamide |
585544-20-3 |
Picture 1538.
|
|
98% |
H-5193 |
2-ethyl-4H-benzo[d][1,3]oxazin-4-one |
2916-09-8 |
Picture 1539.
|
$450 for 5 g |
98% |
H-5194 |
4-bromo-2,2-dimethyl-2-(4,4-dimethyloxazolin-2-yl)toluene |
192775-97-6 |
Picture 1615.
|
|
98% |
H-5195 |
8,11-epoxy-8,9,11-tetrahydrodiindolo(1,2,3-fg:3',2',1'-kl)[1,6]benzodiazocine |
145672-18-0 |
Picture 1617.
|
|
98% |
H-5196 |
ethyl1H-pyrrole-2-carboxylate |
2199-43-1 |
Picture 1622.
|
|
98% |
H-5197 |
6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine |
88964-99-2 |
Picture 1624.
|
|
98% |
H-5198 |
6-chloro-2-(4-chlorophenyl)H-imidazo[1,2-a]pyridine-3-carbaldehyde |
351227-28-6 |
Picture 1626.
|
|
98% |
H-5199 |
[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methanol |
193979-84-9 |
Picture 1627.
|
|
98% |
H-5200 |
6-methyl-2-(4-methyl-phenyl)-imidazo[1,2-a]pyridine |
88965-00-8 |
Picture 1630.
|
$550 for 25 g |
98% |
H-5201 |
6-methyl-2-(p-tolyl)imidazo[1,2-a]pyridine-3-carbaldehyde |
400777-11-9 |
Picture 1631.
|
|
98% |
H-5202 |
(6-methyl-2-p-tolyl-imidazo[1,2-a]pyridin-3-yl)-methanol |
887282-93-1 |
Picture 1632.
|
|
98% |
H-5203 |
2-(trifluoromethyl)-quinazolin-4(3H)-one |
26059-81-4 |
Picture 1633.
|
$150 for 250 mg $390 for 1 g |
98% |
H-5204 |
4-(1-methylhydrazino)-2-(trifluoromethyl)quinazoline |
303148-88-1 |
Picture 1635.
|
|
98% |
H-5205 |
N'-methyl-N'-(2-(trifluoromethyl)quinazolin-4-yl)benzohydrazide |
N/A |
Picture 1636.
|
|
98% |
H-5206 |
N-(4-amino-2-(3,4-dimethylphenylamino)-6-methoxypyrimidin-5-yl)formamide |
N/A |
Picture 1638.
|
|
98% |
H-5207 |
6-chloro-2-phenylimidazo[1,2-a]pyridine |
168837-18-1 |
Picture 1639.
|
$250 for 25 g |
98% |
H-5208 |
ethyl2-(6-chloranyl-2-phenyl-imidazo[1,2-a]pyridin-3-yl)-2-oxidanyl-ethanoate |
N/A |
Picture 1640.
|
|
98% |
H-5209 |
2-Chloro-6-methoxy-7-(2-morpholin-4-yl-ethyl)-7H-purine |
1275583-23-7 |
Picture 1643.
|
|
98% |
H-5210 |
7-(2-bromoethyl)-2-chloro-6-methoxypurine |
1275583-19-1 |
Picture 1644.
|
|
98% |
H-5211 |
N(2)-(3-Trifluoromethylphenyl)guanine |
123994-68-3 |
Picture 1646.
|
|
98% |
H-5212 |
9H-2-[3-(trifluoromethyl)phenylamino]-6-oxopurine |
123994-68-3 |
Picture 1647.
|
|
98% |
H-5213 |
2-chloro-6-methoxypurine |
1198-46-5 |
Picture 1648.
|
$350 for 1 g |
98% |
H-5214 |
9-(2-bromoethyl)-2-chloro-6-methoxypurine |
1275583-20-4 |
Picture 1649.
|
|
98% |
H-5215 |
2-(3-Chloro-2-trifluoromethyl-phenylamino)-1,9-dihydro-purin-6-one |
N/A |
Picture 1650.
|
|
98% |
H-5216 |
1,2-bis(2-chloro-6-methoxy-9H-purin-9-yl)ethane |
N/A |
Picture 1651.
|
|
98% |
H-5217 |
2-(2-Hydroxy-phenylamino)-1,9-dihydro-purin-6-one |
N/A |
Picture 1652.
|
|
98% |
H-5218 |
2-Chloro-6-methoxy-9-trityl-9H-purine |
N/A |
Picture 1653.
|
|
98% |
H-5219 |
2-(3-Hydroxy-phenylamino)-1,9-dihydro-purin-6-one |
N/A |
Picture 1654.
|
|
98% |
H-5220 |
2-chloro-6-methoxy-9-(4-(3,4,5-trimethylphenyl)butyl)-9H-purine |
N/A |
Picture 1655.
|
|
98% |
H-5221 |
2-chloro-9H-purine |
1681-15-8 |
Picture 1656.
|
$250 for 5 g |
98% |
H-5222 |
N-[3-(trifluoromethyl)phenyl]-7H-purin-2-amine |
N/A |
Picture 1657.
|
|
98% |
H-5223 |
2,3-dihydro-2-thioxo-9H-purine-6(1H)-one |
2487-40-3 |
Picture 1658.
|
$300 for 10 g |
98% |
H-5224 |
4-(6-methoxy-7H-purin-2-ylamino)phenol |
N/A |
Picture 1659.
|
|
98% |
H-5225 |
N-(4-bromophenyl)-9H-purin-2-amine |
N/A |
Picture 1660.
|
|
98% |
H-5226 |
2-(4-hydroxy-3-methylphenylamino)-1H-purin-6(9H)-one |
N/A |
Picture 1661.
|
|
98% |
H-5227 |
N-(4-chloro-3-(trifluoromethyl)phenyl)-9H-purin-2-amine |
N/A |
Picture 1663.
|
|
98% |
H-5228 |
6-(2-ethyl-3-methylphenylamino)pyrimidine-2,4(1H,3H)-dione |
N/A |
Picture 1664.
|
|
98% |
H-5229 |
3-(4-(1H-imidazol-1-yl)butyl)-6-(2-ethyl-3-methylphenylamino)pyrimidine-2,4(1H,3H)-dione |
N/A |
Picture 1665.
|
|
98% |
H-5230 |
bis-(9H-carbazol-9-yl),9-(9'-carbazyl)carbazole |
1914-12-1 |
Picture 1668.
|
|
98% |
H-5231 |
(E)-4-(4-nitrobenzylidene)-2-methyloxazol-5(4H)-one |
78312-00-2 66949-13-1 711015-30-4 |
Picture 1672.
|
|
98% |
H-5232 |
2-(6-isopropoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1H-indole |
N/A |
Picture 1678.
|
|
98% |
H-5233 |
1-(2-Chloro-6,7-dihydro-thiazolo[4,5-f]indol-5-yl)-ethanone |
N/A |
Picture 1690.
|
|
98% |
H-5234 |
6-amino-1-methyluracil |
2434-53-9 |
Picture 1707.
|
|
98% |
H-5235 |
ADENINE |
66224-66-6 |
Picture 1719.
|
|
98% |
H-5236 |
2-pyrazinecarbonitrile |
19847-12-2 |
Picture 1735.
|
|
98% |
H-5237 |
6-chloropurine |
87-42-3 |
Picture 1737.
|
|
98% |
H-5238 |
7-chloro-3H-imidazo[4,5-b]pyridine |
6980-11-6 |
Picture 1739.
|
$290 for 5 g $490 for 10 g |
98% |
H-5239 |
4(3H)-Quinazolinone,2-methyl-3-(2-methylphenyl)- |
72-44-6 |
Picture 570.
|
|
98% |
H-5240 |
1H-Pyrazole-3-carboxylicacid,5-(2-phenylethyl)- |
595610-56-3 |
Picture 877.
|
$750 for 1 g |
98% |
H-5241 |
1H-Pyrazole-3-carboxylicacid,5-(2-phenylethyl)-,ethylester |
595610-47-2 |
Picture 930.
|
$350 for 1 g |
98% |
H-5242 |
5-(4-methoxyphenyl)-1H-pyrazol-3-ylpropionate |
N/A |
Picture 1271.
|
|
98% |
H-5243 |
5-(4-methoxyphenyl)-1H-pyrazol-3-ylcarbamimidate |
N/A |
Picture 1277.
|
|
98% |
H-5244 |
7-fluoro-5-(tetrahydro-2H-pyran-4-yloxy)quinazolin-4(3H)-one |
379228-59-8 |
Picture 1524.
|
$680 for 1 g |
98% |
H-5245 |
2-Chloro-5-Ethyl-Pyrimidine |
111196-81-7 |
Picture 623.
|
|
98% |
H-5246 |
2,6,Dichloropurine |
N/A |
Picture 1250.
|
|
98% |
H-5247 |
2-(chloromethyl)pyridinehydrochloride |
6959-47-3 |
Picture 57.
|
$120 for 100 g $350 for 500 g |
98% |
H-5248 |
1H-pyrrolo[2,3-b]pyridine7-oxide |
N/A |
Picture 68.
|
|
98% |
H-5249 |
4-phenylpyridine1-oxide |
N/A |
Picture 69.
|
|
98% |
H-5250 |
benzyl3-(methylsulfonyl)-2,3-dihydro-1H-benzo[d]imidazole-1-carboxylate |
N/A |
Picture 95.
|
|
98% |
H-5251 |
4-(4-bromophenoxy)thieno[2,3-c]pyridine-2-carboxylicacid |
N/A |
Picture 136.
|
|
98% |
H-5252 |
5-(3-methyl-1H-indazol-5-yl)furan-3-carboxylicacid |
N/A |
Picture 156.
|
|
98% |
H-5253 |
2-(3-methyl-1H-indazol-5-yl)thiazole-5-carboxylicacid |
N/A |
Picture 157.
|
|
98% |
H-5254 |
2-(6-fluoro-3-methyl-1H-indazol-5-yl)thiazole-5-carboxylicacid |
N/A |
Picture 165.
|
|
98% |
H-5255 |
tert-butyl3-bromo-6-(pyridin-4-yl)-1H-indazole-1-carboxylate |
N/A |
Picture 166.
|
|
98% |
H-5256 |
2,2-dimethyl-6-nitro-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one |
1002726-59-1 |
Picture 201.
|
$200 for 5 g |
98% |
H-5257 |
7-cyclopentyl-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
N/A |
Picture 402.
|
|
98% |
H-5258 |
Thieno[2,3-c]pyridine-2-carboxylic acid, 4-bromo-, methyl ester |
145325-40-2 |
Picture 425.
|
$220 for 1 g $680 for 5 g |
98% |
H-5259 |
4-((8-chloro-2,5-dioxo-2,3-dihydro-1H-benzo[e][1,4]diazepin-4(5H)-yl)sulfonyl)-2-nitrobenzoicacid |
N/A |
Picture 440.
|
|
98% |
H-5260 |
ethyl4-(2-(3-chlorophenyl)acetyl)-5-methyl-1H-pyrrole-2-carboxylate |
N/A |
Picture 461.
|
|
98% |
H-5261 |
4-(4-amino-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)butylacetate |
N/A |
Picture 472.
|
|
98% |
H-5262 |
benzyl4-(4-(5-(acetamidomethyl)-2-oxooxazolidin-3-yl)phenyl)piperazine-1-carboxylate |
N/A |
Picture 476.
|
|
98% |
H-5263 |
ethyl1-cyclopropyl-6,7,8-trifluoro-4-oxo-1,2,3,4-tetrahydroquinoline-3-carboxylate |
N/A |
Picture 477.
|
|
98% |
H-5264 |
7H-Pyrrolo[2,3-d]pyrimidine,4-methyl- |
945950-37-8 |
Picture 496.
|
$320 for 1 g |
98% |
H-5265 |
Imidazo[1,2-a]pyridine,7-chloro- |
4532-25-6 |
Picture 507.
|
$150 for 25 g $300 for 100 g |
98% |
H-5266 |
3-ethynyl-imidazo[1,2-a]pyrazine |
943320-47-6 |
Picture 513.
|
$180 for 250 mg $580 for 1 g |
98% |
H-5267 |
4-(4-chlorophenethyl)-1H-pyrrol-2-ylpropionate |
N/A |
Picture 550.
|
|
98% |
H-5268 |
2,6-dichloropyrimidin-4-ylcarboxylic acid ethyl ester |
N/A |
Picture 558.
|
|
98% |
H-5269 |
2,6,Dichloropurine |
5451-40-1 |
Picture 628.
|
|
98% |
H-5270 |
5-(4-methoxyphenyl)-1H-pyrazol-3-ylpropionate |
N/A |
Picture 654.
|
|
98% |
H-5271 |
5-(4-methoxyphenyl)-1H-pyrazol-3-ylcarbamimidate |
N/A |
Picture 667.
|
|
98% |
H-5272 |
Ethyl 2-aminothiazole-5-carboxylate |
32955-21-8 |
Picture 668.
|
|
98% |
H-5273 |
phenyl(3-carbamoyl-4-hydroxythiophen-2-yl)carbamate |
N/A |
Picture 830.
|
|
98% |
H-5274 |
3-(4-hydroxy-2-(methylthio)-6-oxopyrimidin-1(6H)-yl)-4-methylphenylacetate |
N/A |
Picture 1025.
|
|
98% |
H-5275 |
3-bromo-5-chloropyrazin-2-ol |
N/A |
Picture 1481.
|
|
98% |
H-5276 |
1H-pyrazol |
288-13-1 |
Picture 1728.
|
|
98% |
H-5277 |
2,4(1H,3H)-Pyrimidinedione,5,6-diamino- |
3240-72-0 |
Picture 1317.
|
$150 for 5 g |
98% |
I-6001 |
2-(2-(2-hydroxyethoxy)ethoxy)ethyl4-methylbenzenesulfonate |
77544-68-4 |
Picture 1177.
|
$390 for 1 g |
98% |
I-6002 |
Ethanol,2-[2-(2-methoxyethoxy)ethoxy]-,1-(4-methylbenzenesulfonate) |
62921-74-8 |
Picture 234.
|
$300 for 5 g |
98% |
I-6003 |
6-Tetradecanol,1-(phenylmethoxy)- |
786690-32-2 |
Picture 573.
|
|
98% |
I-6004 |
4-chloro-benzenesulfonicacidbut-3-ynylester |
877171-15-8 |
Picture 1377.
|
$680 for 1 g |
98% |
I-6005 |
Propanamide,3-chloro-N-(3-methoxyphenyl)- |
21261-76-7 |
Picture 421.
|
$250 for 5 g |
98% |
I-6006 |
Bicyclo[3.1.1]heptane-2,3-diol,2,6,6-trimethyl-,(2R,3R)-rel- |
439807-71-3 |
Picture 519.
|
|
98% |
I-6007 |
Benzamide,2,6-difluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]- |
903522-11-2 |
Picture 524.
|
|
98% |
I-6008 |
4-Dibenzothiopheneboronicacid |
108847-20-7 |
Picture 1507.
|
|
98% |
I-6009 |
N-(3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)furo[3,2-d]pyrimidin-2-amine |
N/A |
Picture 1509.
|
|
98% |
I-6010 |
3-(2-chloroquinazolin-4-yl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione |
N/A |
Picture 15.
|
|
98% |
I-6011 |
3-(2-chloroquinazolin-4-yl)-4-(1-(phenylsulfonyl)-1H-indol-3-yl)-1H-pyrrole-2,5-dione |
N/A |
Picture 21.
|
|
98% |
I-6012 |
3-(2-ethoxyquinazolin-4-yl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione |
N/A |
Picture 1065.
|
|
98% |
I-6013 |
3-(2-ethoxyquinazolin-4-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dione |
N/A |
Picture 17.
|
|
98% |
I-6014 |
tert-butyl2,5-dimethyl-4-(4-(4-(1-methyl-1H-indol-3-yl)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl)quinazolin-2-yl)piperazine-1-carboxylate |
N/A |
Picture 1066.
|
|
98% |
I-6015 |
2-(2-(4-Methylpiperazin-1-yl)quinazolin-4-yl)acetaMide |
425638-73-9 |
Picture 19.
|
|
98% |
I-6016 |
2-(2-CHLOROQUINAZOLINE-4-YL)-ACETAMIDE |
425638-74-0 |
Picture 20.
|
$380 for 1 g $1100 for 5 g |
98% |
I-6017 |
Quinoline,3,8-dibromo-6-(1,1-dimethylethyl)-5-methoxy- |
1257832-13-5 |
Picture 38.
|
$680 for 1 g |
98% |
I-6018 |
benzyl 2-(2-hydroxyethoxy)ethylcarbaMate |
145881-74-9 |
Picture 44.
|
$180 for 1 g $500 for 5 g |
98% |
I-6019 |
1-Piperazinecarboxylicacid,4-[4-[(5S)-5-[(acetylamino)methyl]-2-oxo-3-oxazolidinyl]-2-fluorophenyl]-,phenylmethylester |
174649-06-0 |
Picture 47.
|
|
98% |
I-6020 |
1,4-Dioxane-2-methanol,5-ethenyl-,2-(4-methylbenzenesulfonate),(2R,5R)- |
1408333-36-7 |
Picture 79.
|
|
98% |
I-6021 |
trans-2,5-bis(hydroxymethyl)-1,4-Dioxane |
87133-52-6 |
Picture 80.
|
|
98% |
I-6022 |
1,2-Benzisoxazole,6-(3-bromopropoxy)-7-propyl-3-(trifluoromethyl)- |
194608-95-2 |
Picture 138.
|
|
98% |
I-6023 |
2-chloro-5-iodo-N-(tricyclo[4.3.1.13,8]undecan-1-ylmethyl)benzamide |
N/A |
Picture 139.
|
|
98% |
I-6024 |
3-Isoxazolecarboxylicacid,5-(3-methyl-1H-indazol-5-yl)- |
1093307-31-3 |
Picture 147.
|
|
98% |
I-6025 |
Isoquinoline,1-chloro-5,8-dimethyl-6-(3H-1,2,3-triazolo[4,5-b]pyridin-3-yl)- |
79238-04-3 |
Picture 148.
|
|
98% |
I-6026 |
2-Naphthalenecarbamicacid,7-hydroxy-(5CI) |
858463-06-6 |
Picture 150.
|
|
98% |
I-6027 |
1H-Pyrazole-1-propanenitrile,BETA-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
1153949-38-2 |
Picture 171.
|
$450 for 1 g |
98% |
I-6028 |
7H-Pyrrolo[2,3-d]pyrimidine,4-chloro-7-[[2-(trimethylsilyl)ethoxy]methyl]- |
941685-26-3 |
Picture 172.
|
$180 for 1 g $450 for 5 g |
98% |
I-6029 |
1H-Pyrazole-1-propanenitrile,4-bromo-BETA-cyclopentyl-,(BETAR)- |
1146629-83-5 |
Picture 173.
|
|
98% |
I-6030 |
1H-Pyrrolo[2,3-b]pyridine,4-chloro-3-ethyl-1-[tris(1-methylethyl)silyl] |
1310703-88-8 |
Picture 174.
|
|
98% |
I-6031 |
3-cyclopentyl-4-(4-(7-((2-(trimethylsilyl)ethoxy)methyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)butanenitrile |
N/A |
Picture 175.
|
|
98% |
I-6032 |
3-(4-bromo-1H-pyrazol-1-yl)heptanenitrile |
N/A |
Picture 176.
|
|
98% |
I-6033 |
2-(3-(4-bromo-1H-pyrazol-1-yl)-1-(ethylsulfonyl)azetidin-3-yl)acetonitrile |
2089575-87-9 |
Picture 178.
|
|
98% |
I-6034 |
4-chloro-1-(2-hydroxy-2-methylpropyl)-1H-imidazo[4,5-c]quinoline-2(3H)-thione |
N/A |
Picture 181.
|
|
98% |
I-6035 |
3,4-Quinolinediamine,2-chloro-N4-(2-methylpropyl)- |
133860-76-1 |
Picture 184.
|
$300 for 1 g |
98% |
I-6036 |
4-chloro-1-isobutyl-1H-imidazo[4,5-c]quinoline-2(3H)-thione |
N/A |
Picture 186.
|
|
98% |
I-6037 |
Benzamide, N-(3-chloro-4-fluorophenyl)-3,4-dimethoxy- |
333347-77-6 |
Picture 190.
|
|
98% |
I-6038 |
2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one,6-[(2-chloro-5-fluoro-4-pyrimidinyl)amino]-2,2-dimethyl- |
575484-83-2 |
Picture 202.
|
$980 for 1 g |
98% |
I-6039 |
5-Pyrimidinecarboxylicacid,2-(methylthio)-4-[[3-(2H-1,2,3-triazol-2-yl)phenyl]amino]-,ethylester |
1370261-93-0 |
Picture 206.
|
|
98% |
I-6040 |
5-Pyrimidinecarboxylicacid,2-(methylthio)-4-[[3-(2H-1,2,3-triazol-2-yl)phenyl]amino]- |
1370261-94-1 |
Picture 208.
|
|
98% |
I-6041 |
5-Pyrimidinecarboxamide,2-(methylthio)-4-[[3-(2H-1,2,3-triazol-2-yl)phenyl]amino]- |
1194973-45-9 |
Picture 209.
|
|
98% |
I-6042 |
4-((3-(2H-1,2,3-triazol-2-yl)phenyl)amino)-2-chloropyrimidine-5-carboxamide |
N/A |
Picture 210.
|
|
98% |
I-6043 |
1,4-bis(6-chloropyrimidin-4-yl)piperazine |
N/A |
Picture 220.
|
|
98% |
I-6044 |
4-bromo-7-(prop-1-en-2-yl)-9H-carbazole-1-carboxamide |
N/A |
Picture 221.
|
|
98% |
I-6045 |
1-methyl-5-((pyridin-3-ylmethylene)amino)-1H-pyrazole-4-carboxamide |
N/A |
Picture 224.
|
|
98% |
I-6046 |
N-phenyl-N-(2-((tetrahydro-2H-pyran-2-yl)oxy)ethyl)-2,3-dihydro-1H-inden-2-amine |
N/A |
Picture 313.
|
|
98% |
I-6047 |
2-bromo-N-(2,3-dihydro-1H-inden-2-yl)-N-phenylacetamide |
N/A |
Picture 403.
|
|
98% |
I-6048 |
2-Piperidineethanamine, N-(2,3-dihydro-1H-inden-2-yl)-N-phenyl-1-(phenylmethyl)- |
313257-57-7 |
Picture 452.
|
|
98% |
I-6049 |
1H-Inden-2-ol,2,3-dihydro-,2-methanesulfonate |
777-72-0 |
Picture 556.
|
$750 for 5 g |
98% |
I-6050 |
2-Piperidineethanamine, N-(2,3-dihydro-1H-inden-2-yl)-N-phenyl-,hydrochloride(1:1) |
313257-50-0 |
Picture 1209.
|
|
98% |
I-6051 |
3-Quinolinecarboxylicacid,6-bromo-4-[(2,4-difluorophenyl)amino]-7-ethoxy-,ethylester |
953802-78-3 |
Picture 346.
|
|
98% |
I-6052 |
3-Quinolinecarboxylicacid,6-bromo-4-chloro-7-ethoxy-,ethylester |
953803-81-1 |
Picture 347.
|
$480 for 1 g |
98% |
I-6053 |
3-Quinolinecarboxylicacid,4-[(2,4-difluorophenyl)amino]-7-ethoxy-6-(4-methyl-1-piperazinyl)-,ethylester |
953801-12-2 |
Picture 348.
|
|
98% |
I-6054 |
3-Pyridinecarboxylicacid,6-chloro-2-[[4-(4-morpholinylcarbonyl)phenyl]amino]- |
1258322-58-5 |
Picture 350.
|
|
98% |
I-6055 |
Carbamicacid, N-[(3R)-1-[5-(aminocarbonyl)-6-[[4-(4-morpholinylcarbonyl)phenyl]amino]-2-pyridinyl]-3-pyrrolidinyl]-,1,1-dimethylethylester |
258316-64-1 |
Picture 351.
|
|
98% |
I-6056 |
1,2-Pentanediol,4-(5-fluoro-2,3-dihydro-7-benzofuranyl)-4-methyl-2-(trifluoromethyl)- |
887375-37-3 |
Picture 354.
|
|
98% |
I-6057 |
7-Benzofuranbutanal,5-fluoro-2,3-dihydro-2-hydroxy-GAMMA,GAMMA-dimethyl-2-(trifluoromethyl)- |
887375-38-4 |
Picture 355.
|
|
98% |
I-6058 |
7H-Pyrrolo[2,3-d]pyrimidin-4-amine, N-methyl-N-[(3S,4S)-4-methyl-1-(phenylmethyl)-3-piperidinyl]- |
1252883-90-1 |
Picture 357.
|
|
98% |
I-6059 |
3-Quinolinecarboxylicacid,2-[[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]methyl]-1,4,5,6,7,8-hexahydro-7,7-dimethyl-5-oxo-4-(3-pyridinyl)-,ethylester |
848587-60-0 |
Picture 392.
|
|
98% |
I-6060 |
2,4(1H,3H)-Pyrimidinedione,6-[(3-chloro-4-methylphenyl)amino]-3-(4-iodobutyl)- |
1393653-25-2 |
Picture 449.
|
|
98% |
I-6061 |
Imidazo[1,2-a]pyridine-3-aceticacid,6-chloro-2-(4-chlorophenyl)-,ethylester |
193979-48-5 |
Picture 458.
|
|
98% |
I-6062 |
Benzaldehyde,2-chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]- |
278597-32-3 |
Picture 459.
|
$580 for 1 g |
98% |
I-6063 |
Furo[2,3-b]pyridine-2-carboxylicacid,3-[(4-nitrobenzoyl)amino]-,methylester |
1252585-53-7 |
Picture 462.
|
|
98% |
I-6064 |
Methanone,[5-amino-1-(4-fluorophenyl)-1H-pyrazol-4-yl](3-hydroxyphenyl)- |
249937-13-1 |
Picture 463.
|
|
98% |
I-6065 |
3-Quinolinecarboxylicacid,1-(1,1-dimethylethyl)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-,ethylester |
130435-47-1 |
Picture 467.
|
|
98% |
I-6066 |
6-amino-3-(5-bromopentyl)-2-methoxypyrimidin-4(3H)-one |
N/A |
Picture 468.
|
|
98% |
I-6067 |
4-Pyridineaceticacid,2-[[3-(cyclopentyloxy)-4-methoxyphenyl]methylene]-,ethylester,(2E)- |
162544-16-3 |
Picture 474.
|
|
98% |
I-6068 |
3-Quinolinecarboxylicacid,1-cyclopropyl-6,7,8-trifluoro-1,4-dihydro-4-oxo-,ethylester |
94242-51-0 |
Picture 479.
|
|
98% |
I-6069 |
4-Pyridinecarboxylicacid,3-[(2-fluoro-4-iodophenyl)amino]- |
885588-03-4 |
Picture 490.
|
$390 for 1 g |
98% |
I-6070 |
Benzoicacid,5-[2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]-2-(phenylmethoxy)-,methylester |
174607-70-6 |
Picture 495.
|
|
98% |
I-6071 |
2,3,4-trimethoxy-6-methyl-5-(3-methylbut-2-en-1-yl)phenol |
N/A |
Picture 536.
|
|
98% |
I-6072 |
1-(benzyloxy)-3-((2E,6E)-3,4-dimethylocta-2,6-dien-1-yl)-4,5,6-trimethoxy-2-methylbenzene |
N/A |
Picture 888.
|
|
98% |
I-6073 |
2,6,10,14,18,22,26,30,34-Hexatriacontanonaen-1-ol,3,7,11,15,19,23,27,31,35-nonamethyl- |
52021-26-8 |
Picture 765.
|
|
98% |
I-6074 |
4(3H)-Quinazolinone,2-(1-bromoethyl)-3-(4-fluorophenyl)- |
329190-49-0 |
Picture 565.
|
|
98% |
I-6075 |
N-((1S)-2-chloro-1-(tetrahydro-2H-pyran-2-yl)propyl)-2,2,2-trifluoroacetamide |
N/A |
Picture 566.
|
|
98% |
I-6076 |
Thieno[2,3-d]pyrimidine-6-carboxylicacid,5-amino-4-(3-methoxyphenyl)-2-(methylthio)- |
301847-46-1 |
Picture 567.
|
|
98% |
I-6077 |
Benzo[h]cinnoline,3-chloro-5,6-dihydro- |
25823-50-1 |
Picture 568.
|
|
98% |
I-6078 |
4-chloro-7-methoxy-2-(3-nitrophenyl)quinazoline |
N/A |
Picture 572.
|
|
98% |
I-6079 |
1,2,4-Triazolo[4,3-a]pyridine,6-[4-(2,5-difluorophenyl)-5-oxazolyl]-3-(1-methylethyl)- |
668981-02-0 |
Picture 581.
|
|
98% |
I-6080 |
1-((benzyloxy)methyl)-4-bromo-2-propoxy-1H-imidazole-5-carbaldehyde |
N/A |
Picture 583.
|
|
98% |
I-6081 |
2-Oxazolidinone,3-[(2R)-2-(hydroxymethyl)-4-methyl-1-oxopentyl]-4-(phenylmethyl)-,(4S)- |
632333-33-6 |
Picture 589.
|
|
98% |
I-6082 |
[1,1'-Biphenyl]-2-carbonitrile,4'-(bromomethyl)- |
114772-54-2 |
Picture 590.
|
|
98% |
I-6083 |
N-(3-chloro-4-fluorocyclopenta-2,4-dien-1-yl)-3,4-dimethoxybenzamide |
N/A |
Picture 592.
|
|
98% |
I-6084 |
Phenol,5-[(3-hydroxypropyl)amino]-2-methyl- |
146658-65-3 |
Picture 597.
|
|
98% |
I-6085 |
2-amino-2-(3-chloro-4-fluorophenyl)-1-(3,4-dimethoxyphenyl)ethanone |
N/A |
Picture 600.
|
|
98% |
I-6086 |
11H-Benzo[5,6]cyclohepta[1,2-b]pyridin-11-one,3-bromo-8-chloro-5,6-dihydro- |
156073-28-8 |
Picture 607.
|
$150 for 1 g $980 for 10 g |
98% |
I-6087 |
(R)-5-(azidomethyl)-3-(3-fluoro-4-(oxazolidin-3-yl)phenyl)oxazolidin-2-one |
N/A |
Picture 621.
|
|
98% |
I-6088 |
7H-Purine-7-butanol,6-chloro-2-(phenylamino)-,7-acetate |
161363-42-4 |
Picture 625.
|
|
98% |
I-6089 |
9H-Purine-9-butanol,6-chloro-2-(phenylamino)-,9-acetate |
161363-27-5 |
Picture 626.
|
|
98% |
I-6090 |
(5-(2-(benzyl(tert-butyl)amino)-1-(methoxymethoxy)ethyl)-2-(benzyloxy)phenyl)(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)methanol |
N/A |
Picture 634.
|
|
98% |
I-6091 |
(R)-N-(9-nitro-4-oxo-1-phenyl-3,4,6,7-tetrahydro-[1,4]diazepino[6,7,1-hi]indol-3-yl)nicotinamide |
N/A |
Picture 662.
|
|
98% |
I-6092 |
((6aR,9R)-7-propyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl)methanethiol |
N/A |
Picture 672.
|
|
98% |
I-6093 |
D-6-N-propyl-8-BETA-methoxycarbonylergoline |
63719-09-5 |
Picture 848.
|
|
98% |
I-6094 |
Benzoicacid,2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-3-oxazolidinyl]-,1,1-dimethylethylester |
324788-99-0 |
Picture 673.
|
|
98% |
I-6095 |
5-(((3-chloropropanoyl)oxy)amino)-2-methylphenol |
N/A |
Picture 677.
|
|
98% |
I-6096 |
Carbamicacid,(1-oxiranyl-2-phenylethyl)-,phenylmethylester(9CI) |
163915-59-1 |
Picture 691.
|
|
98% |
I-6097 |
2-Pyrazinecarboxamide,3-(chloromethyl)-N-(5-chloro-2-pyridinyl)- |
1122549-47-6 |
Picture 696.
|
$750 for 1 g |
98% |
I-6098 |
3-Indolizinecarboxylicacid,6-[[(1,1-dimethylethoxy)carbonyl]amino]octahydro-5-oxo-,methylester,(3S,6S,8aS)- |
159303-54-5 |
Picture 701.
|
$650 for 1 g |
98% |
I-6099 |
1-(2-(methoxymethoxy)-5-methylphenyl)-1-phenyl-2-(pyridin-2-yl)ethanol |
N/A |
Picture 703.
|
|
98% |
I-6100 |
Carbamicacid, N,N-dimethyl-, C,C'-[5-(2-bromoacetyl)-1,3-phenylene]ester |
81732-49-2 |
Picture 704.
|
|
98% |
I-6101 |
Carbamicacid, N,N-dimethyl-, C,C'-[5-(2-oxiranyl)-1,3-phenylene]ester |
1392302-60-1 |
Picture 705.
|
|
98% |
I-6102 |
5-Pyrimidinecarbonitrile,4-chloro-6-(3-methoxyphenyl)-2-(methylthio)- |
128666-82-0 |
Picture 706.
|
|
98% |
I-6103 |
Thieno[2,3-d]pyrimidine-6-carboxylicacid,5-amino-4-(3-methoxyphenyl)-2-(methylthio)-,ethylester |
301846-06-0 |
Picture 709.
|
|
98% |
I-6104 |
5-Pyrimidinecarbonitrile,1,6-dihydro-4-(3-methoxyphenyl)-2-(methylthio)-6-oxo- |
128640-73-3 |
Picture 713.
|
|
98% |
I-6105 |
1H-Isoindole-1,3(2H)-dione,2-[[4-[(3,4-dichlorophenyl)methyl]-2-morpholinyl]methyl]- |
407640-38-4 |
Picture 731.
|
|
98% |
I-6106 |
1(2H)-Naphthalenone,3,4-dihydro-6-methoxy-2-[[methyl(phenylmethyl)amino]methyl]- |
885101-16-6 |
Picture 735.
|
|
98% |
I-6107 |
Glycine, N-methyl-N-[[(1R,2S)-1,2,3,4-tetrahydro-6-methoxy-1-phenyl-2-naphthalenyl]methyl]-,ethylester, rel- |
258887-10-4 |
Picture 774.
|
|
98% |
I-6108 |
8-([1,1'-biphenyl]-4-ylmethyl)-7-benzyl-2-chloro-1-methyl-1H-purin-6(7H)-one |
N/A |
Picture 797.
|
|
98% |
I-6109 |
(E)-6-amino-3-(4-(benzyloxy)but-2-en-1-yl)-2-methoxypyrimidin-4(3H)-one |
N/A |
Picture 802.
|
|
98% |
I-6110 |
1(6H)-Pyrimidinehexanenitrile,4-amino-2-methoxy-2,2-dimethyl-6-oxo- |
949566-44-3 |
Picture 805.
|
|
98% |
I-6111 |
6-((6-amino-2-methoxypyrimidin-4-yl)oxy)-2,2-dimethylhexanenitrile |
N/A |
Picture 807.
|
|
98% |
I-6112 |
4-Pyrimidinamine,2-methoxy-6-[3-(4-morpholinyl)propoxy]- |
1026898-19-0 |
Picture 808.
|
|
98% |
I-6113 |
5H-Pyrrolo[3,4-b]pyrazin-5-one,7-chloro-6-(5-chloro-2-pyridinyl)-6,7-dihydro- |
1279710-66-5 |
Picture 811.
|
|
98% |
I-6114 |
4-Pyrimidinamine,2-methoxy-6-[[8-(4-morpholinyl)octyl]oxy]- |
1027523-29-0 |
Picture 813.
|
|
98% |
I-6115 |
4(3H)-Pyrimidinone,6-amino-3-[2-(4-fluorophenyl)-2-oxoethyl]-2-methoxy- |
949566-48-7 |
Picture 815.
|
|
98% |
I-6116 |
6-amino-2-methoxy-3-(3-oxo-3-phenylpropyl)pyrimidin-4(3H)-one |
N/A |
Picture 816.
|
|
98% |
I-6117 |
Morpholine,4-(3-bromopropyl)- |
125422-83-5 |
Picture 817.
|
$130 for 1 g $450 for 25 g |
98% |
I-6118 |
6-amino-3-(2,3-dihydroxypropyl)-2-methoxypyrimidin-4(3H)-one |
N/A |
Picture 818.
|
|
98% |
I-6119 |
4(3H)-Pyrimidinone,6-amino-2-methoxy-3-[2-(4-morpholinyl)ethyl]- |
484684-02-8 |
Picture 819.
|
|
98% |
I-6120 |
(E)-6-amino-5-(benzylideneamino)-3-methyl-2-(methylthio)pyrimidin-4(3H)-one |
N/A |
Picture 821.
|
|
98% |
I-6121 |
4-Isoxazolemethanol,3-(2,6-dichlorophenyl)-5-(1-methylethyl)- |
278597-30-1 |
Picture 827.
|
$350 for 1 g |
98% |
I-6122 |
Benzoicacid,2-amino-4-[(7-chloro-1,4-dihydro-2,4-dioxo-3(2H)-quinazolinyl)sulfonyl]- |
259536-74-8 |
Picture 829.
|
|
98% |
I-6123 |
2-(2-(4-propylphenyl)-1H-imidazol-5-yl)-N-(pyridin-4-ylmethyl)aniline |
N/A |
Picture 832.
|
|
98% |
I-6124 |
[1,1'-Biphenyl]-2-carboxylicacid,4'-(bromomethyl)-3'-fluoro-,1,1-dimethylethylester |
1073549-04-8 |
Picture 837.
|
|
98% |
I-6125 |
4H-Pyrido[1,2-a]pyrimidin-4-one,3-(2-chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl- |
130049-82-0 |
Picture 844.
|
|
98% |
I-6126 |
9H-Purin-2-amine,9-(2-bromoethyl)-6-chloro- |
214201-64-6 |
Picture 865.
|
$420 for 10 g |
98% |
I-6127 |
(E)-6-chloro-9-(2,6-dimethylstyryl)-9H-purin-2-amine |
N/A |
Picture 866.
|
|
98% |
I-6128 |
1,3-Benzodioxole,5-(3-bromopropoxy)- |
56219-51-3 |
Picture 871.
|
|
98% |
I-6129 |
1,3,2-Dioxaborolane,2-(4-bromobutyl)-4,4,5,5-tetramethyl- |
124215-50-5 |
Picture 879.
|
|
98% |
I-6130 |
1-Octanol,8-bromo- |
50816-19-8 |
Picture 903.
|
|
98% |
I-6131 |
1-Octanol,8-chloro- |
23144-52-7 |
Picture 904.
|
|
98% |
I-6132 |
Benzene,[(3-bromopropoxy)methyl]- |
54314-84-0 |
Picture 907.
|
|
98% |
I-6133 |
Carbamicacid, N-[[4-[[(2-aminophenyl)amino]carbonyl]phenyl]methyl]-,3-pyridinylmethylester |
209783-80-2 |
Picture 908.
|
$100 for 100 mg |
98% |
I-6134 |
4-(3-hydroxy-4-methylphenyl)morpholin-2-one |
N/A |
Picture 912.
|
|
98% |
I-6135 |
1H-Indole-2,3-dione,3-[2-(2,4-dinitrophenyl)hydrazone] |
2058-71-1 |
Picture 941.
|
|
98% |
I-6136 |
2-(3-(3-(furan-2-ylmethyl)ureido)propanoyl)-N-(2-methyl-5-nitrophenyl)hydrazinecarboxamide |
N/A |
Picture 949.
|
|
98% |
I-6137 |
Benzenesulfonicacid,4-methyl-,2-[[5-(2-chloro-4-nitrophenyl)-2-furanyl]methylene]hydrazide |
344943-63-1 |
Picture 951.
|
|
98% |
I-6138 |
1H-Indazole,3-chloro-1-(2-chloro-4-pyridinyl)- |
861418-19-1 |
Picture 1001.
|
|
98% |
I-6139 |
2-Pyridinamine,4-(3-chloro-1H-indazol-1-yl)-N-[(1S)-1-phenylethyl]- |
861418-21-5 |
Picture 1003.
|
|
98% |
I-6140 |
2-Pyrazinecarboxamide, N-(4-chlorophenyl)-3-(hydroxymethyl)- |
904441-54-9 |
Picture 1034.
|
|
98% |
I-6141 |
(1R)-1-((6R)-6-(methylthio)tetrahydro-2H-pyran-2-yl)-1-(((oxoboryl)methylene)amino)propan-2-ol |
N/A |
Picture 1040.
|
|
98% |
I-6142 |
1-Piperidinecarboxylicacid,4-(9,10-dihydro-10-oxo-4H-benzo[4,5]cyclohepta[1,2-b]thien-4-ylidene)-,ethylester |
34580-19-3 |
Picture 1050.
|
|
98% |
I-6143 |
methyl6,11-dihydro-11-oxodibenz[b,e]oxepin-2-acetate |
55689-64-0 |
Picture 1461.
|
$290 for 5 g |
98% |
I-6144 |
8-chloro-3,10-dibromo-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridine |
272107-22-9 |
Picture 1434.
|
$150 for 1 g $650 for 5 g |
98% |
I-6145 |
11H-Benzo[5,6]cyclohepta[1,2-b]pyridin-11-one,3-bromo-8-chloro-5,6-dihydro- |
156073-28-8 |
Picture 607.
|
$150 for 1 g $980 for 10 g |
98% |
I-6146 |
Benzo[h]cinnoline,3-hydrazinyl-5,6-dihydro- |
107127-48-0 |
Picture 1052.
|
|
98% |
I-6147 |
Benzo[h]cinnolin-3(2H)-one,4,4a,5,6-tetrahydro-4-hydroxy- |
230307-41-2 |
Picture 1060.
|
|
98% |
I-6148 |
ethyl1-cyclopropyl-6,7,8-trifluoro-4-oxo-1,2,3,4-tetrahydroquinoline-3-carboxylate |
N/A |
Picture 1073.
|
|
98% |
I-6149 |
(S)-4-(5-(acetamidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoicacid |
N/A |
Picture 1076.
|
|
98% |
I-6150 |
(3R)-ethyl1-(benzo[d][1,3]dioxol-4-yl)-9-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
N/A |
Picture 1099.
|
|
98% |
I-6151 |
(1R,3R)-ethyl1-(benzo[d][1,3]dioxol-4-yl)-9-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
N/A |
Picture 1101.
|
|
98% |
I-6152 |
(S)-2-amino-1-(3,5-bis(((dimethylamino)oxy)carbonyl)phenyl)ethanol |
N/A |
Picture 1110.
|
|
98% |
I-6153 |
N,N-dibenzyl-1-isobutyl-2-(propylthio)-1H-imidazo[4,5-c]quinolin-4-amine |
N/A |
Picture 1118.
|
|
98% |
I-6154 |
2-((6-(4-methylpiperazin-1-yl)pyrimidin-4-yl)amino)thiazole-5-carboxylicacid |
N/A |
Picture 1132.
|
|
98% |
I-6155 |
ethyl2-((6-(4-methylpiperazin-1-yl)pyrimidin-4-yl)amino)thiazole-5-carboxylate |
N/A |
Picture 1133.
|
|
98% |
I-6156 |
4-bromo-5-(ethoxycarbonyl)-9H-carbazole-1-carboxylicacid |
N/A |
Picture 1135.
|
|
98% |
I-6157 |
3-iodo-2-((4-methyl-1H-indol-5-yl)amino)benzonitrile |
N/A |
Picture 1160.
|
|
98% |
I-6158 |
1,3-Benzenediamine,4-methyl-N3-[4-(3-pyridinyl)-2-pyrimidinyl]- |
152460-10-1 |
Picture 1161.
|
|
98% |
I-6159 |
Heptanoicacid,7-(2-pyridinyl-3-pyridinylamino)-,ethylester |
1238944-93-8 |
Picture 364.
|
|
98% |
I-6160 |
7-(pyridin-2-yl(pyridin-3-yl)amino)heptanoicacid |
N/A |
Picture 1162.
|
|
98% |
I-6161 |
ethyl6-fluoro-1-(4-fluorophenyl)-4-oxo-7-(piperazin-1-yl)-1,2,3,4-tetrahydroquinoline-3-carboxylate |
N/A |
Picture 1183.
|
|
98% |
I-6162 |
4-(4-((3-chloro-4-methylphenyl)amino)-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)butylacetate |
N/A |
Picture 1185.
|
|
98% |
I-6163 |
5-(aminomethyl)-3-(3-fluoro-4-(piperazin-1-yl)phenyl)oxazolidin-2-onehydrochloride |
N/A |
Picture 1186.
|
|
98% |
I-6164 |
ethyl4-(2-(3-chlorophenyl)acetyl)-5-methyl-1H-pyrrole-2-carboxylate |
N/A |
Picture 1191.
|
|
98% |
I-6165 |
4-(4-amino-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)butylacetate |
N/A |
Picture 1194.
|
|
98% |
I-6166 |
benzyl4-(4-(5-(acetamidomethyl)-2-oxooxazolidin-3-yl)phenyl)piperazine-1-carboxylate |
N/A |
Picture 1195.
|
|
98% |
I-6167 |
(S)-4-(5-(aminomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoicacidcompoundwith2,2,2-trifluoroaceticacid(1:1) |
N/A |
Picture 1198.
|
|
98% |
I-6168 |
(E)-3-(N-(4-bromobenzyl)cyclohexanecarboxamido)styrylacetate |
N/A |
Picture 1225.
|
|
98% |
I-6169 |
tert-butyl4-(2-amino-2-oxo-1-(4-(trifluoromethyl)phenyl)ethyl)piperazine-1-carboxylate |
N/A |
Picture 1231.
|
|
98% |
I-6170 |
N-(2-(5-methoxy-1H-indol-3-yl)ethyl)acetamide |
N/A |
Picture 1256.
|
|
98% |
I-6171 |
(E)-ethyl3-(4-(2-amino-2-methylpropyl)phenyl)acrylate |
N/A |
Picture 1258.
|
|
98% |
I-6172 |
Acetamide, N-[[(5R)-3-[3-fluoro-4-(4-morpholinyl)phenyl]-2-oxo-5-oxazolidinyl]methyl]- |
872992-20-6 |
Picture 1263.
|
|
98% |
I-6173 |
(E)-3-(N-((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)cyclohexanecarboxamido)styrylacetate |
N/A |
Picture 1274.
|
|
98% |
I-6174 |
(2R,5R)-2-(tert-butyl)-5-phenyl-5-(pyrrolidin-3-yl)-1,3-dioxan-4-one |
N/A |
Picture 1288.
|
|
98% |
I-6175 |
isopropyl4-(5-(azidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoate |
N/A |
Picture 1292.
|
|
98% |
I-6176 |
dimethyl2,8-bis((4-fluorophenyl)amino)-5-oxononanedioate |
N/A |
Picture 1294.
|
|
98% |
I-6177 |
2-fluoro-5-(3-(4-(trifluoromethyl)phenyl)ureido)benzoicacid |
N/A |
Picture 1296.
|
|
98% |
I-6178 |
(R)-tert-butyl4-(5-(azidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoate |
N/A |
Picture 1298.
|
|
98% |
I-6179 |
N-benzyl-1-(6-methoxy-1-phenyl-3,4-dihydronaphthalen-2-yl)-N-methylmethanaminehydrochloride |
N/A |
Picture 1299.
|
|
98% |
I-6180 |
ethyl2-(methyl((1-phenyl-3,4-dihydronaphthalen-2-yl)methyl)amino)acetate |
N/A |
Picture 1300.
|
|
98% |
I-6181 |
tert-butyl(3-((tert-butyldimethylsilyl)oxy)-7-hydroxy-4-oxo-1-phenylheptan-2-yl)carbamate |
N/A |
Picture 1302.
|
|
98% |
I-6182 |
methyl5-(4-chlorobutyl)-2-methyl-1,4-dioxane-2-carboxylate |
N/A |
Picture 1303.
|
|
98% |
I-6183 |
methyl6-((4-bromo-2-chlorophenyl)amino)-7-fluoro-1-methyl-1H-benzo[d]imidazole-5-carboxylate |
606144-03-0 |
Picture 1306.
|
|
98% |
I-6184 |
5-(2,6-dichlorophenyl)-3-isopropylisoxazole-4-carboxylicacid |
N/A |
Picture 1315.
|
|
98% |
I-6185 |
4-((6-amino-2-methoxypyrimidin-4-yl)oxy)butylmorpholine-4-carboxylate |
N/A |
Picture 1318.
|
|
98% |
I-6186 |
6-amino-2-methoxy-3-(8-morpholinooctyl)pyrimidin-4(3H)-one |
870451-75-5 |
Picture 1319.
|
|
98% |
I-6187 |
4-fluorophenyl2-((6-amino-2-methoxypyrimidin-4-yl)oxy)acetate |
N/A |
Picture 1320.
|
|
98% |
I-6188 |
phenyl(3-carbamoyl-4-hydroxythiophen-2-yl)carbamate |
N/A |
Picture 1323.
|
|
98% |
I-6189 |
8-benzyl-3-(3-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-olhydrobromide |
N/A |
Picture 1327.
|
|
98% |
I-6190 |
2-fluoro-5-(3-(4-(trifluoromethyl)phenyl)ureido)phenylformate |
N/A |
Picture 1356.
|
|
98% |
I-6191 |
tert-butyl4'-((2-butyl-4-oxo-4,5-dihydro-3H-imidazo[4,5-c]pyridin-3-yl)methyl)-[1,1'-biphenyl]-2-carboxylate |
N/A |
Picture 1361.
|
|
98% |
I-6192 |
3-(4-hydroxy-2-(methylthio)-6-oxopyrimidin-1(6H)-yl)-4-methylphenylacetate |
N/A |
Picture 1369.
|
|
98% |
I-6193 |
pyridin-3-ylmethyl2-((4-((3-aminophenyl)carbamoyl)phenyl)amino)acetate |
N/A |
Picture 1371.
|
|
98% |
I-6194 |
tert-butyl2-fluoro-4-(4-(((methylsulfonyl)oxy)methyl)-2-oxooxazolidin-3-yl)benzoate |
N/A |
Picture 1374.
|
|
98% |
I-6195 |
(S)-tert-butyl4-(5-(azidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoate |
N/A |
Picture 1376.
|
|
98% |
I-6196 |
2-(6-methylpyridin-2-yl)-1-(quinoxalin-6-yl)ethanone |
356560-90-2 |
Picture 1392.
|
|
98% |
I-6197 |
5-{4-[(1,1-dioxidothiomorpholin-4-yl)methyl]phenyl}[1,2,4]triazolo[1,5-a]pyridin-2-amine |
1257705-09-1 |
Picture 1439.
|
|
98% |
I-6198 |
(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-aminehydrochloride |
1417334-58-7 |
Picture 1441.
|
|
98% |
I-6199 |
1,1,1,3,3,3-hexafluoro-2-(pyridin-3-yl)propan-2-ol |
1541305-50-3 |
Picture 1453.
|
|
98% |
I-6200 |
2-(5-bromopyridin-3-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
1404367-27-6 |
Picture 1454.
|
|
98% |
I-6201 |
5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)nicotinaldehyde |
675207-35-8 |
Picture 1455.
|
|
98% |
I-6202 |
6-methoxy-5-morpholino-2,3-dihydro-1H-inden-1-one |
1675205-38-5 |
Picture 1456.
|
|
98% |
I-6203 |
2,5-dioxopyrrolidin-1-yl3-(4-methyl-2,5-dioxo-2,5-dihydrofuran-3-yl)propanoate |
1637561-55-7 |
Picture 1276.
|
|
98% |
I-6204 |
2,5-dioxocyclopent-3-enyl3-(2,5-dioxo-2H-pyrrol-1(5H)-yl)propanoate |
203309-76-6 |
Picture 1459.
|
|
98% |
I-6205 |
(S)-2-((S)-2-(3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamido)propanamido)propanoicacid |
N/A |
Picture 1460.
|
|
98% |
I-6206 |
2-(2-(tert-butoxycarbonyl)-9-fluoro-1,2,3,3,4,7a-hexahydroazepino[3,2,1-hi]indol-7-yl)-2-oxoaceticacid |
N/A |
Picture 1467.
|
|
98% |
I-6207 |
tert-butyl9-fluoro-7-(2-methoxy-2-oxoacetyl)-1,2,3,3,4,7a-hexahydroazepino[3,2,1-hi]indole-2-carboxylate |
N/A |
Picture 1468.
|
|
98% |
I-6208 |
N-benzyl-4-(4-pyridinyl)benzamide |
862722-91-6 |
Picture 1472.
|
|
98% |
I-6209 |
tert-butyl(2S,4R)-4-(benzyloxy)-2-cyanopyrrolidine-1-carboxylate |
955016-60-1 |
Picture 1473.
|
|
98% |
I-6210 |
ethyl1-methyl-8-[4-(quinolin-2-ylmethoxy)phenoxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate |
364762-78-7 |
Picture 1475.
|
|
98% |
I-6211 |
ethyl2-methyl-8-(4-(quinolin-2-ylmethoxy)phenoxy)-4,5-dihydro-2H-thieno[3,4-g]indazole-6-carboxylate |
N/A |
Picture 1476.
|
|
98% |
I-6212 |
(3S)-2-(4-bromo-2-fluorobenzyl)-3-methyl-6-phenyl-1,2-thiazinane1,1-dioxide |
1537863-90-3 |
Picture 1477.
|
|
98% |
I-6213 |
4-bromo-2-iodo-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-indole-7-carboxamide |
1643570-90-4 |
Picture 1484.
|
|
98% |
I-6214 |
tert-butyl3-(3-(4-aminophenyl)-3-hydroxy-2-oxopropyl)pyrrolidine-1-carboxylate |
N/A |
Picture 1488.
|
|
98% |
I-6215 |
tert-butyl3-(3-(4-aminophenyl)-3-hydroxy-2-oxopropyl)piperidine-1-carboxylate |
N/A |
Picture 1490.
|
|
98% |
I-6216 |
tert-butyl4-(3-(4-aminophenyl)-3-hydroxy-2-oxopropyl)piperidine-1-carboxylate |
N/A |
Picture 1492.
|
|
98% |
I-6217 |
tert-butyl3-(3-(4-aminophenyl)-3-hydroxy-2-oxopropyl)azetidine-1-carboxylate |
N/A |
Picture 1494.
|
|
98% |
I-6218 |
2,5-dichloro-4-(3-nitrophenoxy)pyrimidine |
76661-24-0 |
Picture 1496.
|
|
98% |
I-6219 |
(S)-2-(2-cyclohexylethyl)-1-((4-nitrophenyl)sulfonyl)piperidine |
N/A |
Picture 1497.
|
|
98% |
I-6220 |
4-Dibenzothiopheneboronicacid |
108847-20-7 |
Picture 1507.
|
|
98% |
I-6221 |
N-(3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)furo[3,2-d]pyrimidin-2-amine |
N/A |
Picture 1509.
|
|
98% |
I-6222 |
6-bromo-3-(2-(difluoromethyl)phenyl)-2,3-dihydropyrazolo[1,2-a]indazol-9(1H)-one |
N/A |
Picture 1510.
|
|
98% |
I-6223 |
tert-butyl4-(2-amino-2-oxoethyl)-3,4-dihydroquinoline-1(2H)-carboxylate |
N/A |
Picture 1515.
|
|
98% |
I-6224 |
N-(4-(5,5-dimethyl-1,3-dioxan-2-yl)-2-hydroxybutyl)-3-(3-methoxyphenyl)propanamide |
N/A |
Picture 1517.
|
|
98% |
I-6225 |
tert-butyldimethylsilyl3-(tert-butyldimethylsilyloxy)cyclohexanecarboxylate |
N/A |
Picture 1523.
|
|
98% |
I-6226 |
(1S,3R,4S)-3-methyl-4-(3-((2-(trimethylsilyl)ethoxy)methyl)-3H-imidazo[1,2-a]pyrrolo[2,3-e]pyrazin-8-yl)cyclopentanamine |
N/A |
Picture 1526.
|
|
98% |
I-6227 |
(R)-tert-butyl4-(((3,5-dimethylpyridin-2-yl)methyl)(5,6,7,8-tetrahydroquinolin-8-yl)amino)butylcarbamate |
N/A |
Picture 1537.
|
|
98% |
I-6228 |
5-ethyl2-methyl4-hydroxyfuro[2,3-b]pyridine-2,5-dicarboxylate |
170959-85-0 |
Picture 1540.
|
|
98% |
I-6230 |
(S)-tert-butyl2,2-dimethyl-4-((R)-1-(methylsulfonyloxy)-3-(2-oxo-2H-chromen-7-yloxy)propyl)oxazolidine-3-carboxylate |
N/A |
Picture 1560.
|
|
98% |
I-6231 |
(S)-tert-butyl4-((R)-1-hydroxy-3-(2-oxo-2H-chromen-7-yloxy)propyl)-2,2-dimethyloxazolidine-3-carboxylate |
1005497-07-3 |
Picture 1561.
|
|
98% |
I-6232 |
8-(2-(tert-butoxycarbonyl)ethyl)-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-5-yltert-butylcarbonate |
N/A |
Picture 1569.
|
|
98% |
I-6233 |
tert-butyl(2-(N-cyclohexylacrylamido)ethyl)(2-(5-hydroxy-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-8-yl)ethyl)carbamate |
1035229-43-6 |
Picture 1570.
|
|
98% |
I-6234 |
(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexyl(3S)-3-fluoro-2-oxo-3-piperidinecarboxylate |
1345459-64-4 |
Picture 1587.
|
|
98% |
I-6235 |
2-amino-9-((2-chloroethoxy)methyl)-4,9-dihydro-1H-purin-6(5H)-one |
N/A |
Picture 1592.
|
|
98% |
I-6236 |
2-Ethoxymethyleneacetoacetyl-(4-trifluoromethyl)aniline |
75706-11-5 |
Picture 1598.
|
|
98% |
I-6237 |
N-isovanillyltyramine |
4579-60-6 |
Picture 1599.
|
|
98% |
I-6238 |
N-(4-hydroxyphenethyl)-N-(2-bromo-5-hydroxy-4-methoxybenzyl)formamide |
122584-18-3 |
Picture 1600.
|
$350 for 1 g |
98% |
I-6239 |
2-bromanyl-3-[[2-(4-hydroxyphenyl)ethylamino]methyl]-6-methoxy-phenol |
330855-36-2 |
Picture 1601.
|
|
98% |
I-6240 |
N-(2-bromo-5-hydroxy-4-methoxybenzyl)-N-(4-hydroxyphenethyl)methylamine |
188822-63-1 |
Picture 1602.
|
|
98% |
I-6241 |
4-((4-hydroxyphenethylamino)methyl)-2-(allyloxy)-3-bromophenol |
N/A |
Picture 1603.
|
|
98% |
I-6242 |
(2-bromo-5-hydroxy-4-methoxybenzyl)-2-(4-hydroxyphenyl)ethylamine |
179107-93-8 |
Picture 1604.
|
|
98% |
I-6243 |
N-(2,6-dimethylphenyl)-1-pentylpiperidine-2-carboxamidehydrochloride |
N/A |
Picture 1606.
|
|
98% |
I-6244 |
(E)-2-styryl-5-tosyl-5H-pyrrolo[2,3-b]pyrazine |
1421338-22-8 |
Picture 1611.
|
|
98% |
I-6245 |
1,9-di(pyridin-3-yl)nona-1,8-diyn-5-ol |
N/A |
Picture 1616.
|
|
98% |
I-6246 |
4-hydroxy-N-(3,4,5-trimethoxybenzylidene)aniline |
1415567-37-1 |
Picture 1662.
|
|
98% |
I-6247 |
9-(tert-butyldimethylsiloxy)-10-methoxy-5-oxo-2,5-dihydro-2,2,4-trimethyl-1H-[1]benzopyrano[3,4-f]quinoline |
239071-15-9 |
Picture 1671.
|
|
98% |
I-6248 |
(3-((tert-butoxycarbonyl)amino)propyl)triphenylphosphoniumbromide |
1426551-73-6 |
Picture 1676.
|
|
98% |
I-6249 |
3-cyanopropyltriphenylphosphoniumbromide |
7752-62-7 |
Picture 1677.
|
|
98% |
I-6250 |
RS-N-Isopropyl-3-(2-hydroxy-5-ethylphenyl)-3-phenylpropylaminehydrochloride |
805229-28-1 |
Picture 1694.
|
|
98% |
I-6251 |
RS-N-Isopropyl-3-(2-hydroxy-5-propylphenyl)-3-phenylpropylaminehydrochloride |
805229-38-3 |
Picture 1695.
|
|
98% |
I-6252 |
[3-(5-Ethyl-2-methoxy-phenyl)-3-phenyl-propyl]-isopropyl-amine |
N/A |
Picture 1696.
|
|
98% |
I-6253 |
Isopropyl-[3-(5-isopropyl-2-methoxy-phenyl)-3-phenyl-propyl]-amine |
N/A |
Picture 1697.
|
|
98% |
I-6254 |
[3-(5-Butyl-2-methoxy-phenyl)-3-phenyl-propyl]-isopropyl-amine |
N/A |
Picture 1698.
|
|
98% |
I-6255 |
4-Ethyl-2-(3-isopropylamino-1-phenyl-propyl)-phenol |
N/A |
Picture 1699.
|
|
98% |
I-6256 |
4-tert-Butyl-2-(3-isopropylamino-1-phenyl-propyl)-phenol |
N/A |
Picture 1700.
|
|
98% |
I-6257 |
(R)-4-tert-butyl-2-(3-(isopropylamino)-1-phenylpropyl)phenol |
N/A |
Picture 1701.
|
|
98% |
I-6258 |
3-(4-methoxybutyl)-6-(3-ethyl-4-methylanilino)uracil |
292619-97-7 |
Picture 1702.
|
|
98% |
I-6259 |
6-(3-Ethyl-4-methyl-phenylamino)-3-(3-hydroxy-propyl)-1H-pyrimidine-2,4-dione |
230630-81-6 |
Picture 1703.
|
|
98% |
I-6260 |
3-Allyl-6-(3-ethyl-4-methyl-phenylamino)-1H-pyrimidine-2,4-dione |
230630-74-7 |
Picture 1704.
|
|
98% |
I-6261 |
1-(4-methoxybutyl)barbituricacid |
561064-19-5 |
Picture 1705.
|
|
98% |
I-6262 |
1-(2-Methylamino-ethyl)-pyrimidine-2,4,6-trione |
N/A |
Picture 1706.
|
|
98% |
I-6263 |
6-tert-butyl-4-phenyl-chroman-2-one,6-tert-Butyl-4-phenyl-chroman-2-on |
73791-96-5 |
Picture 1710.
|
|
98% |
I-6264 |
3-[3-(5-tert-Butyl-2-methoxy-phenyl)-3-phenyl-propionyl]-4-phenyl-oxazolidin-2-one |
N/A |
Picture 1712.
|
|
98% |
I-6265 |
1-Cyclopropyl-6,8-difluoro-7-(3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-quinoline-3-carboxylicacidethylester |
103460-87-3 |
Picture 1713.
|
$200 for 250 mg |
98% |
I-6266 |
1-Cyclopropyl-6-fluoro-7-(3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-quinoline-3-carboxylicacid; |
N/A |
Picture 1714.
|
|
98% |
I-6267 |
1-Cyclopropyl-6,8-difluoro-7-(3-hydroxymethyl-piperazin-1-yl)-4-oxo-1,4-dihydro-quinoline-3-carboxylicacidethylester |
479070-16-1 |
Picture 1715.
|
|
98% |
I-6268 |
ethyl6,7,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate |
79660-46-1 |
Picture 1716.
|
|
98% |
I-6269 |
ethyl1-cyclopropyl-6,7-difluoro-4-oxo-1,4-dihydro-quinoline-3-carboxylate |
98349-25-8 |
Picture 1717.
|
|
98% |
I-6270 |
6,7-difluoro-1-(2,4-difluorophenyl)-1,4-dihydro-4-oxo-quinoline-3-carboxylicacidethylester |
108138-17-6 |
Picture 1718.
|
|
98% |
I-6271 |
2,6-Octadiene,1-bromo-3,7-dimethyl- |
35719-26-7 |
Picture 325.
|
|
98% |
I-6272 |
3-methoxy-N'-methyl-N'-(2-(trifluoromethyl)-1,2,3,4-tetrahydroquinazolin-4-yl)benzohydrazide |
N/A |
Picture 368.
|
|
98% |
I-6273 |
Ethanamine, N,N-diethyl-2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]- |
846022-28-4 |
Picture 415.
|
|
98% |
I-6274 |
Ethanol,2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]- |
63134-26-9 |
Picture 416.
|
|
98% |
I-6275 |
2(1H)-Quinolinone,7-(4-bromobutoxy)-3,4-dihydro- |
129722-34-5 |
Picture 422.
|
|
98% |
I-6276 |
Ethanone,1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]- |
40786-20-7 |
Picture 601.
|
$980 for 1 g |
98% |
I-6277 |
(4-((2-chloro-9-(2,6-dimethylstyryl)-9H-purin-6-yl)amino)phenyl)dimethylphosphineoxide |
926922-58-9 |
Picture 1178.
|
|
98% |
I-6278 |
tert-butyl(3R)-4-(5-cyanopyridin-2-yl)-3-methylpiperazine-1-carboxylate |
912556-68-4 |
Picture 1401.
|
|
98% |
I-6279 |
ethyl4-((tert-butyldiphenylsilyl)oxy)-2-oxobicyclo[3.1.0]hexane-1-carboxylate |
316380-17-3 |
Picture 22.
|
|
98% |
I-6280 |
Bicyclo[3.1.0]hexane-1-carboxylicacid,4-[[(1,1-dimethylethyl)diphenylsilyl]oxy]-2-oxo-,ethylester,(1R,4R,5R)-rel- |
316380-19-5 |
Picture 23.
|
|
98% |
I-6281 |
Methanesulfonamide, N-[4-[8-bromo-6-(1,1-dimethylethyl)-5-methoxy-3-quinolinyl]phenyl]- |
1257830-36-6 |
Picture 36.
|
|
98% |
I-6282 |
2-chloroethyl4-hydroxy-2-nitrobenzylcarbamate |
65235-20-3 |
Picture 106.
|
|
98% |
I-6283 |
(3R)-ethyl1-(benzo[d][1,3]dioxol-4-yl)-9-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
N/A |
Picture 108.
|
|
98% |
I-6284 |
(1R,3R)-ethyl1-(benzo[d][1,3]dioxol-4-yl)-9-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
N/A |
Picture 113.
|
|
98% |
I-6285 |
(3R)-ethyl2-(4,5-dichloro-2-(ethoxycarbonyl)benzoyl)-1-(3,5-difluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
N/A |
Picture 133.
|
|
98% |
I-6286 |
2-(2-(2-hydroxy-3-methoxyphenethyl)-4-oxoquinazolin-3(4H)-yl)benzonitrile |
N/A |
Picture 145.
|
|
98% |
I-6287 |
(5-(2-bromoacetyl)-1,3-phenylene)bis(((dimethylamino)oxy)methanone) |
N/A |
Picture 153.
|
|
98% |
I-6288 |
3-cyclopentyl-4-(4-(7-(2-(trimethylsilyl)ethoxy)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)butanenitrile |
N/A |
Picture 179.
|
|
98% |
I-6289 |
2-(1-(ethylsulfonyl)-3-((4-(7-(2-(trimethylsilyl)ethoxy)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)methyl)azetidin-3-yl)acetonitrile |
N/A |
Picture 180.
|
|
98% |
I-6290 |
2-((6-(4-methylpiperazin-1-yl)pyrimidin-4-yl)amino)thiazole-5-carboxylicacid |
N/A |
Picture 218.
|
|
98% |
I-6291 |
ethyl2-((6-(4-methylpiperazin-1-yl)pyrimidin-4-yl)amino)thiazole-5-carboxylate |
N/A |
Picture 219.
|
|
98% |
I-6292 |
4-Methyl-5-(2-cyano-6-Iodo)-anilinyl-indole |
N/A |
Picture 340.
|
|
98% |
I-6293 |
7-(pyridin-2-yl(pyridin-3-yl)amino)heptanoicacid |
N/A |
Picture 365.
|
|
98% |
I-6294 |
2-(2-((3,7,7-trimethyl-5-oxo-4-(pyridin-3-yl)-1,4,5,6,7,8-hexahydroquinolin-2-yl)methoxy)ethyl)isoindoline-1,3-dioneacetate |
N/A |
Picture 394.
|
|
98% |
I-6295 |
N-(2,3-dihydro-1H-inden-2-yl)-N-phenyl-2-(propylamino)acetamide |
N/A |
Picture 408.
|
|
98% |
I-6296 |
N,N-diethyl-2-(3-(2-(4-nitrophenoxy)ethoxy)propoxy)ethanaminehydrochloride |
846022-28-4 |
Picture 412.
|
|
98% |
I-6297 |
(4-((2-chloro-9-(2,6-dimethylstyryl)-9H-purin-6-yl)amino)benzyl)dimethylphosphineoxide |
926922-58-9 |
Picture 413.
|
|
98% |
I-6298 |
ethyl6-fluoro-1-(4-fluorophenyl)-4-oxo-7-(piperazin-1-yl)-1,2,3,4-tetrahydroquinoline-3-carboxylate |
N/A |
Picture 444.
|
|
98% |
I-6299 |
4-(4-((3-chloro-4-methylphenyl)amino)-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)butylacetate |
N/A |
Picture 451.
|
|
98% |
I-6300 |
5-(aminomethyl)-3-(3-fluoro-4-(piperazin-1-yl)phenyl)oxazolidin-2-onehydrochloride |
N/A |
Picture 453.
|
|
98% |
I-6301 |
(S)-4-(5-(aminomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoicacidcompoundwith2,2,2-trifluoroaceticacid(1:1) |
N/A |
Picture 486.
|
|
98% |
I-6302 |
(E)-3-(N-(4-bromobenzyl)cyclohexanecarboxamido)styrylacetate |
N/A |
Picture 554.
|
|
98% |
I-6303 |
isopropyl4-(5-(azidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoate |
N/A |
Picture 693.
|
|
98% |
I-6304 |
2-fluoro-5-(3-(4-(trifluoromethyl)phenyl)ureido)benzoicacid |
N/A |
Picture 720.
|
|
98% |
I-6305 |
(R)-tert-butyl4-(5-(azidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoate |
N/A |
Picture 730.
|
|
98% |
I-6306 |
N-benzyl-N-((6-methoxy-1-phenyl-3,4-dihydronaphthalen-2-yl)methyl)anilineHCl |
N/A |
Picture 732.
|
|
98% |
I-6307 |
ethyl2-(methyl((1-phenyl-3,4-dihydronaphthalen-2-yl)methyl)amino)acetate |
N/A |
Picture 733.
|
|
98% |
I-6308 |
tert-butyl(3-((tert-butyldimethylsilyl)oxy)-7-hydroxy-4-oxo-1-phenylheptan-2-yl)carbamate |
N/A |
Picture 741.
|
|
98% |
I-6309 |
methyl5-(4-chlorobutyl)-2-methyl-1,4-dioxane-2-carboxylate |
N/A |
Picture 747.
|
|
98% |
I-6310 |
1H-Benzimidazole-5-carboxylic acid, 6-[(4-bromo-2-chlorophenyl)amino]-7-fluoro-1-methyl-, methyl ester |
606144-03-0 |
Picture 756.
|
|
98% |
I-6311 |
tert-butyl(1-((tert-butyldimethylsilyl)oxy)-1-cyano-3-phenylpropan-2-yl)carbamate |
105116-42-5 |
Picture 757.
|
|
98% |
I-6312 |
1-(5-benzoylthiophen-2-yl)-3-phenylpropane-1,3-dione |
10531-44-9 |
Picture 759.
|
$320 for 5 g |
98% |
I-6313 |
(R)-phenyl(4-(3,4-dichlorobenzyl)morpholin-2-yl)carbamate |
N/A |
Picture 787.
|
|
98% |
I-6314 |
(E)-3-(3-(cyclopentyloxy)-4-methoxyphenyl)-2-(pyridin-4-yl)acrylichypochlorousanhydride |
N/A |
Picture 793.
|
|
98% |
I-6315 |
5-(2,6-dichlorophenyl)-3-isopropylisoxazole-4-carboxylicacid |
N/A |
Picture 795.
|
|
98% |
I-6316 |
2-(2-(4-bromophenyl)-5-oxo-1,3-oxathiolan-4-yl)aceticacid |
N/A |
Picture 799.
|
|
98% |
I-6317 |
4-((6-amino-2-methoxypyrimidin-4-yl)oxy)butylmorpholine-4-carboxylate |
N/A |
Picture 804.
|
|
98% |
I-6318 |
4(3H)-Pyrimidinone, 6-amino-2-methoxy-3-[8-(4-morpholinyl)octyl]- |
870451-75-5 |
Picture 809.
|
|
98% |
I-6319 |
4-fluorophenyl2-((6-amino-2-methoxypyrimidin-4-yl)oxy)acetate |
N/A |
Picture 820.
|
|
98% |
I-6320 |
Benzoic acid, 4-[[[[4-(trifluoromethyl)phenyl]amino]carbonyl]amino]- |
244156-67-0 |
Picture 940.
|
|
98% |
I-6321 |
(R)-tert-butyl(1-(3-(4-(methoxymethyl)phenyl)-4-oxo-3,4-dihydropyrido[2,3-d]pyrimidin-2-yl)ethyl)carbamate |
N/A |
Picture 999.
|
|
98% |
I-6322 |
tert-butyl4'-((2-butyl-4-oxo-4,5-dihydro-3H-imidazo[4,5-c]pyridin-3-yl)methyl)-[1,1'-biphenyl]-2-carboxylate |
N/A |
Picture 1005.
|
|
98% |
I-6323 |
tert-butyl2-fluoro-4-(4-(((methylsulfonyl)oxy)methyl)-2-oxooxazolidin-3-yl)benzoate |
N/A |
Picture 1048.
|
|
98% |
I-6324 |
(S)-tert-butyl4-(5-(azidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoate |
N/A |
Picture 1056.
|
|
98% |
I-6325 |
(R)-tert-butyl(1-(3-(4-(methoxymethyl)phenyl)-4-oxo-3,4-dihydropyrido[2,3-d]pyrimidin-2-yl)ethyl)carbamate |
N/A |
Picture 1357.
|
|
98% |
I-6326 |
bretazenil |
84379-13-5 |
Picture 1426.
|
|
98% |
Nu-9301 |
Thymidine,4-thio- |
7236-57-9 |
Picture 1335.
|
$150 for 250 mg |
98% |
Nu-9302 |
Uridine,5-bromo-2'-deoxy-4-thio- |
676556-11-9 |
Picture 596.
|
|
98% |
Nu-9303 |
2-(6-amino-2-mercapto-4H-purin-9(5H)-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol |
N/A |
Picture 270.
|
|
98% |
Nu-9304 |
1-((4S)-5-(((tert-butyldimethylsilyl)oxy)methyl)-4-((trimethylsilyl)oxy)tetrahydrofuran-2-yl)-5-methyl-4-(1H-1,2,4-triazol-1-yl)-3,4-dihydropyrimidin-2(1H)-one |
N/A |
Picture 1370.
|
|
98% |
Nu-9305 |
2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl4-oxopentanoate |
78635-98-0 1113058--58-4 |
Picture 1595.
|
|
98% |
Nu-9306 |
9-((4S,5R)-5-(azidomethyl)-4-hydroxy-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one |
N/A |
Picture 1511.
|
|
98% |
Nu-9307 |
Benzamide, N-[9-(2,3-dideoxy-BETA-D-erythro-hexopyranosyl)-9H-purin-6-yl]-(9CI) |
145593-87-9 |
Picture 624.
|
|
98% |
Nu-9308 |
Benzamide, N-[1-(2,3-dideoxy-BETA-D-erythro-hexopyranosyl)-1,2-dihydro-2-oxo-4-pyrimidinyl]-(9CI) |
145593-86-8 |
Picture 629.
|
|
98% |
Nu-9309 |
2,4(1H,3H)-Pyrimidinedione,1-(2,3-dideoxy-BETA-D-erythro-hexopyranosyl)-5-methyl- |
64750-94-3 |
Picture 630.
|
|
98% |
Nu-9310 |
4,5-dicyanoimidazole |
1122-28-7 |
Picture 94.
|
|
98% |
Nu-9311 |
4,4'-dimethoxytritylchloride |
40615-36-9 |
Picture 1736.
|
|
98% |
P-9401 |
Phosphonicacid,[2-(4-aminophenyl)ethylidene]bis- |
107092-00-2 |
Picture 846.
|
|
98% |
P-9402 |
Phosphonicacid,[2-(4-aminophenyl)ethylidene]bis-,sodiumsalt |
107091-99-6 |
Picture 882.
|
|
98% |
P-9403 |
Phosphonicacid, P,P'-[2-(4-aminophenyl)-1-hydroxyethylidene]bis- |
149543-15-7 |
Picture 926.
|
|
98% |
P-9404 |
Benzenamine,4-(dipropylphosphinyl)- |
834894-19-8 |
Picture 872.
|
|
98% |
P-9405 |
9H-Purin-6-amine, N-[4-(dipropylphosphinyl)phenyl]-2-(1-methylethyl) |
926922-48-7 |
Picture 414.
|
|
98% |
P-9406 |
O,O,O-tri-o-tolylphosphorothioate |
631-45-8 |
Picture 1596.
|
|
98% |
P-9407 |
Tetraethyl(Chloromethylene)Bisphosphonate |
N/A |
Picture 617.
|
|
98% |
P-9408 |
tetraphenyl(2-(4-nitrophenyl)ethene-1,1-diyl)bis(phosphonate) |
N/A |
Picture 843.
|
|
98% |
P-9409 |
Phosphoramidousacid, N,N-diethyl-,bis(1,1-dimethylethyl)ester |
117924-33-1 |
Picture 231.
|
$100 for 5 g |
98% |
P-9410 |
di-tert-butyl((diisopropylamino)methyl)phosphonite |
N/A |
Picture 1243.
|
|
98% |
P-9411 |
sodiumhydrogen-4-(4-aminobenzamido)-1-hydroxy-1-phosphonobutylphosphonate |
N/A |
Picture 1305.
|
|
98% |
P-9412 |
(1-hydroxy-5-(4-nitrophenyl)-5-oxopentane-1,1-diyl)diphosphonicacid |
N/A |
Picture 1325.
|
|
98% |
P-9413 |
dimethylphosphinicacidchloride |
1111-92-8 |
Picture 1674.
|
|
98% |
Sg-9501 |
(5R,6R)-2-((1S,2S)-1-amino-2-chloropropyl)-6-(methylthio)tetrahydro-2H-pyran-3,4,5-triol |
N/A |
Picture 569.
|
|
98% |
Sg-9502 |
D-erythro-2-D-galacto-Octopyranoside,methyl6-amino-6,8-dideoxy-1-thio- |
14810-93-6 |
Picture 1038.
|
|
98% |
Sg-9503 |
(1S)-1-((5R,6R)-6-(methylthio)-3,4,5-tris((trimethylsilyl)oxy)tetrahydro-2H-pyran-2-yl)-1-(((oxoboryl)methylene)amino)propan-2-one |
N/A |
Picture 1045.
|
|
98% |
Sg-9504 |
N-(2-(2-(((3R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)ethoxy)ethyl)-3-(2,5-dioxo-2,5-dihydrofuran-3-yl)propanamide |
N/A |
Picture 45.
|
|
98% |
Sg-9505 |
tert-butyl((2R)-2-hydroxy-1-((5R,6R)-3,4,5-trihydroxy-6-(methylthio)tetrahydro-2H-pyran-2-yl)propyl)carbamate |
N/A |
Picture 1329.
|
|
98% |
Sg-9506 |
tert-butyl(1-((4R,5S)-5-(methylthio)-2,3,4-tris((trimethylsilyl)oxy)cyclohexyl)-2-oxopropyl)carbamate |
N/A |
Picture 1332.
|
|
98% |
Sg-9507 |
methyl6-amino-6,8-dideoxy-1-thio-erythro-BETA-D-galacto-octopyranoside |
6982-17-8 |
Picture 1730.
|
|
98% |
Sg-9508 |
[2-(6-Methylsulfanyl-3,4,5-tris-trimethylsilanyloxy-tetrahydro-pyran-2-yl)-1,2-bis-trimethylsilanyloxy-ethyl]-carbamicacidtert-butylester |
N/A |
Picture 1731.
|
|
98% |
Sg-9509 |
(2S,3R)-6-((1R)-1-amino-2-hydroxypropyl)tetrahydro-2H-pyran-2,3,4,5-tetraol |
N/A |
Picture 682.
|
|
98% |
Sg-9510 |
tert-butyl(2-hydroxy-1-((5R,6R)-3,4,5-trihydroxy-6-(methylthio)tetrahydro-2H-pyran-2-yl)propyl)carbamate |
N/A |
Picture 859.
|
|
98% |
Sg-9511 |
tert-butyl(1-((4R,5S)-5-(methylthio)-2,3,4-tris((trimethylsilyl)oxy)cyclohexyl)-2-oxopropyl)carbamate |
N/A |
Picture 863.
|
|
98% |
Sg-9512 |
(2R,3R,4R,5R,6R)-5-acetamidotetrahydro-2H-pyran-2,3,4,6-tetrayltetraacetate |
N/A |
Picture 986.
|
|
98% |
R-8001 |
Resiquimod, R-848 |
144875-48-9 |
|
98% |
R-8002 |
Vitamin K1(25) |
121840-65-1 |
|
98% |
R-8003 |
1H-Pyrrole-3-propanoicacid,2-[(1,2-dihydro-6-methoxy-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl- |
258831-12-8 |
Picture 101.
|
|
98% |
R-8004 |
1H-Pyrrole-2,5-dione,3-[5-fluoro-2-(trifluoromethyl)phenyl]-4-(1H-indol-3-yl)- |
1260181-07-4 |
Picture 6.
|
|
98% |
R-8005 |
3-(2-(2,5-dimethylpiperazin-1-yl)quinazolin-4-yl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione |
N/A |
Picture 7.
|
|
98% |
R-8006 |
1H-Pyrrole-2,5-dione,3-(1-methyl-1H-indol-3-yl)-4-[2-(1-piperazinyl)-4-quinazolinyl]- |
425637-76-9 |
Picture 9.
|
|
98% |
R-8007 |
3-(1H-indol-3-yl)-4-(5-(piperazin-1-yl)-2-(trifluoromethyl)phenyl)-1H-pyrrole-2,5-dione |
N/A |
Picture 16.
|
|
98% |
R-8008 |
(R)-3-(1-methyl-1H-indol-3-yl)-4-(2-(2-methylpiperazin-1-yl)quinazolin-4-yl)-1H-pyrrole-2,5-dione |
N/A |
Picture 14.
|
|
98% |
R-8009 |
Bisindolylmaleimide V |
113963-68-1 |
Picture 3.
|
$400 for 200 mg $900 for 1 g |
98% |
R-8010 |
Sotrastaurin |
425637-18-9 |
Picture 5.
|
$120 for 10 mg $500 for 50 mg |
98% |
R-8011 |
3-Furanpropanoicacid,2,5-dihydro-4-methyl-2,5-dioxo-,2,5-dioxo-1-pyrrolidinylester |
1637561-55-7 |
Picture 611.
|
|
98% |
R-8012 |
1H-Naphtho[2,1-b]pyran-1-one,5-(acetyloxy)-3-ethenyldodecahydro-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-,(3R,4aR,5S,6S,6aS,10S,10aR,10bS)- |
66575-29-9 |
Picture 745.
|
$150 for 100 mg |
98% |
R-8013 |
1-cyclopropyl-7-((3R,5S)-3,5-dimethylpiperazin-1-yl)-3-ethylquinolin-4(1H)-one |
N/A |
Picture 833.
|
|
98% |
R-8014 |
N-((R)-1-(4-(tert-butylcarbamoyl)-4-cyclohexylpiperidin-1-yl)-3-(4-fluorophenyl)-1-oxopropan-2-yl)-4-methylpiperazine-2-carboxamide |
N/A |
Picture 1324.
|
|
98% |
R-8015 |
4-fluoro-N-(3-(1-isobutyrylpiperidin-4-yl)-1-methylindolin-5-yl)benzenesulfonamide |
1648705-03-6 |
Picture 1469.
|
|
98% |
R-8016 |
1-Naphthalenecarboxamide, N-[[4-(dimethylamino)phenyl]methyl]-1,2,3,4-tetrahydro-7-methoxy-N-[4-(1-methylethyl)phenyl]-,hydrochloride(1:1) |
405098-33-1 |
Picture 418.
|
$200 for 5 mg |
98% |
R-8017 |
2-(5-(3-(3-(dimethylamino)prop-1-yn-1-yl)phenyl)-4H-1,2,4-triazol-3-yl)-N-(pyridin-4-ylmethyl)aniline |
N/A |
Picture 436.
|
|
98% |
R-8018 |
3-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-Benzamide, |
284461-72-9 |
Picture 1.
|
|
98% |
R-8019 |
N-(4-(6-(tert-butyl)-8-(2,5-dioxopiperazin-1-yl)-5-methoxyisoquinolin-3-yl)phenyl)methanesulfonamide |
N/A |
Picture 37.
|
|
98% |
R-8020 |
(S)-4-(5-(acetamidomethyl)-2-oxooxazolidin-3-yl)-2-fluorobenzoicacid |
N/A |
Picture 48.
|
|
98% |
R-8021 |
2(5H)-Furanone,4-bromo-5-(bromomethylene)-3-butyl- |
66042-01-1 |
Picture 86.
|
|
98% |
R-8022 |
(1-((2-chlorophenyl)(imino)methyl)cyclopentyl)methanol |
79499-57-3 |
Picture 103.
|
|
98% |
R-8023 |
(2R,3S)-1-(benzo[d][1,3]dioxol-4-yl)-2-(2-carboxy-4,5-dichlorobenzoyl)-9-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylicacid |
N/A |
Picture 112.
|
|
98% |
R-8024 |
1H-Imidazo[4,5-c]quinolin-4-amine, 1-(2-methylpropyl)-N,N-bis(phenylmethyl)-2-(propylthio)- |
882072-92-6 |
Picture 182.
|
|
98% |
R-8025 |
(S)-5-(1-(tert-butylamino)-2-hydroxyethyl)-1,3-phenylenebis(dimethylcarbamate)hydrochloride |
N/A |
Picture 456.
|
|
98% |
R-8026 |
(S)-1-(3,4-difluoro-2-((2-fluoro-4-iodophenyl)amino)phenyl)-2-(2,3-dihydroxypropoxy)ethanone |
N/A |
Picture 482.
|
|
98% |
R-8027 |
(E)-4-(4-amino-2-((tert-butylthio)trioxidanyl)styryl)-3-(isopropylsulfonyl)aniline |
N/A |
Picture 483.
|
|
98% |
R-8028 |
N-cyclopropyl-4-((4-((3-methyl-1H-pyrazol-5-yl)amino)-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl)thio)benzamide |
N/A |
Picture 537.
|
|
98% |
R-8029 |
4-((6aR,9S,10aR)-7-propyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl)-3-thioxobutanoicacid |
N/A |
Picture 562.
|
|
98% |
R-8030 |
2-(4-(3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy)phenoxy)-N-methylacetamide |
N/A |
Picture 591.
|
|
98% |
R-8031 |
(E)-3-(N-((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)cyclohexanecarboxamido)styrylacetate |
N/A |
Picture 660.
|
|
98% |
R-8032 |
1-Undecanone, 11-(5,6-dihydro-3-iminobenzo[h]cinnolin-2(3H)-yl)-1-[4-(2-pyrimidinyl)-1-piperazinyl]- |
402519-00-0 |
Picture 663.
|
|
98% |
R-8033 |
2-(4-(4-chlorobenzyl)-7-fluoro-5-sulfamoyl-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)aceticacid |
2043025-96-1 |
Picture 780.
|
|
98% |
R-8034 |
8-benzyl-3-(3-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-olhydrobromide |
N/A |
Picture 852.
|
|
98% |
R-8035 |
sodium(E)-5-(4-(methylsulfonyl)-3-nitrobenzamido)-2-(4-(4-(methylthio)-2-morpholinobenzamido)-2-sulfonatostyryl)benzenesulfonate |
N/A |
Picture 856.
|
|
98% |
R-8036 |
(R)-2-(4-fluoro-3-(trifluoromethyl)phenyl)-N-(1-(3-(4-(methoxymethyl)phenyl)-4-oxo-3,4-dihydropyrido[2,3-d]pyrimidin-2-yl)ethyl)-N-(pyridin-3-ylmethyl)acetamide |
N/A |
Picture 1000.
|
|
98% |
R-8037 |
1-(4-((4-ethyl-5-(trifluoromethyl)thiophen-2-yl)methoxy)-3-methylbenzyl)azetidin-3-ylformate |
N/A |
Picture 1008.
|
|
98% |
R-8038 |
4,5-bis(4-methoxycyclohexyl)-1H-imidazol-2(3H)-one |
N/A |
Picture 1429.
|
|
98% |
R-8039 |
1-(2-cyanoacetyl)-4-(3,4-dichlorophenyl)thiosemicarbazide |
656222-54-7 |
Picture 1430.
|
|
98% |
R-8040 |
N-[5-(1,1-dimethylethyl)-3-isoxazolyl]-N'-[4-[7-[2-(4-morpholinyl)ethoxy]imidazo[2,1-b]benzothiazol-2-yl]phenyl]-Urea, |
950769-58-1 |
Picture 2.
|
$200 for 25 mg $500 for 100 mg |
98% |
R-8041 |
6-[2-(1,1-dimethylethyl)-5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]-Quinoxaline, |
356559-20-1 |
Picture 4.
|
$100 for 10 mg $400 for 50 mg |
98% |
R-8042 |
(E)-2-(2-hydroxy-3-methoxystyryl)-3-(3-(oxazol-5-yl)phenyl)quinazolin-4(3H)-one |
N/A |
Picture 70.
|
|
98% |
R-8043 |
(E)-2-(2-(2-hydroxy-3-methoxystyryl)-4-oxoquinazolin-3(4H)-yl)benzonitrile |
N/A |
Picture 72.
|
|
98% |
R-8044 |
1H-Indole-2-propanoicacid,1-[(4-chloro-3-iodophenyl)methyl]-3-[(1,1-dimethylethyl)thio]-2,2-dimethyl-5-(1-methylethyl)-,ethylester |
136558-16-2 |
Picture 78.
|
|
98% |
R-8045 |
2,4-Pyrimidinediamine,5-[[3-methoxy-4-[(4-methoxyphenyl)methoxy]phenyl]methyl]- |
870483-87-7 |
Picture 84.
|
$100 for 100 mg $300 for 500 mg |
98% |
R-8046 |
2(5H)-Furanone,4-bromo-5-(bromomethylene)-3-butyl-,(5Z)- |
63025-35-4 |
Picture 85.
|
|
98% |
R-8047 |
3H-Purin-6-amine,3-[[3-(cyclopentyloxy)-4-methoxyphenyl]methyl]-N-ethyl-8-(1-methylethyl)- |
162278-10-6 |
Picture 97.
|
|
98% |
R-8048 |
Ethanone,1-[3-(cyclopentyloxy)-4-methoxyphenyl]-, O-(aminocarbonyl)oxime,(1E)- |
141184-34-1 |
Picture 109.
|
|
98% |
R-8049 |
1-(3-(cyclopentyloxy)-5-(methoxymethyl)phenyl)ethanoneO-carbamoyloxime |
N/A |
Picture 114.
|
|
98% |
R-8050 |
Ethanone,1-[3-(cyclopentyloxy)-4-methoxyphenyl]-,oxime |
141184-49-8 |
Picture 185.
|
|
98% |
R-8051 |
2-Propenoicacid,3-[5-[4-(cyclopentyloxy)-2-hydroxybenzoyl]-2-hydroxyphenyl]-,methylester,(2E)- |
947408-92-6 |
Picture 330.
|
|
98% |
R-8052 |
Benzamide,3-(cyclopentyloxy)-N-(3,5-dichloro-4-pyridinyl)-4-methoxy- |
144035-83-6 |
Picture 646.
|
$580 for 1 g |
98% |
R-8053 |
Cyclohexanecarboxylicacid,4-cyano-4-[3-(cyclopentyloxy)-4-methoxyphenyl]- |
164414-71-5 |
Picture 652.
|
|
98% |
R-8054 |
Cyclohexanecarbonitrile,1-[3-(cyclopentyloxy)-4-methoxyphenyl]-4-oxo- |
152630-47-2 |
Picture 744.
|
|
98% |
R-8055 |
2-Pyrrolidinone,4-[3-(cyclopentyloxy)-4-methoxyphenyl]- |
61413-54-5 |
Picture 754.
|
$150 for 100 mg |
98% |
R-8057 |
2-Cyclohexen-1-one,6-amino-6-(2-chlorophenyl)- |
57683-62-2 |
Picture 110.
|
|
98% |
R-8058 |
Imidazo[1,2-a]pyridine-6-carboxylicacid,2-[(2,2,2-trifluoroacetyl)amino]-,methylester |
209971-50-6 |
Picture 120.
|
$480 for 1 g |
98% |
R-8059 |
2-chloro-N-((dodecahydrocyclopenta[2',1':2,3]cyclopenta[1,2-a]cyclopenta[2',3':1,4]cyclobuta[1,2-b]benzen-2a-yl)methyl)-5-(3-hydroxy-4-(methylamino)butyl)benzamide |
N/A |
Picture 130.
|
|
98% |
R-8060 |
Benzeneaceticacid,3-propyl-4-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzisoxazol-6-yl]oxy]propoxy]- |
194980-32-0 |
Picture 141.
|
|
98% |
R-8061 |
1H-Pyrrole-3-carboxamide, N-[2-(diethylamino)ethyl]-5-[(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-2,4-dimethyl- |
342641-94-5 |
Picture 142.
|
$250 for 1 g |
98% |
R-8062 |
Benzeneaceticacid,3-chloro-4-[[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzisoxazol-6-yl]oxy]propyl]thio]- |
194608-77-0 |
Picture 143.
|
|
98% |
R-8063 |
11H-Pyrido[3',2':4,5]pyrrolo[2,3-g]isoquinoline,6-chloro-5,10-dimethyl- |
79238-06-5 |
Picture 149.
|
|
98% |
R-8064 |
Benzo[b]thiophene-3-carboxamide,2-[(cyclopropylcarbonyl)amino]-4,5,6,7-tetrahydro- |
329221-38-7 |
Picture 170.
|
|
98% |
R-8065 |
4-(4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)-3-cyclopentylbutanenitrile |
N/A |
Picture 177.
|
|
98% |
R-8066 |
2H-Imidazo[4,5-c]quinoline-2-thione,4-[bis(phenylmethyl)amino]-1,3-dihydro-1-(2-methylpropyl)- |
882072-89-1 |
Picture 183.
|
|
98% |
R-8067 |
3-(4-(3-(4-chlorophenyl)propyl)phenoxy)benzamide |
N/A |
Picture 189.
|
|
98% |
R-8068 |
2-Pyridinecarboxamide, N-[5-[[(2S,5R)-2,5-dimethyl-4-[(tetrahydro-2H-pyran-4-yl)methyl]-1-piperazinyl]carbonyl]-1,4,5,6-tetrahydro-6,6-dimethylpyrrolo[3,4-c]pyrazol-3-yl]- |
1072100-81-2 |
Picture 199.
|
|
98% |
R-8069 |
2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one,6-[[5-fluoro-2-[(3,4,5-trimethoxyphenyl)amino]-4-pyrimidinyl]amino]-2,2-dimethyl- |
841290-80-0 |
Picture 203.
|
$150 for 25 mg $500 for 100 mg |
98% |
R-8070 |
5-Pyrimidinecarboxamide,2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[[3-(2H-1,2,3-triazol-2-yl)phenyl]amino]-, rel- |
1194954-52-3 |
Picture 205.
|
$350 for 25 mg |
98% |
R-8071 |
4-(3-(7-fluoro-1-oxo-3,4-dihydroisoquinolin-2(1H)-yl)-2-methylphenyl)-7-(2-hydroxypropan-2-yl)-9H-carbazole-1-carboxamide |
N/A |
Picture 222.
|
|
98% |
R-8072 |
9H-Carbazole-1-carboxamide,4-[3-(6-fluoro-1,3-dihydro-1-oxo-2H-isoindol-2-yl)-2-methylphenyl]-7-(1-hydroxy-1-methylethyl)- |
1231889-43-2 |
Picture 225.
|
|
98% |
R-8073 |
6H-Pyrimido[1,6-b]pyridazin-6-one,5-(2,6-dichlorophenyl)-2-[(2,4-difluorophenyl)thio]- |
209410-46-8 |
Picture 282.
|
$200 for 100 mg |
98% |
R-8074 |
CPA-373-1 |
N/A |
Picture 321.
|
|
98% |
R-8075 |
Benzenepropanoicacid,5-[4-(cyclopentyloxy)-2-hydroxybenzoyl]-2-[[2,3-dihydro-3-oxo-2-(triphenylmethyl)-1,2-benzisoxazol-6-yl]methoxy]-,methylester |
947409-01-0 |
Picture 331.
|
|
98% |
R-8076 |
Benzenepropanoicacid,5-[4-(cyclopentyloxy)-2-hydroxybenzoyl]-2-[(2,3-dihydro-3-oxo-1,2-benzisoxazol-6-yl)methoxy]- |
530141-72-1 |
Picture 334.
|
$300 for 50 mg
|
98% |
R-8077 |
2H-1-Benzopyran-2-one,6-(2,4-dihydroxybenzoyl)- |
947408-91-5 |
Picture 335.
|
|
98% |
R-8078 |
Benzenemethanol,4-(7-ethyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)-2,2-dimethyl- |
1011732-96-9 |
Picture 341.
|
|
98% |
R-8079 |
1,6-Naphthyridin-5-amine,7-[1-(1,1-dimethylethyl)-1H-pyrazol-4-yl]-N-[[(3S)-3-fluoro-3-piperidinyl]methyl]- |
1345458-66-3 |
Picture 344.
|
|
98% |
R-8080 |
3-Quinolinecarboxamide,4-[(2,4-difluorophenyl)amino]-7-ethoxy-6-(4-methyl-1-piperazinyl)- |
953798-95-3 |
Picture 349.
|
|
98% |
R-8081 |
1-Piperidinepropanenitrile,4-methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-BETA-oxo-,(3S,4S)- |
1092578-47-6 |
Picture 356.
|
$450 for 100 mg |
98% |
R-8082 |
Heptanamide, N-hydroxy-7-(2-pyridinyl-3-pyridinylamino)- |
1238944-56-3 |
Picture 366.
|
|
98% |
R-8083 |
Benzoicacid,4-methoxy-,2-methyl-2-[2-(trifluoromethyl)-4-quinazolinyl]hydrazide |
320421-89-4 |
|
|
98% |
R-8084 |
Methanone,[5-amino-1-(4-fluorophenyl)-1H-pyrazol-4-yl][3-[(2R)-2,3-dihydroxypropoxy]phenyl]- |
249936-54-7 |
Picture 435.
|
|
98% |
R-8085 |
3-((4-bromo-2,6-difluorobenzyl)oxy)-5-(3-(4-(pyrrolidin-1-yl)butyl)ureido)isothiazole-4-carboxamide |
252003-65-9 |
Picture 465.
|
$300 for 50 mg $1100 for 250 mg |
98% |
R-8086 |
Benzamide, N-[(2S)-2,3-dihydroxypropoxy]-3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]- |
391210-11-0 |
Picture 487.
|
|
98% |
R-8087 |
Benzenamine,3-[4-(4-morpholinyl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]- |
371934-59-7 |
Picture 488.
|
|
98% |
R-8088 |
3-methoxy-N'-methyl-N'-(2-(trifluoromethyl)quinazolin-4-yl)benzohydrazide |
N/A |
Picture 492.
|
|
98% |
R-8089 |
Benzamide,2-[(2-chloro-4-iodophenyl)amino]-N-(cyclopropylmethoxy)-3,4-difluoro- |
212631-79-3 |
Picture 493.
|
$200 for 25 mg |
98% |
R-8090 |
3-(4-chlorophenyl)-1-propyl-3,4,5,7-tetrahydro-1H-purine-2,6-dione |
N/A |
Picture 494.
|
|
98% |
R-8091 |
Aceticacid,2-[[[(8BETA)-6-propylergolin-8-yl]methyl]thio]- |
478815-25-7 |
Picture 502.
|
|
98% |
R-8092 |
Carbamicacid, N,N-dimethyl-,5-[(1R)-2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]-1,3-phenyleneester |
788821-30-7 |
Picture 503.
|
|
98% |
R-8093 |
Carbamicacid, N,N-dimethyl-, C,C'-[5-[(1S)-2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]-1,3-phenylene]ester |
662138-64-9 |
Picture 515.
|
|
98% |
R-8094 |
(S)-1-(2-(((1r,3R,5R,7S)-3-hydroxyadamantan-1-yl)amino)acetyl)pyrrolidine-2-carbonitrile, Vildagliptin |
274901-16-5 |
Picture 523.
|
$180 for 1 g |
98% |
R-8095 |
Imidazo[2,1-b]oxazole,6-(4-fluorophenyl)- |
815597-09-2 |
Picture 539.
|
|
98% |
R-8096 |
Aceticacid,2-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenoxy]-,methylester |
194608-82-7 |
Picture 599.
|
$1200 for 1 g |
98% |
R-8097 |
2H,6H-Pyrimido[1,2-c][1,3]benzothiazin-6-imine,3,4-dihydro- |
72596-74-8 |
Picture 627.
|
|
98% |
R-8098 |
Dodecanamide,3-oxo-N-(tetrahydro-2-oxo-3-furanyl)- |
152833-54-0 |
Picture 647.
|
|
98% |
R-8099 |
2(5H)-Furanone,5-(bromomethylene)-3-butyl-,(5Z)- |
883456-52-8 |
Picture 648.
|
|
98% |
R-8100 |
Ethanone,1-(4-methylphenyl)-,2-(2-methyl-6-phenyl-4-pyrimidinyl)hydrazone |
330991-89-4 |
Picture 661.
|
|
98% |
R-8101 |
4(3H)-Quinazolinone,2-[1-[[2-(dimethylamino)ethyl]amino]ethyl]-3-phenyl- |
860002-89-7 |
Picture 684.
|
|
98% |
R-8102 |
Benzo[h]cinnoline-2(3H)-undecanoicacid,5,6-dihydro-3-imino- |
402519-05-5 |
Picture 685.
|
|
98% |
R-8103 |
3-Pyridinecarboxamide, N-[(3R)-9-amino-3,4,6,7-tetrahydro-4-oxo-1-phenylpyrrolo[3,2,1-jk][1,4]benzodiazepin-3-yl]- |
197894-84-1 |
Picture 686.
|
|
98% |
R-8104 |
Imidazo[2,1-b]oxazole,6-(4-fluorophenyl)-5-[2-(methylsulfonyl)-4-pyrimidinyl]- |
815594-06-0 |
Picture 690.
|
|
98% |
R-8105 |
N-(1-ethyl-2-(pyridin-3-yl)-1H-benzo[d]imidazol-6-yl)-4-hexyl-1-(thiophen-2-ylsulfonyl)piperazine-2-carboxamide |
N/A |
Picture 718.
|
|
98% |
R-8106 |
(Z)-5-((4-(4,4-difluoropiperidin-1-yl)quinazolin-6-yl)methylene)thiazolidine-2,4-dione |
N/A |
Picture 766.
|
|
98% |
R-8107 |
1-(4-((4-methylpiperazin-1-yl)methyl)phenyl)-3-(4-(trifluoromethyl)phenyl)urea |
N/A |
Picture 768.
|
|
98% |
R-8108 |
3-Pyridinecarboxamide,6-[(3-cyclobutyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)oxy]-N-methyl- |
720690-73-3 |
Picture 769.
|
|
98% |
R-8109 |
Urea, N-[3-(4-morpholinylcarbonyl)phenyl]-N'-[4-(trifluoromethyl)phenyl]- |
1005136-05-9 |
Picture 771.
|
|
98% |
R-8110 |
5-((4-bromo-2-chlorophenyl)amino)-4-fluoro-N-(2-hydroxyethyl)-1-methyl-1H-benzo[d]imidazole-6-carboxamide |
N/A |
Picture 775.
|
|
98% |
R-8111 |
(S)-4-((3-((4-(3,4-dichlorobenzyl)morpholin-2-yl)methyl)ureido)methyl)cyclohexanecarboxamide |
N/A |
Picture 779.
|
|
98% |
R-8112 |
Spiro[cyclopentane-1,7'(8'H)-[3H]imidazo[2,1-b]purin]-4'(5'H)-one,2'-([1,1'-biphenyl]-4-ylmethyl)-5'-methyl-3'-(phenylmethyl)- |
191982-37-3 |
Picture 796.
|
|
98% |
R-8113 |
((1S,3R)-1-isopropyl-3-(((3S,4S)-3-methoxytetrahydro-2H-pyran-4-yl)amino)cyclopentyl)(3-(trifluoromethyl)-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)methanone |
N/A |
Picture 798.
|
|
98% |
R-8114 |
3-Pyridinecarboxamide, N-(2,2-dimethylpropyl)-6-[3-fluoro-5-[(3-isoxazolylamino)carbonyl]-2-methylphenyl]- |
917223-75-7 |
Picture 800.
|
|
98% |
R-8115 |
[1,1'-Binaphthalene]-5,5'-disulfonicacid,4,4'-bis(phenylamino)-,potassiumsalt(1:2) |
65664-81-5 |
Picture 878.
|
|
98% |
R-8116 |
phenyl dichloroarsine |
696-28-6 |
Picture 887.
|
|
98% |
R-8117 |
Benzamide, N-[3-(1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-iodo-4-methyl- |
943320-49-8 |
Picture 894.
|
|
98% |
R-8118 |
Phenarsazine,10-chloro-5,10-dihydro- |
578-94-9 |
Picture 896.
|
|
98% |
R-8119 |
Cyclopent[b]indole-3-aceticacid,4-[(4-chlorophenyl)methyl]-7-fluoro-1,4-dihydro-5-(methylsulfonyl)- |
923580-09-0 |
Picture 943.
|
|
98% |
R-8120 |
(E)-N-((4,5-bis(3,4-dimethoxyphenyl)-2-nitrofuran-3-yl)methylene)aniline |
N/A |
Picture 956.
|
|
98% |
R-8121 |
N-((4,5-bis(2-chlorophenyl)-2-nitrofuran-3-yl)methyl)pyridin-2-amine |
N/A |
Picture 958.
|
|
98% |
R-8122 |
Urea, N-[4-fluoro-3-(4-morpholinylcarbonyl)phenyl]-N'-[4-(trifluoromethyl)phenyl]- |
1005136-07-1 |
Picture 997.
|
|
98% |
R-8123 |
2-Pyridinamine,4-[3-[5-(1-methylethyl)-2,5-diazabicyclo[2.2.1]hept-2-yl]-1H-indazol-1-yl]-N-[(1S)-1-phenylethyl]- |
861416-05-9 |
Picture 1002.
|
|
98% |
R-8124 |
8-Quinolinol,7-[[(4-nitrophenyl)amino]phenylmethyl]- |
5335-96-6 |
Picture 957.
|
|
98% |
R-8125 |
8-Quinolinol,7-[phenyl(2-pyridinylamino)methyl]- |
304685-32-3 |
Picture 998.
|
|
98% |
R-8126 |
2-(phenyl(pyridin-2-ylamino)methyl)naphthalen-1-ol |
N/A |
Picture 945.
|
|
98% |
R-8127 |
2-(((4-nitrophenyl)amino)(phenyl)methyl)naphthalen-1-ol |
N/A |
Picture 946.
|
|
98% |
R-8128 |
6-(phenyl(phenylamino)methyl)quinolin-8-ol |
N/A |
Picture 322.
|
|
98% |
R-8129 |
6-(benzo[d][1,3]dioxol-5-yl(pyridin-2-ylamino)methyl)quinolin-8-ol |
832104-47-9 |
Picture 323.
|
|
98% |
R-8130 |
6-(phenyl(pyridin-2-ylamino)methyl)quinolin-8-ol |
N/A |
Picture 324.
|
|
98% |
R-8131 |
8-Quinolinol,5-chloro-7-[(4-ethoxyphenyl)(3-pyridinylamino)methyl]- |
832109-44-1 |
Picture 327.
|
|
98% |
R-8132 |
7-((3-ethoxyphenyl)((4-methylpyridin-2-yl)amino)methyl)quinolin-8-ol |
N/A |
Picture 329.
|
|
98% |
R-8133 |
8-Quinolinol,7-[(5-chloro-2-methoxyphenyl)(3-pyridinylamino)methyl] |
832093-37-5 |
Picture 952.
|
|
98% |
R-8134 |
8-Quinolinol,7-[[2-(phenylmethoxy)phenyl](3-pyridinylamino)methyl]- |
915886-96-3 |
Picture 953.
|
|
98% |
R-8135 |
8-Quinolinol,7-[(4-chlorophenyl)(3-pyridinylamino)methyl]- |
832123-06-5 |
Picture 954.
|
|
98% |
R-8136 |
8-Quinolinol,7-[[4-(methylthio)phenyl](3-pyridinylamino)methyl]- |
832106-68-0 |
Picture 955.
|
|
98% |
R-8137 |
8-Quinolinol,7-[phenyl(8-quinolinylamino)methyl]- |
908813-78-5 |
Picture 1017.
|
|
98% |
R-8138 |
8-Quinolinol,7-[(3-pyridinylamino)[4-(trifluoromethyl)phenyl]methyl]- |
832092-56-5 |
Picture 1018.
|
|
98% |
R-8139 |
8-Quinolinol,7-[(2-chloro-6-fluorophenyl)[(4-methyl-2-pyridinyl)amino]methyl]-2-methyl- |
693823-26-6 |
Picture 1019.
|
|
98% |
R-8140 |
8-Quinolinol,7-[[(4-methyl-2-pyridinyl)amino][3-(2-propen-1-yloxy)phenyl]methyl]- |
692290-52-1 |
Picture 1020.
|
|
98% |
R-8141 |
8-Quinolinol,7-[(3-bromophenyl)[(4-methyl-2-pyridinyl)amino]methyl]-2-methyl- |
693832-54-1 |
Picture 1021.
|
|
98% |
R-8142 |
8-Quinolinol,7-[[(4-methyl-2-pyridinyl)amino](3-nitrophenyl)methyl]- |
353517-81-4 |
Picture 1022.
|
|
98% |
R-8143 |
Benzoicacid,3-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1(6H)-pyrimidinyl]-4-methyl- |
773104-07-7 |
Picture 1024.
|
|
98% |
R-8144 |
3-iodo-4-methyl-N-(3-((4-methylpiperazin-1-yl)methyl)-4-(trifluoromethyl)phenyl)benzamide |
N/A |
Picture 1030.
|
|
98% |
R-8145 |
D-erythro-2-D-galacto-Octopyranoside,methyl6,8-dideoxy-6-[[[(2S,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio- |
154-21-2 |
Picture 1041.
|
|
98% |
R-8146 |
10H-Benzo[4,5]cyclohepta[1,2-b]thiophen-10-one,4,9-dihydro-4-(4-piperidinylidene)- |
34580-20-6 |
Picture 1059.
|
|
98% |
R-8147 |
Sorafenib(BAY-43-9006) |
284461-73-0 |
Picture 1063.
|
|
98% |
R-8148 |
1-Piperidinepropanenitrile,4-methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-BETA-oxo-,(3R,4R)-Tofacitinib |
477600-75-2 |
Picture 1064.
|
$150 for 1 g $480 for 5 g |
98% |
R-8149 |
N-(4-(6-(tert-butyl)-8-(2,5-dioxopiperazin-1-yl)-5-methoxyquinolin-3-yl)phenyl)methanesulfonamide |
N/A |
Picture 1070.
|
|
98% |
R-8150 |
TAK-242 |
243984-11-4 |
Picture 1071.
|
$250 for 10 mg |
98% |
R-8151 |
(3R)-1-(benzo[d][1,3]dioxol-4-yl)-2-(2-carboxy-4,5-dichlorobenzoyl)-9-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid |
N/A |
Picture 1100.
|
|
98% |
R-8152 |
(3R)-ethyl2-(4,5-dichloro-2-(ethoxycarbonyl)benzoyl)-1-(3,5-difluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
N/A |
Picture 1107.
|
|
98% |
R-8153 |
INCB28050 |
N/A |
Picture 1117.
|
|
98% |
R-8154 |
Aceticacid,2-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenoxy]- |
79558-09-1 |
Picture 1122.
|
|
98% |
R-8155 |
2(1H)-Quinolinone,7-[4-[4-(2,3-dichlorophenyl)-1-piperazinyl]butoxy]-3,4-dihydro- |
129722-12-9 |
Picture 1169.
|
$150 for 1 g |
98% |
R-8156 |
(S)-5-(1-(tert-butylamino)-2-hydroxyethyl)-1,3-phenylenebis(dimethylcarbamate)hydrochloride |
N/A |
Picture 1189.
|
|
98% |
R-8157 |
3-Quinuclidinylbenzilate |
6581-06-2 |
Picture 1200.
|
$300 for 25 mg |
98% |
R-8158 |
Cyclopropanecarboxamide, N-[4-[[4-(4-methyl-1-piperazinyl)-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl]thio]phenyl]- |
639089-54-6 |
Picture 1211.
|
$150 for 100 mg |
98% |
R-8159 |
Urea, N-[3-(1,1-dimethylethyl)-1-(4-methylphenyl)-1H-pyrazol-5-yl]-N'-[4-[2-(4-morpholinyl)ethoxy]-1-naphthalenyl]- |
285983-48-4 |
Picture 1214.
|
$180 for 100 mg |
98% |
R-8160 |
11-(3-imino-1,5,6,10b-tetrahydrobenzo[h]cinnolin-2(3H)-yl)undecanoicacid |
N/A |
Picture 1222.
|
|
98% |
R-8161 |
4-((6aR,9S,10aR)-7-propyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl)-3-thioxobutanoicacid |
N/A |
Picture 1228.
|
|
98% |
R-8162 |
4-Isoxazolecarboxamide,5-methyl-N-[4-(trifluoromethyl)phenyl]- |
75706-12-6 |
Picture 1269.
|
|
98% |
R-8163 |
7H-1,2,3-Triazolo[4,5-d]pyrimidin-7-one,3,6-dihydro-5-(2-propoxyphenyl)Zaprinast |
37762-06-4 |
Picture 1270.
|
$850 for 1 g |
98% |
R-8164 |
11-(3-imino-5,6-dihydrobenzo[h]cinnolin-2(3H)-yl)-1-(4-(pyrimidin-2-yl)piperazin-1-yl)undecan-1-one |
402519-00-0 |
Picture 1275.
|
|
98% |
R-8165 |
5-Thiazolecarboxamide, N-(2-chloro-6-methylphenyl)-2-[[6-[4-(2-hydroxyethyl)-1-piperazinyl]-2-methyl-4-pyrimidinyl]amino]- |
302962-49-8 |
Picture 1289.
|
$150 for 5 g |
98% |
R-8166 |
2-(4-(4-chlorobenzyl)-7-fluoro-5-sulfamoyl-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)aceticacid |
2043025-96-1 |
Picture 1311.
|
|
98% |
R-8167 |
sodium(E)-5-(4-(methylsulfonyl)-3-nitrobenzamido)-2-(4-(4-(methylthio)-2-morpholinobenzamido)-2-sulfonatostyryl)benzenesulfonate |
N/A |
Picture 1328.
|
|
98% |
R-8168 |
Benzoicacid,4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]- |
19741-14-1 |
Picture 1331.
|
|
98% |
R-8169 |
1-(4-((4-ethyl-5-(trifluoromethyl)thiophen-2-yl)methoxy)-3-methylbenzyl)azetidin-3-ylformate |
N/A |
Picture 1364.
|
|
98% |
R-8170 |
N-[2-(1-piperidinyl)-5-(trifluoromethyl)phenyl]isonicotinamide |
218156-96-8 |
Picture 1420.
|
$100 for 10 mg $300 for 50 mg |
98% |
R-8171 |
ethyl3-[4-(1-methyl-3-phenylureido)phenylaminomethyl]benzoate |
1392278-32-8 |
Picture 1425.
|
|
98% |
R-8172 |
2-[(2-propan-2-yloxyphenyl)carbonylamino]-N-[3-(trifluoromethylsulfonyl)phenyl]benzamide |
1482500--76-4 |
Picture 1427.
|
|
98% |
R-8173 |
filgotinib |
1206161-97-8 |
Picture 1440.
|
$150 for 50 mg $250 for 100 mg |
98% |
R-8174 |
AZD5423 |
1034148-04-3 |
Picture 1442.
|
|
98% |
R-8175 |
4-cyclopropyl-5-(pyridin-4-yl)pyrimidin-2-amine |
947018-15-7 |
Picture 1444.
|
|
98% |
R-8176 |
5-(2-bromopyridin-4-yl)-4-cyclopropylpyrimidin-2-amine |
1607817-47-9 |
Picture 1445.
|
|
98% |
R-8177 |
N-methyl((1s,4s)-4-(methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino)cyclohexyl)methanesulfonamide |
N/A |
Picture 1447.
|
|
98% |
R-8178 |
2-(3-fluoro-3'-methoxy-biphenyl-4-ylcarbamoyl)-cyclopent-1-enecarboxylicacid |
717824-30-1 |
Picture 1448.
|
$120 for 10 mg $780 for 100 mg |
98% |
R-8179 |
N-(3-(1H-imidazol-1-yl)propyl)-5-(furan-2-yl)isoxazole-3-carboxamide |
909089-13-0 |
Picture 1449.
|
|
98% |
R-8180 |
5-((1R,2R)-2-aminocyclohexylamino)-7-(3,5-dimethoxyphenylamino)imidazo[1,2-f]pyrimidine-8-carboxamide |
725237-11-6 |
Picture 1450.
|
|
98% |
R-8181 |
3-((8-carbamoyl-7-(3,5-dimethoxyphenylamino)imidazo[1,2-f]pyrimidin-5-ylamino)methyl)benzoicacid |
N/A |
Picture 1451.
|
|
98% |
R-8182 |
methyl3-((8-carbamoyl-7-(3,5-dimethoxyphenylamino)imidazo[1,2-f]pyrimidin-5-ylamino)methyl)benzoate |
N/A |
Picture 1452.
|
|
98% |
R-8183 |
2-((5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyridin-3-yl)methyl)-6-methoxy-5-morpholino-2,3-dihydro-1H-inden-1-one |
1675206-64-0 |
Picture 1457.
|
|
98% |
R-8184 |
(E)-2-((5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyridin-3-yl)methylene)-6-methoxy-5-morpholino-2,3-dihydro-1H-inden-1-one |
1675207-38-1 |
Picture 1458.
|
|
98% |
R-8185 |
4,5-dihydro-1-methyl-8-[4-(2-quinolinylmethoxy)phenoxy]-1H-thieno[3,4-g]indazole-6-carboxamide |
364762-86-7 |
Picture 1474.
|
|
98% |
R-8186 |
1-{4-[3-fluoro-4-((3S,6R)-3-methyl-1,1-dioxo-6-phenyl-[1,2]thiazinan-2-ylmethyl)-phenyl]-piperazin-1-yl}ethanone |
N/A |
Picture 1478.
|
|
98% |
R-8187 |
N-tert-butyloxycarbonyl-3-(4-cyanophenyl)oxaziridine |
150884-56-3 |
Picture 1482.
|
|
98% |
R-8188 |
3-cyano-N-(3-(1-(cyclopentylcarbonyl)piperidin-4-yl)-1-methyl-1H-indol-5-yl)benzamide |
1648704-11-3 |
Picture 1483.
|
|
98% |
R-8189 |
2-cyclopropyl-6,7-dimethoxy-4-(4-(2-methoxyphenyl)piperazin-1-yl)quinazoline |
1448895-09-7 |
Picture 1520.
|
$200 for 5 mg $300 for 10 mg |
98% |
R-8190 |
4-(4-methyl-1H-indol-5-ylamino)-5-(5-((4-methylpiperazin-1-yl)methyl)benzofuran-2-yl)nicotinonitrile |
959969-71-2 |
Picture 1559.
|
|
98% |
R-8191 |
N-(benzo[d]thiazol-6-yl)-6-(isopropylsulfonyl)quinolin-4-amine |
N/A |
Picture 1574.
|
|
98% |
R-8192 |
2-ethyl-N-(4-(4-(morpholinosulfonyl)phenyl)thiazol-2-yl)butanamide |
1808260-45-8 |
Picture 1575.
|
|
98% |
R-8193 |
(R)-ethyl2-(4-fluorophenyl)-3-(6-oxo-1-o-tolyl-1,6-dihydropyridazin-3-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-6-carboxylate |
N/A |
Picture 1577.
|
|
98% |
R-8194 |
1,2-benzoxazol-3-yl4-acetamidobenzenesulfonate |
77408-67-4 |
Picture 1578.
|
|
98% |
R-8195 |
VU0366369 |
1222834-53-8 |
Picture 1580.
|
|
98% |
R-8196 |
fexofenadine |
83799-24-0 |
Picture 1586.
|
$330 for 1 g |
98% |
R-8197 |
cyanopindolol |
69906-85-0 |
Picture 1590.
|
|
98% |
R-8198 |
2-(5-fluoro-2-methyl-1-(4-(methylsulfonyl)phenylsulfonyl)indolin-3-yl)aceticacid |
N/A |
Picture 1641.
|
|
98% |
R-8199 |
ethyl2-(5-fluoro-2-methyl-1-(4-(methylsulfonyl)phenylsulfonyl)indolin-3-yl)acetate |
N/A |
Picture 1642.
|
|
98% |
R-8200 |
2-(3,4-Dichloro-benzylamino)-7-(2-morpholin-4-yl-ethyl)-1,7-dihydro-purin-6-one |
1275582-97-2 |
Picture 1645.
|
|
98% |
R-8201 |
4-(8-(dibenzo[b,d]thiophen-4-yl)benzo[b][1,4]dioxin-2-yl)morpholine |
N/A |
Picture 1666.
|
|
98% |
R-8202 |
4-Piperidin-4-ylidene-4,9-dihydro-1-thia-benzo[f]azulen-10-one |
1227458-03-8 |
Picture 1732.
|
|
98% |
R-8203 |
GSK650394 |
890842-28-1 |
Picture 1581.
|
$250 for 100 mg |
98% |
R-8204 |
SC514 |
354812-17-2 |
Picture 1582.
|
$150 for 50 mg |
98% |
R-8205 |
4-((((4-methoxyphenyl)sulfonyl)oxy)imino)-2,6-dimethylcyclohexa-2,5-dienone |
321695-57-2 |
Picture 1583.
|
|
98% |
R-8206 |
SR2211 |
1359164-11-6 |
Picture 1584.
|
|
98% |
R-8207 |
BMS-470539 |
N/A |
Picture 1585.
|
|
98% |
R-8208 |
AS1940477 |
928344-12-1 |
Picture 1579.
|
|
98% |
R-8209 |
AZ505 |
1035227-43-0 |
Picture 1568.
|
$230 for 10 mg |
98% |
R-8210 |
UBP710 |
1333111-40-2 |
Picture 1571.
|
|
98% |
R-8211 |
(R)-tert-butyl1-(4-butyryl-4-phenylpiperidin-1-yl)-3-(4-methoxyphenyl)-1-oxopropan-2-ylcarbamate |
457895-11-3 |
Picture 1572.
|
|
98% |
R-8212 |
SR9238 |
1416153-62-2 |
Picture 1573.
|
|
98% |
R-8213 |
VU0405601,2-[(1-bromonaphthalen-2-yl)oxy]-N-(pyridin-3-yl)acetamide |
712325-30-9 |
Picture 1421.
|
|
98% |
R-8214 |
(4-chloro-3-nitrophenyl)(4-(2-fluorophenyl)piperazin-1-yl)methanone |
432020-20-7 |
Picture 1422.
|
|
98% |
R-8215 |
CH-223191 |
301326-22-7 |
Picture 1423.
|
|
98% |
R-8216 |
ethyl4-(4-(2-methylbenzamido)piperidin-1-yl)piperidine-1-carboxylate |
N/A |
Picture 1424.
|
|
98% |
R-8217 |
2,2'-Sulfonylbis(3,4,6-trichlorophenol) |
1638-41-1 |
Picture 1412.
|
|
98% |
R-8218 |
2-(5-chloro-2-(thiazol-2-ylmethylamino)pyrimidin-4-ylamino)-6-fluorobenzamide |
1848232-20-1 |
Picture 1413.
|
|
98% |
R-8219 |
N-(12-cyanoindolizino[2,3-b]quinoxalin-2-yl)thiophene-2-carboxamide |
487020-03-1 |
Picture 1414.
|
|
98% |
R-8220 |
YK-3-237 |
1215281-19-8 |
Picture 1415.
|
|
98% |
R-8221 |
(E)-N'-(4-hydroxy-3-iodo-5-methoxybenzylidene)-2-fluorobenzohydrazide |
575447-68-6 |
Picture 1416.
|
|
98% |
R-8222 |
(E)-3-(4-bromophenyl)-1-(4-(4-methoxybenzoyl)piperazin-1-yl)prop-2-en-1-one |
1599432-08-2 |
Picture 1417.
|
$220 for 5 mg $320 for 10 mg |
98% |
R-8223 |
2-[(2,5-Dichloro-4-pyrimidinyl)amino]-6-fluorobenzamide |
1042434-90-1 |
Picture 1418.
|
|
98% |
R-8224 |
(Z)-1-(3-ethyl-5-hydroxybenzo[d]thiazol-2(3H)-ylidene)propan-2-one |
1169755-45-6 |
Picture 1419.
|
|
98% |
R-8225 |
isopropyl3,4,6-tri-O-acetyl-2-(acetylamino)-2-deoxy-BETA-D-glucopyranoside |
7772-85-2 |
Picture 1431.
|
|
98% |
R-8226 |
4-(6-(butylamino)-3-(4-(morpholinosulfonyl)phenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)cyclohexanol,UNC1062 |
1350549-36-8 1350549-37-9 |
Picture 1576.
|
|
98% |
S-9001 |
[1,1'-Biphenyl]-3-sulfonylchloride,4'-methoxy- |
799283-94-6 |
Picture 389.
|
$680 for 5 g |
98% |
S-9002 |
3-(2-methylbenzyl)benzene-1-sulfonylchloride |
1032507-41-7 |
Picture 370.
|
$580 for 1 g |
98% |
S-9003 |
3-(pyridin-3-yloxy)benzene-1-sulfonylchloridehydrochloride |
N/A |
Picture 371.
|
|
98% |
S-9004 |
4-(2-(trifluoromethyl)phenoxy)cyclohexane-1-sulfonylchloride |
N/A |
Picture 373.
|
|
98% |
S-9005 |
(3,4-dichlorophenyl)methanesulfonylchloride |
85952-30-3 |
Picture 383.
|
$320 for 5 g |
98% |
S-9006 |
Cyclopentanemethanesulfonylchloride |
242459-85-4 |
Picture 898.
|
$350 for 1 g |
98% |
S-9007 |
Benzenesulfonylchloride,3-(2-methylphenoxy)- |
885950-88-9 |
Picture 51.
|
$280 for 1 g $1200 for 5 g |
98% |
S-9008 |
Benzenesulfonylchloride,4-(3-pyridinyloxy)- |
694471-97-1 |
Picture 53.
|
$200 for 1 g $700 for 5 g |
98% |
S-9009 |
Benzenemethanesulfonylchloride,3,4-dichloro- |
85952-30-3 |
Picture 54.
|
$280 for 5 g |
98% |
S-9010 |
3-Pyridinemethanesulfonylchloride |
159290-96-7 |
Picture 58.
|
$500 for 1 g |
98% |
S-9011 |
Benzenemethanesulfonylchloride,4-chloro- |
6966-45-6 |
Picture 240.
|
|
98% |
S-9012 |
Benzeneethanesulfonylchloride,BETA-phenyl-2-(trifluoromethyl)- |
885950-97-0 |
Picture 259.
|
$480 for 1 g |
98% |
S-9013 |
[1,1'-Biphenyl]-3-sulfonylchloride,4'-chloro- |
501697-62-7 |
Picture 271.
|
$200 for 1 g $750 for 5 g |
98% |
S-9014 |
[1,1'-Biphenyl]-3-sulfonylchloride |
65685-01-0 |
Picture 277.
|
$200 for 1 g $750 for 5 g |
98% |
S-9015 |
[1,1'-Biphenyl]-3-sulfonylchloride,4'-fluoro- |
861248-58-0 |
Picture 279.
|
$200 for 1 g $750 for 5 g |
98% |
S-9016 |
Benzenesulfonylchloride,4-(4-methoxyphenoxy)- |
370065-09-1 |
Picture 299.
|
$480 for 1 g |
98% |
S-9017 |
Benzenesulfonylchloride,4-[2-(trifluoromethyl)phenoxy]- |
885950-91-4 |
Picture 376.
|
$450 for 1 g |
98% |
S-9018 |
4-(2-Chlorophenoxy)phenylsulfonylchloride |
610277-84-4 |
Picture 377.
|
$380 for 1 g |
98% |
S-9019 |
Benzenemethanesulfonylchloride,4-methyl- |
51419-59-1 |
Picture 379.
|
$150 for 10 g |
98% |
S-9020 |
Benzenesulfonylchloride,4-(3,4-dichlorophenoxy)- |
501697-77-4 |
Picture 382.
|
$180 for 1 g $480 for 5 g |
98% |
S-9021 |
Benzenesulfonylchloride,4-(4-fluorophenoxy)- |
192329-91-2 |
Picture 862.
|
$140 for 1 g $490 for 5 g |
98% |
S-9022 |
[1,1'-Biphenyl]-2-sulfonylchloride,4'-methoxy- |
173253-50-4 |
Picture 884.
|
$490 for 1 g |
98% |
S-9023 |
3-(2-chloro-3,6-dimethylphenoxy)benzene-1-sulfonylchloride |
N/A |
Picture 1079.
|
|
98% |
S-9024 |
Cyclopropanesulfonylchloride,1-(2-propen-1-yl)- |
923032-59-1 |
Picture 1080.
|
$190 for 1 g $550 for 5 g |
98% |
S-9025 |
3-(pyridin-3-yloxy)benzene-1-sulfonylchloridehydrochloride |
N/A |
Picture 1164.
|
|
98% |
S-9026 |
4'-methyl-2-biphenylsulphonylchloride |
173253-46-8 |
Picture 1634.
|
$550 for 1 g |
98% |
S-9027 |
4-pyridin-3-yloxybenzenesulfonylchloride;hydrochloride |
1171901-60-2 |
Picture 1670.
|
$250 for 1 g $750 for 5 g |
98% |
S-9028 |
lithium4-(4-methylbenzyl)benzenesulfonate |
N/A |
Picture 280.
|
|
98% |
S-9029 |
sodium[1,1'-biphenyl]-3-sulfonate |
N/A |
Picture 284.
|
|
98% |
S-9030 |
lithium4-(4-methoxyphenoxy)benzenesulfinate |
N/A |
Picture 293.
|
|
98% |
S-9031 |
sodium4'-methoxy-[1,1'-biphenyl]-3-sulfonate |
N/A |
Picture 397.
|
|
98% |
S-9032 |
4'-chloro-[1,1'-biphenyl]-2-sulfonicacid |
N/A |
Picture 839.
|
|
98% |
S-9033 |
lithium4-(2-chlorobenzyl)benzenesulfinate |
N/A |
Picture 1043.
|
|
98% |
S-9034 |
[1,1'-Biphenyl]-2-sulfonicacid,4'-methoxy- |
1450926-02-9 |
Picture 886.
|
$390 for 1 g |
98% |
S-9035 |
lithium4-(2-(trifluoromethyl)phenoxy)benzenesulfinate |
N/A |
Picture 1078.
|
|
98% |
S-9036 |
pyridin-3-ylmethanesulfonic acid hydrochloride |
N/A |
Picture 1081.
|
|
98% |
S-9037 |
lithium4-(4-methylbenzyl)benzenesulfonate |
N/A |
Picture 1148.
|
|
98% |
S-9038 |
sodium[1,1'-biphenyl]-3-sulfonate |
N/A |
Picture 1152.
|
|
98% |
S-9039 |
lithium4-(4-methoxyphenoxy)benzenesulfinate |
N/A |
Picture 1153.
|
|
98% |
S-9040 |
sodium4'-methoxy-[1,1'-biphenyl]-3-sulfonate |
N/A |
Picture 1172.
|
|
98% |
S-9041 |
4'-chloro-[1,1'-biphenyl]-2-sulfonicacid |
N/A |
|
98% |
S-9042 |
lithium4-(2-chlorobenzyl)benzenesulfinate |
N/A |
Picture 1373.
|
|
98% |
S-9043 |
4-(methylsulfonyl)morpholine4-(methylthio)benzoate |
299181-53-6 |
Picture 471.
|
|
98% |
S-9044 |
p-tolylsulfazidite |
N/A |
Picture 656.
|
|
98% |
S-9045 |
Benzene,(ethenylsulfonyl)- |
5535-48-8 |
Picture 194.
|
|
98% |
S-9046 |
Benzenecarbothioicacid, S-2-propen-1-ylester |
41820-25-1 |
Picture 792.
|
|
98% |
S-9047 |
Benzene,1,4-difluoro-2-(methylsulfonyl)- |
236739-03-0 |
Picture 944.
|
$150 for 1 g $650 for 5 g |
98% |
S-9048 |
Acetonitrile,2-(methylsulfonyl)- |
2274-42-2 |
Picture 1238.
|
$220 for 25 g |
98% |
S-9049 |
sodium(3R)-3,4-dihydroxytetrahydro-2H-pyran-4-sulfonate |
N/A |
Picture 1333.
|
|
98% |
S-9050 |
1-butyl3-chloro-1-propanesulfonate |
146475-47-0 |
Picture 1409.
|
$490 for 5 g |
98% |
S-9051 |
1-butylcyclopropanesulfonate,butylcyclopropanesulfonate |
83635-12-5 |
Picture 1410.
|
$150 for 1 g $580 for 5 g |
98% |
S-9052 |
butyl1-allylcyclopropane-1-sulfonate |
923032-56-8 |
Picture 1411.
|
$390 for 1 g |
98% |
S-9053 |
Dibenzothiophenesulfoxide |
1013-23-6 |
Picture 1725.
|
$150 for 1 g $450 for 5 g |
98% |
S-9054 |
lithium4-(2-(trifluoromethyl)phenoxy)benzenesulfinate |
N/A |
Picture 50.
|
|
98% |
St-9601 |
Estra-1,3,5(10)-triene-3,17-diol,2-methoxy-,(17BETA)- |
362-07-2 |
Picture 867.
|
|
98% |
St-9602 |
Estra-1,3,5(10)-triene-3,17-diol,2-methoxy-,17-acetate,(17BETA)- |
52717-98-3 |
Picture 407.
|
|
98% |
St-9603 |
Estra-1,3,5(10)-triene-3,17-diol,2-iodo-,17-acetate,(17BETA)-(9CI) |
110370-91-7 |
Picture 401.
|
|
98% |
St-9604 |
1,3,5(10)-Estratriene-17-carboxylicacid,3-hydroxy-,methylester,acetate(5CI) |
891488-62-3 |
Picture 385.
|
|
98% |
St-9605 |
Estra-1,3,5(10)-trien-17-ol,3-methoxy-,(17BETA)- |
1035-77-4 |
Picture 192.
|
|
98% |
St-9606 |
Estra-1,3,5(10)-triene-3,17-diol,2-iodo-,(17BETA)- |
24381-12-2 |
Picture 193.
|
|
98% |
St-9607 |
2-(3-(hexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanamido)aceticacid |
N/A |
Picture 1295.
|
|
98% |
St-9608 |
Androst-5-ene-7,17-dione,3-(acetyloxy)-,cyclic17-(1,2-ethanediylacetal),(3BETA)- |
40573-86-2 |
Picture 1061.
|
|
98% |
St-9609 |
Dihydrotestosteronecyclopentyl-propionate |
N/A |
Picture 1264.
|
|
98% |
St-9610 |
(1aR,11aS)-2,7-dihydroxy-6a-methyl-1a,4,4a,4b,5,6,6a,7,8,9,9a,9b,10,11-tetradecahydrocyclopenta[7,8]phenanthro[1,10a-b]oxirene-3-carbonitrile |
13647-35-3 |
Picture 242.
|
|
98% |
St-9611 |
4-((3R,7R,12S)-3,7,12-trihydroxy-13-methylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoicacid |
N/A |
Picture 249.
|
|
98% |
St-9612 |
2-(3-((3R,7R,10S)-3,7-dihydroxy-10-methylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanamido)aceticacid |
N/A |
Picture 1036.
|
|
98% |
St-9613 |
(10R,13S)-10,13-dimethyl-1,2,3,4,7,8,9,10,11,12,13,14,15,16-tetradecahydrospiro[cyclopenta[a]phenanthrene-17,2'-[1,3]dioxolan]-3-ylacetate |
N/A |
Picture 1053.
|
|
98% |
St-9614 |
Cholan-24-oicacid,3,7,12-trihydroxy-,methylester,(32,5BETA,72,12BETA)-(9CI) |
71883-63-1 |
Picture 236.
|
|
98% |
St-9615 |
N,N-diethyl-1,6a-dimethyl-2-oxohexadecahydro-1H-indeno[5,4-f]quinoline-7-carboxamide |
N/A |
Picture 246.
|
|
98% |
St-9616 |
3-methoxy-13-methylhexadecahydro-1H-cyclopenta[a]phenanthren-17-ol |
N/A |
Picture 258.
|
|
98% |
St-9617 |
Androst-4-ene-3,17-dione,11-hydroxy-,(11BETA)- |
382-44-5 |
Picture 260.
|
|
98% |
St-9618 |
N,N-diethyl-1,4,6a-trimethyl-2-oxohexadecahydro-1H-indeno[5,4-f]quinoline-7-carboxamide |
N/A |
Picture 263.
|
|
98% |
St-9619 |
Androst-4-en-3-one,7,17-dihydroxy-,(72,17BETA)- |
62-83-9 |
Picture 265.
|
|
98% |
St-9620 |
(17S)-3,13,17-trimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-5H-cyclopenta[a]phenanthren-17-ol |
N/A |
Picture 274.
|
|
98% |
St-9621 |
Cyclopenta[5,6]naphtho[1,2-c]pyran-2(1H)-one,tetradecahydro-7-hydroxy-4a,6a,7-trimethyl-,(4aS,4bS,6aS,7S,9aS,9bR,11aS)- |
53-39-4 |
Picture 298.
|
|
98% |
St-9622 |
2-Phenanthrenecarboxylicacid,4b,5,6,7,8,8a,9,10-octahydro-7-hydroxy-4b-(phenylmethyl)-7-(trifluoromethyl)-,methylester,(4bS,7R,8aR)- |
305830-57-3 |
Picture 315.
|
|
98% |
St-9623 |
2-Phenanthrenecarboxylicacid,4b,5,6,7,9,10-hexahydro-7-oxo-4b-(phenylmethyl)-,methylester,(4bS)- |
1400926-93-3 |
Picture 316.
|
|
98% |
St-9624 |
2-Phenanthrenecarboxylicacid,4b,5,6,7,8,8a,9,10-octahydro-7-hydroxy-4b-(phenylmethyl)-7-(trifluoromethyl)-,methylester,(4bS,8aS)- |
1400926-33-1 |
Picture 317.
|
|
98% |
St-9625 |
2-Phenanthrenecarboxamide,4b,5,6,7,8,8a,9,10-octahydro-7-hydroxy-N-(2-methyl-3-pyridinyl)-4b-(phenylmethyl)-7-(trifluoromethyl)-,(4bS,7R,8aR)- |
1044535-52-5 |
Picture 318.
|
|
98% |
St-9626 |
Phenanthrene,7-bromo-2-ethoxy-3,4,4a,9-tetrahydro-4a-(phenylmethyl)-,(4aS)- |
418772-24-4 |
Picture 319.
|
|
98% |
St-9627 |
2-Phenanthrenecarboxylicacid,4b,5,6,7,8,8a,9,10-octahydro-7-oxo-4b-(phenylmethyl)-,methylester,(4bS,8aS)- |
1400926-32-0 |
Picture 320.
|
|
98% |
St-9628 |
(10S)-10,17,17-trimethyl-4,5,6,7,8,9,10,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one |
1423-85-4 |
Picture 445.
|
|
98% |
St-9629 |
Androst-5-ene-7,17-dione,3-(acetyloxy)-,cyclic17-(1,2-ethanediylacetal) |
952654-90-9 |
Picture 679.
|
|
98% |
St-9630 |
Pregn-5-en-20-one,3,17-dihydroxy-,(3BETA)- |
387-79-1 |
Picture 897.
|
$350 for 1 g |
98% |
St-9631 |
Androst-5-en-17-one,3-(acetyloxy)-,cyclic17-(1,2-ethanediylacetal),(3BETA)- |
17921-59-4 |
Picture 1062.
|
|
98% |
St-9632 |
(1aR,11aS)-2,7-dihydroxy-4a,6a-dimethyl-1a,4,4a,4b,5,6,6a,7,8,9,9a,9b,10,11-tetradecahydrocyclopenta[7,8]phenanthro[1,10a-b]oxirene-3-carbonitrile |
13647-35-3 |
Picture 1138.
|
$150 for 1 g |
98% |
St-9633 |
4-((3R,7R,12S)-3,7,12-trihydroxy-13-methylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoicacid |
N/A |
Picture 1140.
|
|
98% |
St-9634 |
(10R,13S)-10,13-dimethyl-1,2,3,4,7,8,9,10,11,12,13,14,15,16-tetradecahydrospiro[cyclopenta[a]phenanthrene-17,2'-[1,3]dioxolan]-3-ylacetate |
17921-59-4 |
Picture 1375.
|
|
98% |
St-9635 |
cholesterol,cholest-5-en-3BETA-ol |
57-88-5 |
Picture 1679.
|
|
98% |
St-9636 |
cholesterylacetate |
604-35-3 |
Picture 1680.
|
|
98% |